From df132a178189d0b655afedae7a38a4068c022547 Mon Sep 17 00:00:00 2001 From: Federico Mandelli <federico.mandelli@skywarder.eu> Date: Fri, 6 Oct 2023 15:06:48 +0000 Subject: [PATCH] [OBSW] Roccaraso Payload flight software --- CMakeLists.txt | 14 +- cmake/dependencies.cmake | 24 +- src/boards/Payload/Actuators/Actuators.cpp | 268 +++++++ src/boards/Payload/Actuators/Actuators.h | 138 ++++ .../AltitudeTrigger/AltitudeTrigger.cpp | 101 +++ .../Payload/AltitudeTrigger/AltitudeTrigger.h | 81 +++ src/boards/Payload/BoardScheduler.cpp | 66 ++ src/boards/Payload/BoardScheduler.h | 62 ++ src/boards/Payload/Buses.h | 55 ++ src/boards/Payload/CanHandler/CanHandler.cpp | 149 ++++ src/boards/Payload/CanHandler/CanHandler.h | 90 +++ src/boards/Payload/Configs/ActuatorsConfigs.h | 68 ++ src/boards/Payload/Configs/CanHandlerConfig.h | 36 + .../Payload/Configs/FlightModeManagerConfig.h | 30 + .../Configs/FlightStatsRecorderConfig.h | 33 + src/boards/Payload/Configs/NASConfig.h | 67 ++ src/boards/Payload/Configs/PinHandlerConfig.h | 34 + src/boards/Payload/Configs/RadioConfig.h | 46 ++ src/boards/Payload/Configs/SensorsConfig.h | 124 ++++ .../Payload/Configs/VerticalVelocityConfig.h | 37 + src/boards/Payload/Configs/WESConfig.h | 45 ++ src/boards/Payload/Configs/WingConfig.h | 62 ++ .../FlightStatsRecorder.cpp | 177 +++++ .../FlightStatsRecorder/FlightStatsRecorder.h | 80 ++ src/boards/Payload/PinHandler/PinHandler.cpp | 75 ++ src/boards/Payload/PinHandler/PinHandler.h | 66 ++ src/boards/Payload/Radio/Radio.cpp | 517 +++++++++++++ src/boards/Payload/Radio/Radio.h | 102 +++ .../Payload/Sensors/RotatedIMU/RotatedIMU.cpp | 103 +++ .../Payload/Sensors/RotatedIMU/RotatedIMU.h | 120 +++ .../Sensors/RotatedIMU/RotatedIMUData.h | 60 ++ src/boards/Payload/Sensors/SensorData.h | 97 +++ src/boards/Payload/Sensors/Sensors.cpp | 687 ++++++++++++++++++ src/boards/Payload/Sensors/Sensors.h | 180 +++++ .../FlightModeManager/FlightModeManager.cpp | 668 +++++++++++++++++ .../FlightModeManager/FlightModeManager.h | 126 ++++ .../FlightModeManager/FlightModeManagerData.h | 63 ++ .../NASController/NASController.cpp | 370 ++++++++++ .../NASController/NASController.h | 99 +++ .../NASController/NASControllerData.h | 56 ++ .../WingController/WingController.cpp | 472 ++++++++++++ .../WingController/WingController.h | 182 +++++ .../WingController/WingControllerData.h | 56 ++ .../Payload/TMRepository/TMRepository.cpp | 616 ++++++++++++++++ .../Payload/TMRepository/TMRepository.h | 52 ++ .../VerticalVelocityTrigger.cpp | 87 +++ .../VerticalVelocityTrigger.h | 90 +++ .../WindEstimationScheme/WindEstimation.cpp | 215 ++++++ .../WindEstimationScheme/WindEstimation.h | 130 ++++ .../WindEstimationScheme/WindEstimationData.h | 46 ++ .../Payload/Wing/AutomaticWingAlgorithm.cpp | 181 +++++ .../Payload/Wing/AutomaticWingAlgorithm.h | 97 +++ src/boards/Payload/Wing/FileWingAlgorithm.cpp | 68 ++ src/boards/Payload/Wing/FileWingAlgorithm.h | 91 +++ .../Guidance/ClosedLoopGuidanceAlgorithm.cpp | 42 ++ .../Guidance/ClosedLoopGuidanceAlgorithm.h | 57 ++ .../EarlyManeuverGuidanceAlgorithm.cpp | 150 ++++ .../EarlyManeuversGuidanceAlgorithm.h | 112 +++ .../Payload/Wing/Guidance/GuidanceAlgorithm.h | 61 ++ src/boards/Payload/Wing/WingAlgorithm.cpp | 122 ++++ src/boards/Payload/Wing/WingAlgorithm.h | 107 +++ src/boards/Payload/Wing/WingAlgorithmData.h | 57 ++ .../Payload/Wing/WingTargetPositionData.h | 58 ++ src/entrypoints/Payload/payload-entry.cpp | 318 ++++++++ .../payload-test-VerticalVelocityTrigger.cpp | 166 +++++ 65 files changed, 8904 insertions(+), 5 deletions(-) create mode 100644 src/boards/Payload/Actuators/Actuators.cpp create mode 100644 src/boards/Payload/Actuators/Actuators.h create mode 100644 src/boards/Payload/AltitudeTrigger/AltitudeTrigger.cpp create mode 100644 src/boards/Payload/AltitudeTrigger/AltitudeTrigger.h create mode 100644 src/boards/Payload/BoardScheduler.cpp create mode 100644 src/boards/Payload/BoardScheduler.h create mode 100644 src/boards/Payload/Buses.h create mode 100644 src/boards/Payload/CanHandler/CanHandler.cpp create mode 100644 src/boards/Payload/CanHandler/CanHandler.h create mode 100644 src/boards/Payload/Configs/ActuatorsConfigs.h create mode 100644 src/boards/Payload/Configs/CanHandlerConfig.h create mode 100644 src/boards/Payload/Configs/FlightModeManagerConfig.h create mode 100644 src/boards/Payload/Configs/FlightStatsRecorderConfig.h create mode 100644 src/boards/Payload/Configs/NASConfig.h create mode 100644 src/boards/Payload/Configs/PinHandlerConfig.h create mode 100644 src/boards/Payload/Configs/RadioConfig.h create mode 100644 src/boards/Payload/Configs/SensorsConfig.h create mode 100644 src/boards/Payload/Configs/VerticalVelocityConfig.h create mode 100644 src/boards/Payload/Configs/WESConfig.h create mode 100644 src/boards/Payload/Configs/WingConfig.h create mode 100644 src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.cpp create mode 100644 src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.h create mode 100644 src/boards/Payload/PinHandler/PinHandler.cpp create mode 100644 src/boards/Payload/PinHandler/PinHandler.h create mode 100644 src/boards/Payload/Radio/Radio.cpp create mode 100644 src/boards/Payload/Radio/Radio.h create mode 100644 src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.cpp create mode 100644 src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.h create mode 100644 src/boards/Payload/Sensors/RotatedIMU/RotatedIMUData.h create mode 100644 src/boards/Payload/Sensors/SensorData.h create mode 100644 src/boards/Payload/Sensors/Sensors.cpp create mode 100644 src/boards/Payload/Sensors/Sensors.h create mode 100644 src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.cpp create mode 100644 src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.h create mode 100644 src/boards/Payload/StateMachines/FlightModeManager/FlightModeManagerData.h create mode 100644 src/boards/Payload/StateMachines/NASController/NASController.cpp create mode 100644 src/boards/Payload/StateMachines/NASController/NASController.h create mode 100644 src/boards/Payload/StateMachines/NASController/NASControllerData.h create mode 100644 src/boards/Payload/StateMachines/WingController/WingController.cpp create mode 100644 src/boards/Payload/StateMachines/WingController/WingController.h create mode 100644 src/boards/Payload/StateMachines/WingController/WingControllerData.h create mode 100644 src/boards/Payload/TMRepository/TMRepository.cpp create mode 100644 src/boards/Payload/TMRepository/TMRepository.h create mode 100644 src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.cpp create mode 100644 src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.h create mode 100644 src/boards/Payload/WindEstimationScheme/WindEstimation.cpp create mode 100644 src/boards/Payload/WindEstimationScheme/WindEstimation.h create mode 100644 src/boards/Payload/WindEstimationScheme/WindEstimationData.h create mode 100644 src/boards/Payload/Wing/AutomaticWingAlgorithm.cpp create mode 100644 src/boards/Payload/Wing/AutomaticWingAlgorithm.h create mode 100644 src/boards/Payload/Wing/FileWingAlgorithm.cpp create mode 100644 src/boards/Payload/Wing/FileWingAlgorithm.h create mode 100644 src/boards/Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.cpp create mode 100644 src/boards/Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.h create mode 100644 src/boards/Payload/Wing/Guidance/EarlyManeuverGuidanceAlgorithm.cpp create mode 100644 src/boards/Payload/Wing/Guidance/EarlyManeuversGuidanceAlgorithm.h create mode 100644 src/boards/Payload/Wing/Guidance/GuidanceAlgorithm.h create mode 100644 src/boards/Payload/Wing/WingAlgorithm.cpp create mode 100644 src/boards/Payload/Wing/WingAlgorithm.h create mode 100644 src/boards/Payload/Wing/WingAlgorithmData.h create mode 100644 src/boards/Payload/Wing/WingTargetPositionData.h create mode 100644 src/entrypoints/Payload/payload-entry.cpp create mode 100644 src/tests/Payload/payload-test-VerticalVelocityTrigger.cpp diff --git a/CMakeLists.txt b/CMakeLists.txt index 239e46323..65a2c2f39 100644 --- a/CMakeLists.txt +++ b/CMakeLists.txt @@ -52,6 +52,16 @@ target_include_directories(main-entry-euroc PRIVATE ${OBSW_INCLUDE_DIRS}) target_compile_definitions(main-entry-euroc PRIVATE EUROC) sbs_target(main-entry-euroc stm32f767zi_skyward_death_stack_v4) +add_executable(payload-entry-roccaraso src/entrypoints/Payload/payload-entry.cpp ${PAYLOAD_COMPUTER}) +target_include_directories(payload-entry-roccaraso PRIVATE ${OBSW_INCLUDE_DIRS}) +target_compile_definitions(payload-entry-roccaraso PRIVATE ROCCARASO) +sbs_target(payload-entry-roccaraso stm32f767zi_skyward_death_stack_v4) + +add_executable(payload-entry-euroc src/entrypoints/Payload/payload-entry.cpp ${PAYLOAD_COMPUTER}) +target_include_directories(payload-entry-euroc PRIVATE ${OBSW_INCLUDE_DIRS}) +target_compile_definitions(payload-entry-euroc PRIVATE EUROC) +sbs_target(payload-entry-euroc stm32f767zi_skyward_death_stack_v4) + add_executable(motor-entry src/entrypoints/Motor/motor-entry.cpp ${MOTOR_SOURCES}) target_include_directories(motor-entry PRIVATE ${OBSW_INCLUDE_DIRS}) sbs_target(motor-entry stm32f767zi_gemini_motor) @@ -63,7 +73,3 @@ sbs_target(rig-entry stm32f429zi_skyward_rig) add_executable(con_rig-entry src/entrypoints/con_RIG/con_rig-entry.cpp ${CON_RIG_COMPUTER}) target_include_directories(con_rig-entry PRIVATE ${OBSW_INCLUDE_DIRS}) sbs_target(con_rig-entry stm32f429zi_stm32f4discovery) - -#-----------------------------------------------------------------------------# -# Test entrypoints # -#-----------------------------------------------------------------------------# diff --git a/cmake/dependencies.cmake b/cmake/dependencies.cmake index da4dc6d1f..65860823f 100644 --- a/cmake/dependencies.cmake +++ b/cmake/dependencies.cmake @@ -25,7 +25,7 @@ set(OBSW_INCLUDE_DIRS src/hardware_in_the_loop ) -set(HIL +set(HIL src/hardware_in_the_loop/HIL/HILFlightPhasesManager.cpp src/hardware_in_the_loop/HIL/HILTransceiver.cpp ) @@ -73,3 +73,25 @@ set(CON_RIG_COMPUTER src/boards/con_RIG/Radio/Radio.cpp src/boards/con_RIG/BoardScheduler.cpp ) + +set(PAYLOAD_COMPUTER + src/boards/Payload/Actuators/Actuators.cpp + src/boards/Payload/CanHandler/CanHandler.cpp + src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.cpp + src/boards/Payload/Sensors/Sensors.cpp + src/boards/Payload/BoardScheduler.cpp + src/boards/Payload/PinHandler/PinHandler.cpp + src/boards/Payload/Radio/Radio.cpp + src/boards/Payload/TMRepository/TMRepository.cpp + src/boards/Payload/StateMachines/NASController/NASController.cpp + src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.cpp + src/boards/Payload/StateMachines/WingController/WingController.cpp + src/boards/Payload/AltitudeTrigger/AltitudeTrigger.cpp + src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.cpp + src/boards/Payload/Wing/AutomaticWingAlgorithm.cpp + src/boards/Payload/Wing/Guidance/EarlyManeuverGuidanceAlgorithm.cpp + src/boards/Payload/Wing/FileWingAlgorithm.cpp + src/boards/Payload/Wing/WingAlgorithm.cpp + src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.cpp + src/boards/Payload/WindEstimationScheme/WindEstimation.cpp +) diff --git a/src/boards/Payload/Actuators/Actuators.cpp b/src/boards/Payload/Actuators/Actuators.cpp new file mode 100644 index 000000000..759aef675 --- /dev/null +++ b/src/boards/Payload/Actuators/Actuators.cpp @@ -0,0 +1,268 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Alberto Nidasio, Federico Lolli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "Actuators.h" + +#include <Payload/BoardScheduler.h> +#include <Payload/Configs/ActuatorsConfigs.h> +#include <interfaces-impl/hwmapping.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +using namespace miosix; +using namespace Boardcore; +using namespace Payload::ActuatorsConfigs; + +namespace Payload +{ + +Actuators::Actuators(Boardcore::TaskScheduler* sched) : scheduler(sched) +{ + leftServo = new Servo(SERVO_1_TIMER, SERVO_1_PWM_CH, LEFT_SERVO_MIN_PULSE, + LEFT_SERVO_MAX_PULSE); + rightServo = new Servo(SERVO_2_TIMER, SERVO_2_PWM_CH, RIGHT_SERVO_MIN_PULSE, + RIGHT_SERVO_MAX_PULSE); + buzzer = new PWM(BUZZER_TIMER, BUZZER_FREQUENCY); + buzzer->setDutyCycle(BUZZER_CHANNEL, BUZZER_DUTY_CYCLE); + camOff(); +} + +bool Actuators::start() +{ + // Servos + enableServo(PARAFOIL_LEFT_SERVO); + setServo(PARAFOIL_LEFT_SERVO, 0); + enableServo(PARAFOIL_RIGHT_SERVO); + setServo(PARAFOIL_RIGHT_SERVO, 0); + + // Signaling Devices configurations + + return scheduler->addTask([&]() { updateBuzzer(); }, BUZZER_UPDATE_PERIOD, + TaskScheduler::Policy::RECOVER) != 0; +} + +bool Actuators::setServo(ServosList servoId, float percentage) +{ + switch (servoId) + { + case PARAFOIL_LEFT_SERVO: + { + miosix::Lock<miosix::FastMutex> ll(leftServoMutex); + leftServo->setPosition(percentage); + Logger::getInstance().log(leftServo->getState()); + break; + } + case PARAFOIL_RIGHT_SERVO: + { + miosix::Lock<miosix::FastMutex> lr(rightServoMutex); + rightServo->setPosition(percentage); + Logger::getInstance().log(rightServo->getState()); + break; + } + default: + { + return false; + } + } + + return true; +} + +bool Actuators::setServoAngle(ServosList servoId, float angle) +{ + switch (servoId) + { + case PARAFOIL_LEFT_SERVO: + { + miosix::Lock<miosix::FastMutex> ll(leftServoMutex); + leftServo->setPosition(angle / LEFT_SERVO_ROTATION); + Logger::getInstance().log(leftServo->getState()); + break; + } + case PARAFOIL_RIGHT_SERVO: + { + miosix::Lock<miosix::FastMutex> lr(rightServoMutex); + rightServo->setPosition(angle / RIGHT_SERVO_ROTATION); + Logger::getInstance().log(rightServo->getState()); + break; + } + default: + { + return false; + } + } + + return true; +} + +bool Actuators::wiggleServo(ServosList servoId) +{ + + if (!setServo(servoId, 1)) + { + return false; + } + Thread::sleep(1000); + return setServo(servoId, 0); +} + +bool Actuators::enableServo(ServosList servoId) +{ + switch (servoId) + { + case PARAFOIL_LEFT_SERVO: + { + miosix::Lock<miosix::FastMutex> ll(leftServoMutex); + leftServo->enable(); + break; + } + case PARAFOIL_RIGHT_SERVO: + { + miosix::Lock<miosix::FastMutex> lr(rightServoMutex); + rightServo->enable(); + break; + } + default: + return false; + } + + return true; +} + +bool Actuators::disableServo(ServosList servoId) +{ + switch (servoId) + { + case PARAFOIL_LEFT_SERVO: + { + miosix::Lock<miosix::FastMutex> ll(leftServoMutex); + leftServo->disable(); + break; + } + case PARAFOIL_RIGHT_SERVO: + { + miosix::Lock<miosix::FastMutex> lr(rightServoMutex); + rightServo->disable(); + break; + } + default: + return false; + } + + return true; +} + +float Actuators::getServoPosition(ServosList servoId) +{ + + switch (servoId) + { + case PARAFOIL_LEFT_SERVO: + { + miosix::Lock<miosix::FastMutex> ll(leftServoMutex); + return leftServo->getPosition(); + } + case PARAFOIL_RIGHT_SERVO: + { + miosix::Lock<miosix::FastMutex> lr(rightServoMutex); + return rightServo->getPosition(); + } + default: + return 0; + } + + return 0; +} + +float Actuators::getServoAngle(ServosList servoId) +{ + switch (servoId) + { + case PARAFOIL_LEFT_SERVO: + { + miosix::Lock<miosix::FastMutex> ll(leftServoMutex); + return leftServo->getPosition() * LEFT_SERVO_ROTATION; + } + case PARAFOIL_RIGHT_SERVO: + { + miosix::Lock<miosix::FastMutex> lr(rightServoMutex); + return rightServo->getPosition() * RIGHT_SERVO_ROTATION; + } + default: + return 0; + } + + return 0; +} + +void Actuators::cuttersOn() { gpios::cut_trigger::high(); } + +void Actuators::cuttersOff() { gpios::cut_trigger::low(); } + +void Actuators::camOn() { gpios::camera_enable::high(); } + +void Actuators::camOff() { gpios::camera_enable::low(); } + +void Actuators::buzzerArmed() +{ + miosix::Lock<miosix::FastMutex> l(rocketSignalingStateMutex); + // Set the counter with respect to the update function period + buzzerCounterOverflow = ROCKET_SS_ARMED_PERIOD / BUZZER_UPDATE_PERIOD; +} + +void Actuators::buzzerLanded() +{ + miosix::Lock<miosix::FastMutex> l(rocketSignalingStateMutex); + buzzerCounterOverflow = ROCKET_SS_LAND_PERIOD / BUZZER_UPDATE_PERIOD; +} + +void Actuators::buzzerOff() +{ + miosix::Lock<miosix::FastMutex> l(rocketSignalingStateMutex); + buzzerCounterOverflow = 0; +} + +void Actuators::updateBuzzer() +{ + miosix::Lock<miosix::FastMutex> l(rocketSignalingStateMutex); + if (buzzerCounterOverflow == 0) + { + // The buzzer is deactivated thus the channel is disabled + buzzer->disableChannel(BUZZER_CHANNEL); + } + else + { + if (buzzerCounter >= buzzerCounterOverflow) + { + // Enable the channel for this period + buzzer->enableChannel(BUZZER_CHANNEL); + buzzerCounter = 0; + } + else + { + buzzer->disableChannel(BUZZER_CHANNEL); + buzzerCounter++; + } + } +} + +} // namespace Payload diff --git a/src/boards/Payload/Actuators/Actuators.h b/src/boards/Payload/Actuators/Actuators.h new file mode 100644 index 000000000..db2169c17 --- /dev/null +++ b/src/boards/Payload/Actuators/Actuators.h @@ -0,0 +1,138 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Alberto Nidasio, Federico Lolli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <actuators/Servo/Servo.h> +#include <common/Mavlink.h> +#include <interfaces/gpio.h> +#include <scheduler/TaskScheduler.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ + +struct Actuators : public Boardcore::Module +{ + explicit Actuators(Boardcore::TaskScheduler* sched); + + [[nodiscard]] bool start(); + + /** + * @brief Moves the specified servo to the given position. + * + * @param servoId Servo to move. + * @param percentage Angle to set [0-1]. + * @return True if the the angle was set. + */ + bool setServo(ServosList servoId, float percentage); + + /** + * @brief Moves the specified servo to the given position. + * + * @param servoId Servo to move. + * @param angle Angle to set [degree]. + * @return True if the the angle was set. + */ + bool setServoAngle(ServosList servoId, float angle); + + /** + * @brief Wiggles the servo for few seconds. + * + * @param servoId Servo to move. + * @return true + * @return false + */ + bool wiggleServo(ServosList servoId); + + /** + * @brief Enables the specified servo. + * + * @param servoId Servo to enable. + * @return True if the servo was enabled. + * @return False if the servoId is invalid. + */ + bool enableServo(ServosList servoId); + + /** + * @brief Disables the specified servo. + * + * @param servoId Servo to disable. + * @return True if the servo was disabled. + * @return False if the servoId is invalid. + */ + bool disableServo(ServosList servoId); + + /** + * @brief Returns the current position of the specified servo. + * + * @param servoId Servo to read. + * @return float current Servo position in range [0-1], 0 if the servoId is + * invalid. + */ + float getServoPosition(ServosList servoId); + + /** + * @brief Returns the current angle of the specified servo. + * + * @param servoId Servo to read. + * @return float current Servo angle in range [0-180], 0 if the servoId is + * invalid. + */ + float getServoAngle(ServosList servoId); + + void cuttersOn(); + void cuttersOff(); + + void camOn(); + void camOff(); + + void buzzerArmed(); + void buzzerError(); + void buzzerLanded(); + void buzzerOff(); + +private: + void toggleLed(); + /** + * @brief Automatic called method to update the buzzer status + */ + void updateBuzzer(); + + Boardcore::TaskScheduler* scheduler = nullptr; + Boardcore::Servo* leftServo = nullptr; + Boardcore::Servo* rightServo = nullptr; + Boardcore::PWM* buzzer = nullptr; + + // mutexes + miosix::FastMutex leftServoMutex; + miosix::FastMutex rightServoMutex; + miosix::FastMutex rocketSignalingStateMutex; + + // Counter that enables and disables the buzzer + uint32_t buzzerCounter = 0; + // Upper limit of the buzzer counter + uint32_t buzzerCounterOverflow = 0; +}; + +} // namespace Payload diff --git a/src/boards/Payload/AltitudeTrigger/AltitudeTrigger.cpp b/src/boards/Payload/AltitudeTrigger/AltitudeTrigger.cpp new file mode 100644 index 000000000..6398f6e51 --- /dev/null +++ b/src/boards/Payload/AltitudeTrigger/AltitudeTrigger.cpp @@ -0,0 +1,101 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Authors: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "AltitudeTrigger.h" + +#include <Payload/BoardScheduler.h> +#include <Payload/Configs/WingConfig.h> +#include <Payload/StateMachines/NASController/NASController.h> +#include <common/Events.h> +#include <events/EventBroker.h> + +using namespace Boardcore; +using namespace Common; + +namespace Payload +{ + +AltitudeTrigger::AltitudeTrigger(TaskScheduler *sched) + : running(false), confidence(0), + deploymentAltitude(WingConfig::ALTITUDE_TRIGGER_DEPLOYMENT_ALTITUDE), + scheduler(sched) +{ +} + +bool AltitudeTrigger::start() +{ + return (scheduler->addTask(std::bind(&AltitudeTrigger::update, this), + WingConfig::ALTITUDE_TRIGGER_PERIOD) != 0); +} + +void AltitudeTrigger::enable() +{ + miosix::Lock<miosix::FastMutex> l(mutex); + confidence = 0; + running = true; +} + +void AltitudeTrigger::setDeploymentAltitude(float altitude) +{ + miosix::Lock<miosix::FastMutex> l(mutex); + deploymentAltitude = altitude; +} + +void AltitudeTrigger::disable() +{ + miosix::Lock<miosix::FastMutex> l(mutex); + running = false; +} + +bool AltitudeTrigger::isActive() +{ + miosix::Lock<miosix::FastMutex> l(mutex); + return running; +} + +void AltitudeTrigger::update() +{ + miosix::Lock<miosix::FastMutex> l(mutex); + if (running) + { + // We multiply by -1 to have a positive height + float height = + -ModuleManager::getInstance().get<NASController>()->getNasState().d; + + if (height < WingConfig::ALTITUDE_TRIGGER_DEPLOYMENT_ALTITUDE) + { + confidence++; + } + else + { + confidence = 0; + } + if (confidence >= WingConfig ::ALTITUDE_TRIGGER_CONFIDENCE) + { + confidence = 0; + EventBroker::getInstance().post(ALTITUDE_TRIGGER_ALTITUDE_REACHED, + TOPIC_FLIGHT); + running = false; + } + } +} +} // namespace Payload diff --git a/src/boards/Payload/AltitudeTrigger/AltitudeTrigger.h b/src/boards/Payload/AltitudeTrigger/AltitudeTrigger.h new file mode 100644 index 000000000..b0d2731ac --- /dev/null +++ b/src/boards/Payload/AltitudeTrigger/AltitudeTrigger.h @@ -0,0 +1,81 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Payload/BoardScheduler.h> + +#include <atomic> +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ + +class AltitudeTrigger : public Boardcore::Module +{ +public: + explicit AltitudeTrigger(Boardcore::TaskScheduler *sched); + + /** + * @brief Adds the update() task to the task scheduler. + */ + bool start(); + + /** + * @brief Enable the AltitudeTrigger. + */ + void enable(); + + /** + * @brief Disable the AltitudeTrigger. + */ + void disable(); + + /** + * @return The status of the AltitudeTrigger + */ + bool isActive(); + + /** + * @return Set the altitude of the AltitudeTrigger + */ + void setDeploymentAltitude(float altitude); + +private: + // Update method that posts a FLIGHT_WING_ALT_PASSED when the correct + // altitude is reached + void update(); + + bool running; + + // Number of times that the algorithm detects to be below the fixed + // altitude + int confidence; + + float deploymentAltitude; + + miosix::FastMutex mutex; + + Boardcore::TaskScheduler *scheduler = nullptr; +}; + +} // namespace Payload diff --git a/src/boards/Payload/BoardScheduler.cpp b/src/boards/Payload/BoardScheduler.cpp new file mode 100644 index 000000000..10eafa5f5 --- /dev/null +++ b/src/boards/Payload/BoardScheduler.cpp @@ -0,0 +1,66 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Authors: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "BoardScheduler.h" + +using namespace Boardcore; + +namespace Payload +{ + +BoardScheduler::BoardScheduler() +{ + scheduler1 = new TaskScheduler(miosix::PRIORITY_MAX - 4); + scheduler2 = new TaskScheduler(miosix::PRIORITY_MAX - 3); + scheduler3 = new TaskScheduler(miosix::PRIORITY_MAX - 2); + scheduler4 = new TaskScheduler(miosix::PRIORITY_MAX - 1); +} + +TaskScheduler* BoardScheduler::getScheduler(miosix::Priority priority) +{ + switch (priority.get()) + { + case miosix::PRIORITY_MAX: + return scheduler4; + case miosix::PRIORITY_MAX - 1: + return scheduler3; + case miosix::PRIORITY_MAX - 2: + return scheduler2; + case miosix::MAIN_PRIORITY: + return scheduler1; + default: + return scheduler1; + } +} + +bool BoardScheduler::start() +{ + return scheduler1->start() && scheduler2->start() && scheduler3->start() && + scheduler4->start(); +} + +bool BoardScheduler::isStarted() +{ + return scheduler1->isRunning() && scheduler2->isRunning() && + scheduler3->isRunning() && scheduler4->isRunning(); +} +} // namespace Payload \ No newline at end of file diff --git a/src/boards/Payload/BoardScheduler.h b/src/boards/Payload/BoardScheduler.h new file mode 100644 index 000000000..3a09bccc3 --- /dev/null +++ b/src/boards/Payload/BoardScheduler.h @@ -0,0 +1,62 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Authors: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <scheduler/TaskScheduler.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ +/** + * @brief Class that wraps the 4 main task schedulers of the entire OBSW. + * There is a task scheduler for every miosix priority + */ +class BoardScheduler : public Boardcore::Module +{ +public: + BoardScheduler(); + + /** + * @brief Get the Scheduler object relative to the requested priority + * + * @param priority The task scheduler priority + * @return Boardcore::TaskScheduler& Reference to the requested task + * scheduler. + * @note Min priority scheduler is returned in case of non valid priority. + */ + Boardcore::TaskScheduler* getScheduler(miosix::Priority priority); + + [[nodiscard]] bool start(); + + /** + * @brief Returns if all the schedulers are up and running + */ + bool isStarted(); + +private: + Boardcore::TaskScheduler* scheduler1; + Boardcore::TaskScheduler* scheduler2; + Boardcore::TaskScheduler* scheduler3; + Boardcore::TaskScheduler* scheduler4; +}; +} // namespace Payload diff --git a/src/boards/Payload/Buses.h b/src/boards/Payload/Buses.h new file mode 100644 index 000000000..d4f498137 --- /dev/null +++ b/src/boards/Payload/Buses.h @@ -0,0 +1,55 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <drivers/i2c/I2C.h> +#include <drivers/spi/SPIBus.h> +#include <drivers/usart/USART.h> +#include <interfaces-impl/hwmapping.h> + +#include <utils/ModuleManager/ModuleManager.hpp> +namespace Payload +{ +class Buses : public Boardcore::Module +{ +public: + Boardcore::SPIBus spi1; + Boardcore::SPIBus spi3; + Boardcore::SPIBus spi4; + Boardcore::SPIBus spi6; + + Boardcore::I2C i2c1; + + Boardcore::USART usart1; + Boardcore::USART usart2; + Boardcore::USART uart4; + + Buses() + : spi1(SPI1), spi3(SPI3), spi4(SPI4), spi6(SPI6), + i2c1(I2C1, miosix::interfaces::i2c1::scl::getPin(), + miosix::interfaces::i2c1::sda::getPin()), + usart1(USART1, 115200), usart2(USART2, 115200), uart4(UART4, 115200) + { + } +}; +} // namespace Payload diff --git a/src/boards/Payload/CanHandler/CanHandler.cpp b/src/boards/Payload/CanHandler/CanHandler.cpp new file mode 100644 index 000000000..e9ba14e44 --- /dev/null +++ b/src/boards/Payload/CanHandler/CanHandler.cpp @@ -0,0 +1,149 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Authors: Federico Mandelli, Alberto Nidasio + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "CanHandler.h" + +#include <Payload/Configs/CanHandlerConfig.h> +#include <Payload/Sensors/Sensors.h> +#include <Payload/StateMachines/FlightModeManager/FlightModeManager.h> +#include <common/Events.h> +#include <events/EventBroker.h> + +#include <functional> + +using namespace std; +using namespace placeholders; +using namespace Boardcore; +using namespace Canbus; +using namespace Common; +using namespace CanConfig; +using namespace Payload::CanHandlerConfig; + +namespace Payload +{ + +CanHandler::CanHandler(TaskScheduler *sched) : scheduler(sched) +{ + CanbusDriver::AutoBitTiming bitTiming; + bitTiming.baudRate = BAUD_RATE; + bitTiming.samplePoint = SAMPLE_POINT; + CanbusDriver::CanbusConfig config; + driver = new CanbusDriver(CAN2, config, bitTiming); + + protocol = + new CanProtocol(driver, bind(&CanHandler::handleCanMessage, this, _1), + miosix::PRIORITY_MAX - 1); + + // Accept messages only from the main and RIG board + protocol->addFilter(static_cast<uint8_t>(Board::MAIN), + static_cast<uint8_t>(Board::BROADCAST)); + protocol->addFilter(static_cast<uint8_t>(Board::RIG), + static_cast<uint8_t>(Board::BROADCAST)); + driver->init(); +} + +bool CanHandler::start() +{ + bool result; + // Add a task to periodically send the pitot data + result = scheduler->addTask( // sensor template + [&]() + { + protocol->enqueueData( + static_cast<uint8_t>(Priority::MEDIUM), + static_cast<uint8_t>(PrimaryType::SENSORS), + static_cast<uint8_t>(Board::PAYLOAD), + static_cast<uint8_t>(Board::BROADCAST), + static_cast<uint8_t>(SensorId::PITOT), + ModuleManager::getInstance() + .get<Sensors>() + ->getPitotLastSample()); + }, + PITOT_TRANSMISSION_PERIOD) != 0; + + result = + result && + scheduler->addTask( // status + [&]() + { + FlightModeManagerState state = ModuleManager::getInstance() + .get<FlightModeManager>() + ->getStatus() + .state; + protocol->enqueueSimplePacket( + static_cast<uint8_t>(Priority::MEDIUM), + static_cast<uint8_t>(PrimaryType::STATUS), + static_cast<uint8_t>(Board::PAYLOAD), + static_cast<uint8_t>(Board::BROADCAST), + static_cast<uint8_t>(state), + ((state == FlightModeManagerState::ARMED) ? 0x01 : 0x00)); + }, + STATUS_TRANSMISSION_PERIOD) != 0; + return protocol->start() && result; +} + +bool CanHandler::isStarted() { return protocol->isStarted(); } + +void CanHandler::sendEvent(EventId event) +{ + protocol->enqueueEvent(static_cast<uint8_t>(Priority::CRITICAL), + static_cast<uint8_t>(PrimaryType::EVENTS), + static_cast<uint8_t>(Board::PAYLOAD), + static_cast<uint8_t>(Board::BROADCAST), + static_cast<uint8_t>(event)); +} + +void CanHandler::handleCanMessage(const CanMessage &msg) +{ + PrimaryType msgType = static_cast<PrimaryType>(msg.getPrimaryType()); + + switch (msgType) + { + case PrimaryType::EVENTS: + { + handleCanEvent(msg); + break; + } + default: + { + LOG_WARN(logger, "Received unsupported message type: type={}", + msgType); + break; + } + } +} + +void CanHandler::handleCanEvent(const Boardcore::Canbus::CanMessage &msg) +{ + EventId eventId = static_cast<EventId>(msg.getSecondaryType()); + + auto it = eventToEvent.find(eventId); + + if (it != eventToEvent.end()) + { + EventBroker::getInstance().post(it->second, TOPIC_CAN); + } + else + LOG_WARN(logger, "Received unsupported event: id={}", eventId); +} + +} // namespace Payload diff --git a/src/boards/Payload/CanHandler/CanHandler.h b/src/boards/Payload/CanHandler/CanHandler.h new file mode 100644 index 000000000..2f040b4e0 --- /dev/null +++ b/src/boards/Payload/CanHandler/CanHandler.h @@ -0,0 +1,90 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Authors: Federico Mandelli, Alberto Nidasio + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Payload/BoardScheduler.h> +#include <common/CanConfig.h> +#include <drivers/canbus/CanProtocol/CanProtocol.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ +/** + * @class CanHandler + * + * @brief Payload implementation of CanProtocol with methods for ease of use + * + */ +class CanHandler : public Boardcore::Module +{ + +public: + /** + * @brief Creates the protocol and the driver and adds the filters. + * + * @warning With Payload motherboard CanDriver initialization could be + * blocking + */ + explicit CanHandler(Boardcore::TaskScheduler *sched); + + /** + * @brief Starts the protocol and adds the periodic messages to the task + * scheduler. + * + * @return true if the protocol started correctly and the tasks were + * successfully inserted + */ + bool start(); + + /** + * @return true if the protocol is started + */ + bool isStarted(); + + /** + * @brief Compile the the ID of the message and send the event trough + * CanProtocol + */ + void sendEvent(Common::CanConfig::EventId event); + +private: + /** + * @brief Function called by CanProtocol when a new message is received + */ + void handleCanMessage(const Boardcore::Canbus::CanMessage &msg); + + /** + * @brief Converts the received CanEvent in Event and post it on TOPIC_CAN + */ + void handleCanEvent(const Boardcore::Canbus::CanMessage &msg); + + Boardcore::Canbus::CanbusDriver *driver; + Boardcore::Canbus::CanProtocol *protocol; + + Boardcore::PrintLogger logger = Boardcore::Logging::getLogger("canhandler"); + + Boardcore::TaskScheduler *scheduler = nullptr; +}; + +} // namespace Payload diff --git a/src/boards/Payload/Configs/ActuatorsConfigs.h b/src/boards/Payload/Configs/ActuatorsConfigs.h new file mode 100644 index 000000000..015793dc4 --- /dev/null +++ b/src/boards/Payload/Configs/ActuatorsConfigs.h @@ -0,0 +1,68 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Alberto Nidasio, Federico Lolli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <drivers/timer/PWM.h> +#include <drivers/timer/TimerUtils.h> + +namespace Payload +{ + +namespace ActuatorsConfigs +{ + +// Left servo +static TIM_TypeDef* const SERVO_1_TIMER = TIM3; +constexpr Boardcore::TimerUtils::Channel SERVO_1_PWM_CH = + Boardcore::TimerUtils::Channel::CHANNEL_1; + +constexpr float LEFT_SERVO_ROTATION = 120; // [deg] +constexpr float LEFT_SERVO_MIN_PULSE = 900; // [us] +constexpr float LEFT_SERVO_MAX_PULSE = + LEFT_SERVO_MIN_PULSE + 10 * LEFT_SERVO_ROTATION; // [us] + +// Right servo +static TIM_TypeDef* const SERVO_2_TIMER = TIM3; +constexpr Boardcore::TimerUtils::Channel SERVO_2_PWM_CH = + Boardcore::TimerUtils::Channel::CHANNEL_2; + +constexpr float RIGHT_SERVO_ROTATION = 120; // [deg] +constexpr float RIGHT_SERVO_MIN_PULSE = 2100; // [us] +constexpr float RIGHT_SERVO_MAX_PULSE = + RIGHT_SERVO_MIN_PULSE - 10 * RIGHT_SERVO_ROTATION; // [us] + +// Buzzer configs +static TIM_TypeDef* const BUZZER_TIMER = TIM1; +constexpr Boardcore::TimerUtils::Channel BUZZER_CHANNEL = + Boardcore::TimerUtils::Channel::CHANNEL_1; +constexpr uint32_t BUZZER_FREQUENCY = 1000; +constexpr float BUZZER_DUTY_CYCLE = 0.5; + +constexpr uint32_t BUZZER_UPDATE_PERIOD = 100; // [ms] + +constexpr uint32_t ROCKET_SS_ARMED_PERIOD = 500; +constexpr uint32_t ROCKET_SS_LAND_PERIOD = 1000; // [ms] + +} // namespace ActuatorsConfigs + +} // namespace Payload diff --git a/src/boards/Payload/Configs/CanHandlerConfig.h b/src/boards/Payload/Configs/CanHandlerConfig.h new file mode 100644 index 000000000..c3ffa58ec --- /dev/null +++ b/src/boards/Payload/Configs/CanHandlerConfig.h @@ -0,0 +1,36 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Alberto Nidasio + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +namespace Payload +{ + +namespace CanHandlerConfig +{ + +constexpr unsigned int PITOT_TRANSMISSION_PERIOD = 50; // ms +constexpr unsigned int STATUS_TRANSMISSION_PERIOD = 1000; // ms + +} // namespace CanHandlerConfig + +} // namespace Payload diff --git a/src/boards/Payload/Configs/FlightModeManagerConfig.h b/src/boards/Payload/Configs/FlightModeManagerConfig.h new file mode 100644 index 000000000..0d09f70c8 --- /dev/null +++ b/src/boards/Payload/Configs/FlightModeManagerConfig.h @@ -0,0 +1,30 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +namespace Payload +{ +constexpr unsigned int MISSION_TIMEOUT = 15 * 60 * 1000; // [ms] +constexpr unsigned int APOGEE_TIMEOUT = 40 * 1000; // [ms] +constexpr unsigned int LOGGING_DELAY = 30 * 1000; // [ms] +} // namespace Payload diff --git a/src/boards/Payload/Configs/FlightStatsRecorderConfig.h b/src/boards/Payload/Configs/FlightStatsRecorderConfig.h new file mode 100644 index 000000000..ab003f917 --- /dev/null +++ b/src/boards/Payload/Configs/FlightStatsRecorderConfig.h @@ -0,0 +1,33 @@ +/* Copyright (c) 2019-2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <stdint.h> + +namespace Payload +{ +namespace FlightStatsRecorderConfig +{ +constexpr uint32_t FSR_UPDATE_PERIOD = 100; // [ms] +} +} // namespace Payload diff --git a/src/boards/Payload/Configs/NASConfig.h b/src/boards/Payload/Configs/NASConfig.h new file mode 100644 index 000000000..d6b38e085 --- /dev/null +++ b/src/boards/Payload/Configs/NASConfig.h @@ -0,0 +1,67 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Alberto Nidasio + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <algorithms/NAS/NASConfig.h> +#include <algorithms/ReferenceValues.h> +#include <common/ReferenceConfig.h> + +namespace Payload +{ + +namespace NASConfig +{ + +constexpr uint32_t UPDATE_PERIOD = 20; // 50 hz + +constexpr int CALIBRATION_SAMPLES_COUNT = 20; +constexpr int CALIBRATION_SLEEP_TIME = 100; // [ms] + +constexpr int ACCELERATION_THRESHOLD_SAMPLE = 50; + +constexpr float ACCELERATION_THRESHOLD = 2; // [m/s^2] + +static const Boardcore::NASConfig config = { + UPDATE_PERIOD / 1000.0, // T + 0.0001f, // SIGMA_BETA + 0.3f, // SIGMA_W + 0.1f, // SIGMA_ACC + 0.1f, // SIGMA_MAG + 10.0f, // SIGMA_GPS + 4.3f, // SIGMA_BAR + 10.0f, // SIGMA_POS + 10.0f, // SIGMA_VEL + 10.0f, // SIGMA_PITOT + 1.0f, // P_POS + 10.0f, // P_POS_VERTICAL + 1.0f, // P_VEL + 10.0f, // P_VEL_VERTICAL + 0.01f, // P_ATT + 0.01f, // P_BIAS + 6.0f, // SATS_NUM + Common::ReferenceConfig::nedMag // NED_MAG +}; + +} // namespace NASConfig + +} // namespace Payload diff --git a/src/boards/Payload/Configs/PinHandlerConfig.h b/src/boards/Payload/Configs/PinHandlerConfig.h new file mode 100644 index 000000000..d02c99e07 --- /dev/null +++ b/src/boards/Payload/Configs/PinHandlerConfig.h @@ -0,0 +1,34 @@ +/* Copyright (c) 2019-2023 Skyward Experimental Rocketry + * Authors: Luca Erbetta, Luca Conterio + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <utils/PinObserver/PinObserver.h> + +namespace Payload +{ + +constexpr unsigned int NC_DETACH_PIN_THRESHOLD = 20; +constexpr Boardcore::PinTransition NC_DETACH_PIN_TRIGGER = + Boardcore::PinTransition::RISING_EDGE; + +} // namespace Payload diff --git a/src/boards/Payload/Configs/RadioConfig.h b/src/boards/Payload/Configs/RadioConfig.h new file mode 100644 index 000000000..ade3dd7f1 --- /dev/null +++ b/src/boards/Payload/Configs/RadioConfig.h @@ -0,0 +1,46 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <common/Mavlink.h> + +namespace Payload +{ +namespace RadioConfig +{ +// Mavlink driver template parameters +constexpr uint32_t RADIO_PKT_LENGTH = 255; +constexpr uint32_t RADIO_OUT_QUEUE_SIZE = 20; +constexpr uint32_t RADIO_MAV_MSG_LENGTH = MAVLINK_MAX_DIALECT_PAYLOAD_SIZE; + +constexpr uint32_t RADIO_PERIODIC_TELEMETRY_PERIOD = 200; + +constexpr uint16_t RADIO_SLEEP_AFTER_SEND = 50; +constexpr size_t RADIO_OUT_BUFFER_MAX_AGE = 10; + +constexpr uint8_t MAV_SYSTEM_ID = 171; +constexpr uint8_t MAV_COMP_ID = 96; + +constexpr uint32_t MAVLINK_QUEUE_SIZE = 10; + +} // namespace RadioConfig +} // namespace Payload diff --git a/src/boards/Payload/Configs/SensorsConfig.h b/src/boards/Payload/Configs/SensorsConfig.h new file mode 100644 index 000000000..df790a830 --- /dev/null +++ b/src/boards/Payload/Configs/SensorsConfig.h @@ -0,0 +1,124 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <sensors/ADS131M08/ADS131M08.h> +#include <sensors/H3LIS331DL/H3LIS331DL.h> +#include <sensors/LIS2MDL/LIS2MDL.h> +#include <sensors/LPS22DF/LPS22DF.h> +#include <sensors/LPS28DFW/LPS28DFW.h> +#include <sensors/LSM6DSRX/LSM6DSRX.h> +#include <sensors/UBXGPS/UBXGPSSpi.h> + +namespace Payload +{ +namespace SensorsConfig +{ +constexpr Boardcore::LPS22DF::AVG LPS22DF_AVG = Boardcore::LPS22DF::AVG_4; +constexpr Boardcore::LPS22DF::ODR LPS22DF_ODR = Boardcore::LPS22DF::ODR_100; + +constexpr Boardcore::LPS28DFW::AVG LPS28DFW_AVG = Boardcore::LPS28DFW::AVG_4; +constexpr Boardcore::LPS28DFW::ODR LPS28DFW_ODR = Boardcore::LPS28DFW::ODR_100; +constexpr Boardcore::LPS28DFW::FullScaleRange LPS28DFW_FSR = + Boardcore::LPS28DFW::FS_1260; + +constexpr Boardcore::H3LIS331DLDefs::OutputDataRate H3LIS331DL_ODR = + Boardcore::H3LIS331DLDefs::OutputDataRate::ODR_400; +constexpr Boardcore::H3LIS331DLDefs::BlockDataUpdate H3LIS331DL_BDU = + Boardcore::H3LIS331DLDefs::BlockDataUpdate::BDU_CONTINUOS_UPDATE; +constexpr Boardcore::H3LIS331DLDefs::FullScaleRange H3LIS331DL_FSR = + Boardcore::H3LIS331DLDefs::FullScaleRange::FS_100; + +constexpr Boardcore::LIS2MDL::OperativeMode LIS2MDL_OPERATIVE_MODE = + Boardcore::LIS2MDL::MD_CONTINUOUS; +constexpr Boardcore::LIS2MDL::ODR LIS2MDL_ODR = Boardcore::LIS2MDL::ODR_100_HZ; +constexpr unsigned int LIS2MDL_TEMPERATURE_DIVIDER = 5; + +constexpr uint8_t UBXGPS_SAMPLE_RATE = 5; + +constexpr Boardcore::LSM6DSRXConfig::BDU LSM6DSRX_BDU = + Boardcore::LSM6DSRXConfig::BDU::CONTINUOUS_UPDATE; + +constexpr Boardcore::LSM6DSRXConfig::ACC_FULLSCALE LSM6DSRX_ACC_FS = + Boardcore::LSM6DSRXConfig::ACC_FULLSCALE::G16; +constexpr Boardcore::LSM6DSRXConfig::ACC_ODR LSM6DSRX_ACC_ODR = + Boardcore::LSM6DSRXConfig::ACC_ODR::HZ_416; +constexpr Boardcore::LSM6DSRXConfig::OPERATING_MODE LSM6DSRX_OPERATING_MODE = + Boardcore::LSM6DSRXConfig::OPERATING_MODE::NORMAL; + +constexpr Boardcore::LSM6DSRXConfig::GYR_FULLSCALE LSM6DSRX_GYR_FS = + Boardcore::LSM6DSRXConfig::GYR_FULLSCALE::DPS_4000; +constexpr Boardcore::LSM6DSRXConfig::GYR_ODR LSM6DSRX_GYR_ODR = + Boardcore::LSM6DSRXConfig::GYR_ODR::HZ_416; + +constexpr Boardcore::LSM6DSRXConfig::FIFO_MODE LSM6DSRX_FIFO_MODE = + Boardcore::LSM6DSRXConfig::FIFO_MODE::CONTINUOUS; +constexpr Boardcore::LSM6DSRXConfig::FIFO_TIMESTAMP_DECIMATION + LSM6DSRX_FIFO_TIMESTAMP_DECIMATION = + Boardcore::LSM6DSRXConfig::FIFO_TIMESTAMP_DECIMATION::DEC_1; +constexpr Boardcore::LSM6DSRXConfig::FIFO_TEMPERATURE_BDR + LSM6DSRX_FIFO_TEMPERATURE_BDR = + Boardcore::LSM6DSRXConfig::FIFO_TEMPERATURE_BDR::DISABLED; + +constexpr Boardcore::ADS131M08Defs::OversamplingRatio + ADS131M08_OVERSAMPLING_RATIO = + Boardcore::ADS131M08Defs::OversamplingRatio::OSR_8192; +constexpr bool ADS131M08_GLOBAL_CHOP_MODE = true; + +constexpr uint32_t LPS22DF_PERIOD = 20; // [ms] 50Hz +constexpr uint32_t LPS28DFW_PERIOD = 20; // [ms] 50Hz +constexpr uint32_t H3LIS331DL_PERIOD = 10; // [ms] 100Hz +constexpr uint32_t LIS2MDL_PERIOD = 10; // [ms] 100Hz +constexpr uint32_t UBXGPS_PERIOD = 1000 / UBXGPS_SAMPLE_RATE; // [ms] +constexpr uint32_t LSM6DSRX_PERIOD = 20; // [ms] 50Hz +constexpr uint32_t ADS131M08_PERIOD = 10; // [ms] 100Hz +constexpr uint32_t IMU_PERIOD = 20; // [ms] Fake processed IMU 50Hz +constexpr uint32_t MAG_CALIBRATION_PERIOD = 100; // [ms] 10Hz + +// ADC sensors configs +constexpr float ADC_VOLTAGE_RANGE = 1.2f; // [V] Voltage reading range +constexpr Boardcore::ADS131M08Defs::Channel BATTERY_VOLTAGE_CHANNEL = + Boardcore::ADS131M08Defs::Channel::CHANNEL_1; +constexpr Boardcore::ADS131M08Defs::Channel DYNAMIC_PRESSURE_CHANNEL = + Boardcore::ADS131M08Defs::Channel::CHANNEL_2; +constexpr Boardcore::ADS131M08Defs::Channel STATIC_PRESSURE_CHANNEL = + Boardcore::ADS131M08Defs::Channel::CHANNEL_4; +constexpr Boardcore::ADS131M08Defs::Channel CURRENT_CHANNEL = + Boardcore::ADS131M08Defs::Channel::CHANNEL_5; +constexpr Boardcore::ADS131M08Defs::Channel CAM_BATTERY_VOLTAGE_CHANNEL = + Boardcore::ADS131M08Defs::Channel::CHANNEL_7; +// ADC Voltage divider +constexpr float BATTERY_VOLTAGE_CONVERSION_FACTOR = + (20.f / 2.4f) + + 1; // 20 kOhm resistor and 2.4 kOhm resistor for voltage divider +constexpr float CURRENT_CONVERSION_FACTOR = + (20.f / 4.f) / (12.f / (12.f + 33.f)); +constexpr float CURRENT_OFFSET = 0.133333333f; // V in ADC + +constexpr unsigned int NUMBER_OF_SENSORS = 8; + +// Calibration samples +constexpr unsigned int CALIBRATION_SAMPLES = 20; +constexpr unsigned int CALIBRATION_PERIOD = 100; + +} // namespace SensorsConfig +} // namespace Payload diff --git a/src/boards/Payload/Configs/VerticalVelocityConfig.h b/src/boards/Payload/Configs/VerticalVelocityConfig.h new file mode 100644 index 000000000..28e36e070 --- /dev/null +++ b/src/boards/Payload/Configs/VerticalVelocityConfig.h @@ -0,0 +1,37 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Raul Radu + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +namespace Payload +{ + +namespace FailSafe +{ + +constexpr int FAILSAFE_VERTICAL_VELOCITY_TRIGGER_PERIOD = 10; // [ms] +constexpr float FAILSAFE_VERTICAL_VELOCITY_THRESHOLD = 12; // [m/s] +constexpr int FAILSAFE_VERTICAL_VELOCITY_TRIGGER_CONFIDENCE = 30; + +} // namespace FailSafe + +} // namespace Payload diff --git a/src/boards/Payload/Configs/WESConfig.h b/src/boards/Payload/Configs/WESConfig.h new file mode 100644 index 000000000..36382803a --- /dev/null +++ b/src/boards/Payload/Configs/WESConfig.h @@ -0,0 +1,45 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <miosix.h> + +namespace Payload +{ + +namespace WESConfig +{ + +constexpr uint32_t WES_CALIBRATION_TIMEOUT = + 5 * 1000; // time needed for the first loop [ms] + +constexpr int WES_CALIBRATION_SAMPLE_NUMBER = + 20; // number to sample to take in the first loop +constexpr uint32_t WES_CALIBRATION_UPDATE_PERIOD = + WES_CALIBRATION_TIMEOUT / WES_CALIBRATION_SAMPLE_NUMBER; +constexpr uint32_t WES_PREDICTION_UPDATE_PERIOD = + 100; // update period of WES[ms] + +} // namespace WESConfig + +} // namespace Payload diff --git a/src/boards/Payload/Configs/WingConfig.h b/src/boards/Payload/Configs/WingConfig.h new file mode 100644 index 000000000..f8dbd7219 --- /dev/null +++ b/src/boards/Payload/Configs/WingConfig.h @@ -0,0 +1,62 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Authors: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +namespace Payload +{ + +namespace WingConfig +{ +// Algorithm configuration + +#if defined(EUROC) +constexpr float DEFAULT_TARGET_LAT = 39.389733; +constexpr float DEFAULT_TARGET_LON = -8.288992; +#elif defined(ROCCARASO) +constexpr float DEFAULT_TARGET_LAT = 41.809216; +constexpr float DEFAULT_TARGET_LON = 14.055310; +#else // Milan +constexpr float DEFAULT_TARGET_LAT = 41.809216; +constexpr float DEFAULT_TARGET_LON = 14.055310; +#endif + +constexpr int WING_UPDATE_PERIOD = 1000; // [ms] + +constexpr float PI_CONTROLLER_SATURATION_MAX_LIMIT = 2.09439; +constexpr float PI_CONTROLLER_SATURATION_MIN_LIMIT = -2.09439; + +constexpr int GUIDANCE_CONFIDENCE = 15; +constexpr int GUIDANCE_M1_ALTITUDE_THRESHOLD = 250; //[m] +constexpr int GUIDANCE_M2_ALTITUDE_THRESHOLD = 150; //[m] +constexpr int GUIDANCE_TARGET_ALTITUDE_THRESHOLD = 50; //[m] + +// TODO check this parameter preflight +constexpr float KP = 0.4; //[m] +constexpr float KI = 0.08; //[m] +constexpr float ALTITUDE_TRIGGER_DEPLOYMENT_ALTITUDE = 300; // [meters] + +constexpr int ALTITUDE_TRIGGER_CONFIDENCE = 10; // [number of sample] +constexpr int ALTITUDE_TRIGGER_PERIOD = 100; //[ms] +} // namespace WingConfig + +} // namespace Payload diff --git a/src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.cpp b/src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.cpp new file mode 100644 index 000000000..faf62811c --- /dev/null +++ b/src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.cpp @@ -0,0 +1,177 @@ +/* Copyright (c) 2019-2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/Configs/FlightStatsRecorderConfig.h> +#include <Payload/FlightStatsRecorder/FlightStatsRecorder.h> +#include <Payload/Sensors/Sensors.h> +#include <Payload/StateMachines/FlightModeManager/FlightModeManager.h> +#include <Payload/StateMachines/NASController/NASController.h> + +#include <Eigen/Core> + +using namespace Boardcore; +using namespace Payload::FlightStatsRecorderConfig; +using namespace Eigen; +using namespace miosix; + +namespace Payload +{ +FlightStatsRecorder::FlightStatsRecorder(TaskScheduler* sched) + : scheduler(sched) +{ + // Init the data structure to avoid UB + stats.max_airspeed_pitot = 0; + stats.apogee_alt = 0; + stats.apogee_lat = 0; + stats.apogee_lon = 0; + stats.apogee_ts = 0; + stats.cpu_load = 0; + stats.dpl_max_acc = 0; + stats.dpl_ts = 0; + stats.free_heap = 0; + stats.liftoff_max_acc = 0; + stats.liftoff_max_acc_ts = 0; + stats.max_z_speed = 0; + stats.max_z_speed_ts = 0; + stats.min_pressure = 0; + stats.max_speed_altitude = 0; +} + +bool FlightStatsRecorder::start() +{ + return scheduler->addTask([&]() { update(); }, FSR_UPDATE_PERIOD, + TaskScheduler::Policy::RECOVER); +} + +void FlightStatsRecorder::update() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // FMM state + FlightModeManagerState flightState = + modules.get<FlightModeManager>()->getStatus().state; + + // Data gathering + Sensors* sensor = modules.get<Sensors>(); + AccelerometerData accData = sensor->getIMULastSample(); + PressureData baroData = sensor->getStaticPressureLastSample(); + PitotData pitotData = sensor->getPitotLastSample(); + GPSData gpsData = sensor->getGPSLastSample(); + NASState nasData = modules.get<NASController>()->getNasState(); + + // Store the apogee ts + uint64_t previousApogee = stats.apogee_ts; + + // Update the data + updateAcc(flightState, accData); + updateBaro(flightState, baroData); + updatePitot(flightState, pitotData); + updateNAS(flightState, nasData); + + // If the apogee ts is different update the GPS apogee coordinates + if (previousApogee != stats.apogee_ts) + { + Lock<FastMutex> l(mutex); + // minus to get positive altitude + stats.apogee_alt = -nasData.d; + stats.apogee_lat = gpsData.latitude; + stats.apogee_lon = gpsData.longitude; + } +} + +mavlink_payload_stats_tm_t FlightStatsRecorder::getStats() +{ + Lock<FastMutex> l(mutex); + return stats; +} + +void FlightStatsRecorder::updateAcc(FlightModeManagerState flightState, + AccelerometerData data) +{ + Vector3f accelerations = static_cast<Vector3f>(data); + float norm = accelerations.norm(); + + if (flightState == FlightModeManagerState::ASCENDING) + { + Lock<FastMutex> l(mutex); + + stats.liftoff_max_acc = std::max(stats.liftoff_max_acc, norm); + bool changed = stats.liftoff_max_acc == norm; + + // In case of a change update the timestamp + stats.liftoff_max_acc_ts = + changed ? data.accelerationTimestamp : stats.liftoff_max_acc_ts; + } + else if (flightState >= FlightModeManagerState::DROGUE_DESCENT) + { + Lock<FastMutex> l(mutex); + + stats.dpl_max_acc = std::max(stats.dpl_max_acc, norm); + + // Change the timestamp of DPL if not already done + stats.dpl_ts = + stats.dpl_ts == 0 ? data.accelerationTimestamp : stats.dpl_ts; + } +} + +void FlightStatsRecorder::updateBaro(FlightModeManagerState flightState, + PressureData data) +{ + Lock<FastMutex> l(mutex); + + if (stats.min_pressure == 0) + { + stats.min_pressure = data.pressure; + } + + // Update the min + stats.min_pressure = std::min(stats.min_pressure, data.pressure); +} + +void FlightStatsRecorder::updatePitot(FlightModeManagerState flightState, + PitotData data) +{ + Lock<FastMutex> l(mutex); + + stats.max_airspeed_pitot = + std::max(stats.max_airspeed_pitot, data.airspeed); +} + +void FlightStatsRecorder::updateNAS(FlightModeManagerState flightState, + NASState state) +{ + if (flightState == FlightModeManagerState::ASCENDING) + { + Lock<FastMutex> l(mutex); + + stats.max_z_speed = std::max(stats.max_z_speed, -state.vd); + bool changed = stats.max_z_speed == -state.vd; + + // Change the max speed altitude and timestamp if the max speed changed + stats.max_speed_altitude = + changed ? -state.d : stats.max_speed_altitude; + + stats.max_z_speed_ts = changed ? state.timestamp : stats.max_z_speed_ts; + } +} + +} // namespace Payload diff --git a/src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.h b/src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.h new file mode 100644 index 000000000..1470c4168 --- /dev/null +++ b/src/boards/Payload/FlightStatsRecorder/FlightStatsRecorder.h @@ -0,0 +1,80 @@ +/* Copyright (c) 2019-2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Payload/StateMachines/FlightModeManager/FlightModeManager.h> +#include <algorithms/ADA/ADAData.h> +#include <algorithms/NAS/NASState.h> +#include <common/Mavlink.h> +#include <scheduler/TaskScheduler.h> +#include <sensors/SensorData.h> +#include <sensors/analog/Pitot/PitotData.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ +class FlightStatsRecorder : public Boardcore::Module +{ +public: + FlightStatsRecorder(Boardcore::TaskScheduler* sched); + + /** + * @brief Adds a task to the scheduler to update the stats + */ + bool start(); + + /** + * @brief Gets the packet already populated + */ + mavlink_payload_stats_tm_t getStats(); + +private: + /** + * @brief Update method that gathers all the info to update the data + * structure + */ + void update(); + + // Update methods + void updateAcc(FlightModeManagerState flightState, + Boardcore::AccelerometerData data); + void updateBaro(FlightModeManagerState flightState, + Boardcore::PressureData data); + void updateDPLPressure(FlightModeManagerState flightState, + Boardcore::PressureData data); + void updatePitot(FlightModeManagerState flightState, + Boardcore::PitotData data); + void updateNAS(FlightModeManagerState flightState, + Boardcore::NASState data); + + // Update scheduler to update all the data + Boardcore::TaskScheduler* scheduler = nullptr; + + // Data structure + mavlink_payload_stats_tm_t stats; + + // Update mutex + miosix::FastMutex mutex; +}; +} // namespace Payload diff --git a/src/boards/Payload/PinHandler/PinHandler.cpp b/src/boards/Payload/PinHandler/PinHandler.cpp new file mode 100644 index 000000000..4005f105b --- /dev/null +++ b/src/boards/Payload/PinHandler/PinHandler.cpp @@ -0,0 +1,75 @@ +/* Copyright (c) 2019-2023 Skyward Experimental Rocketry + * Authors: Luca Erbetta, Luca Conterio, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "PinHandler.h" + +#include <Payload/Configs/PinHandlerConfig.h> +#include <common/Events.h> +#include <events/EventBroker.h> +#include <interfaces-impl/hwmapping.h> +#include <miosix.h> + +#include <functional> + +using namespace std::placeholders; +using namespace miosix; +using namespace Boardcore; +using namespace Common; + +// TODO change hwmapping for Euroc this is need to have the right name +using nosecone_detach = gpios::liftoff_detach; + +namespace Payload +{ + +void PinHandler::onExpulsionPinTransition(PinTransition transition) +{ + if (transition == NC_DETACH_PIN_TRIGGER) + EventBroker::getInstance().post(FLIGHT_NC_DETACHED, TOPIC_FLIGHT); +} + +bool PinHandler::start() +{ + running = PinObserver::getInstance().start(); + return running; +} + +bool PinHandler::isStarted() { return running; } + +std::map<PinsList, PinData> PinHandler::getPinsData() +{ + std::map<PinsList, PinData> data; + + data[PinsList::NOSECONE_PIN] = + PinObserver::getInstance().getPinData(nosecone_detach::getPin()); + + return data; +} + +PinHandler::PinHandler() : running(false) +{ + PinObserver::getInstance().registerPinCallback( + nosecone_detach::getPin(), + std::bind(&PinHandler::onExpulsionPinTransition, this, _1), + NC_DETACH_PIN_THRESHOLD); +} +} // namespace Payload diff --git a/src/boards/Payload/PinHandler/PinHandler.h b/src/boards/Payload/PinHandler/PinHandler.h new file mode 100644 index 000000000..45dcff2c9 --- /dev/null +++ b/src/boards/Payload/PinHandler/PinHandler.h @@ -0,0 +1,66 @@ +/* Copyright (c) 2019-2023 Skyward Experimental Rocketry + * Authors: Luca Erbetta, Luca Conterio, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <common/Mavlink.h> +#include <diagnostic/PrintLogger.h> +#include <utils/PinObserver/PinObserver.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ + +/** + * @brief This class contains the handlers for the detach pins on the rocket. + * + * It uses Boardcore's PinObserver to bind these functions to the GPIO pins. + * The handlers post an event on the EventBroker. + */ +class PinHandler : public Boardcore::Module +{ +public: + PinHandler(); + + bool start(); + + bool isStarted(); + + /** + * @brief Called when the deployment servo actuation is detected via the + * optical sensor. + */ + void onExpulsionPinTransition(Boardcore::PinTransition transition); + + /** + * @brief Returns a vector with all the pins data. + */ + std::map<PinsList, Boardcore::PinData> getPinsData(); + +private: + Boardcore::PrintLogger logger = Boardcore::Logging::getLogger("pinhandler"); + + std::atomic<bool> running; +}; + +} // namespace Payload diff --git a/src/boards/Payload/Radio/Radio.cpp b/src/boards/Payload/Radio/Radio.cpp new file mode 100644 index 000000000..bc84d7db7 --- /dev/null +++ b/src/boards/Payload/Radio/Radio.cpp @@ -0,0 +1,517 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#include <Payload/Actuators/Actuators.h> +#include <Payload/AltitudeTrigger/AltitudeTrigger.h> +#include <Payload/Buses.h> +#include <Payload/Radio/Radio.h> +#include <Payload/Sensors/Sensors.h> +#include <Payload/StateMachines/FlightModeManager/FlightModeManager.h> +#include <Payload/StateMachines/NASController/NASController.h> +#include <Payload/StateMachines/WingController/WingController.h> +#include <Payload/TMRepository/TMRepository.h> +#include <common/Events.h> +#include <common/Topics.h> +#include <drivers/interrupt/external_interrupts.h> +#include <events/EventBroker.h> +#include <radio/SX1278/SX1278Frontends.h> + +#include <memory> + +using namespace Boardcore; +using namespace Common; + +#define SX1278_IRQ_DIO0 EXTI3_IRQHandlerImpl +#define SX1278_IRQ_DIO1 EXTI4_IRQHandlerImpl +#define SX1278_IRQ_DIO3 EXTI5_IRQHandlerImpl + +void __attribute__((used)) SX1278_IRQ_DIO0() +{ + ModuleManager& modules = ModuleManager::getInstance(); + if (modules.get<Payload::Radio>()->transceiver) + { + modules.get<Payload::Radio>()->transceiver->handleDioIRQ(); + } +} + +void __attribute__((used)) SX1278_IRQ_DIO1() +{ + ModuleManager& modules = ModuleManager::getInstance(); + if (modules.get<Payload::Radio>()->transceiver) + { + modules.get<Payload::Radio>()->transceiver->handleDioIRQ(); + } +} + +void __attribute__((used)) SX1278_IRQ_DIO3() +{ + ModuleManager& modules = ModuleManager::getInstance(); + if (modules.get<Payload::Radio>()->transceiver) + { + modules.get<Payload::Radio>()->transceiver->handleDioIRQ(); + } +} +namespace Payload +{ + +Radio::Radio(TaskScheduler* sched) : scheduler(sched) {} + +bool Radio::start() +{ + ModuleManager& modules = ModuleManager::getInstance(); + // Config the transceiver + SX1278Fsk::Config config = { + .freq_rf = 868000000, + .freq_dev = 50000, + .bitrate = 48000, + .rx_bw = Boardcore::SX1278Fsk::Config::RxBw::HZ_125000, + .afc_bw = Boardcore::SX1278Fsk::Config::RxBw::HZ_125000, + .ocp = 120, + .power = 13, + .shaping = Boardcore::SX1278Fsk::Config::Shaping::GAUSSIAN_BT_1_0, + .dc_free = Boardcore::SX1278Fsk::Config::DcFree::WHITENING, + .enable_crc = false}; + + std::unique_ptr<SX1278::ISX1278Frontend> frontend = + std::make_unique<Skyward433Frontend>(); + + transceiver = new SX1278Fsk( + modules.get<Buses>()->spi6, miosix::radio::cs::getPin(), + miosix::radio::dio0::getPin(), miosix::radio::dio1::getPin(), + miosix::radio::dio3::getPin(), SPI::ClockDivider::DIV_128, + std::move(frontend)); + + // Config the radio + SX1278Fsk::Error error = transceiver->init(config); + + // Add periodic telemetry send task + uint8_t result = + scheduler->addTask([=]() { this->sendPeriodicMessage(); }, + RadioConfig::RADIO_PERIODIC_TELEMETRY_PERIOD, + TaskScheduler::Policy::RECOVER); + result *= scheduler->addTask( + [&]() + { + this->enqueueMsg( + modules.get<TMRepository>()->packSystemTm(MAV_STATS_ID, 0, 0)); + }, + RadioConfig::RADIO_PERIODIC_TELEMETRY_PERIOD * 2, + TaskScheduler::Policy::RECOVER); + + // Config mavDriver + mavDriver = new MavDriver( + transceiver, + [=](MavDriver*, const mavlink_message_t& msg) + { this->handleMavlinkMessage(msg); }, + RadioConfig::RADIO_SLEEP_AFTER_SEND, + RadioConfig::RADIO_OUT_BUFFER_MAX_AGE); + + // Check radio failure + if (error != SX1278Fsk::Error::NONE) + { + return false; + } + + // Start the mavlink driver thread + return mavDriver->start() && result != 0; +} + +void Radio::sendAck(const mavlink_message_t& msg) +{ + mavlink_message_t ackMsg; + mavlink_msg_ack_tm_pack(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &ackMsg, msg.msgid, + msg.seq); + enqueueMsg(ackMsg); +} + +void Radio::sendNack(const mavlink_message_t& msg) +{ + mavlink_message_t nackMsg; + mavlink_msg_nack_tm_pack(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &nackMsg, msg.msgid, + msg.seq); + enqueueMsg(nackMsg); +} + +void Radio::logStatus() { Logger::getInstance().log(mavDriver->getStatus()); } + +bool Radio::isStarted() +{ + return mavDriver->isStarted() && scheduler->isRunning(); +} + +void Radio::handleMavlinkMessage(const mavlink_message_t& msg) +{ + ModuleManager& modules = ModuleManager::getInstance(); + + switch (msg.msgid) + { + case MAVLINK_MSG_ID_PING_TC: + { + // Do nothing, just add the ack to the queue + break; + } + case MAVLINK_MSG_ID_COMMAND_TC: + { + // Let the handle command reply to the message + return handleCommand(msg); + } + case MAVLINK_MSG_ID_SYSTEM_TM_REQUEST_TC: + { + SystemTMList tmId = static_cast<SystemTMList>( + mavlink_msg_system_tm_request_tc_get_tm_id(&msg)); + + if (tmId == SystemTMList::MAV_SENSORS_STATE_ID) + { + mavlink_message_t msg; + mavlink_sensor_state_tm_t tm; + auto sensorsState = ModuleManager::getInstance() + .get<Sensors>() + ->getSensorInfo(); + for (SensorInfo i : sensorsState) + { + strcpy(tm.sensor_name, i.id.c_str()); + tm.state = 0; + if (i.isEnabled) + { + tm.state += 1; + } + if (i.isInitialized) + { + tm.state += 2; + } + mavlink_msg_sensor_state_tm_encode( + RadioConfig::MAV_SYSTEM_ID, RadioConfig::MAV_COMP_ID, + &msg, &tm); + enqueueMsg(msg); + } + } + else + { + + // Add to the queue the respose + mavlink_message_t response = + modules.get<TMRepository>()->packSystemTm(tmId, msg.msgid, + msg.seq); + + // Add the response to the queue + enqueueMsg(response); + + // Check if the TM repo answered with a NACK. If so the function + // must return to avoid sending a default ack + if (response.msgid == MAVLINK_MSG_ID_NACK_TM) + { + return; + } + } + break; + } + case MAVLINK_MSG_ID_SENSOR_TM_REQUEST_TC: + { + SensorsTMList tmId = static_cast<SensorsTMList>( + mavlink_msg_sensor_tm_request_tc_get_sensor_name(&msg)); + + // Add to the queue the respose + mavlink_message_t response = + modules.get<TMRepository>()->packSensorsTm(tmId, msg.msgid, + msg.seq); + + // Add the response to the queue + enqueueMsg(response); + + // Check if the TM repo answered with a NACK. If so the function + // must return to avoid sending a default ack + if (response.msgid == MAVLINK_MSG_ID_NACK_TM) + { + return; + } + + break; + } + case MAVLINK_MSG_ID_SERVO_TM_REQUEST_TC: + { + ServosList servoId = static_cast<ServosList>( + mavlink_msg_servo_tm_request_tc_get_servo_id(&msg)); + + // Add to the queue the respose + mavlink_message_t response = + modules.get<TMRepository>()->packServoTm(servoId, msg.msgid, + msg.seq); + + // Add the response to the queue + mavDriver->enqueueMsg(response); + + // Check if the TM repo answered with a NACK. If so the function + // must return to avoid sending a default ack + if (response.msgid == MAVLINK_MSG_ID_NACK_TM) + { + return; + } + + break; + } + case MAVLINK_MSG_ID_SET_SERVO_ANGLE_TC: + { + ServosList servoId = static_cast<ServosList>( + mavlink_msg_set_servo_angle_tc_get_servo_id(&msg)); + float angle = mavlink_msg_set_servo_angle_tc_get_angle(&msg); + + // Move the servo, if it fails send a nack + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE || + !modules.get<Actuators>()->setServoAngle(servoId, angle)) + { + return sendNack(msg); + } + + break; + } + case MAVLINK_MSG_ID_WIGGLE_SERVO_TC: + { + ServosList servoId = static_cast<ServosList>( + mavlink_msg_wiggle_servo_tc_get_servo_id(&msg)); + + // Send nack if the FMM is not in test mode + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE || + !modules.get<Actuators>()->wiggleServo(servoId)) + { + return sendNack(msg); + } + + break; + } + case MAVLINK_MSG_ID_RESET_SERVO_TC: + { + ServosList servoId = static_cast<ServosList>( + mavlink_msg_reset_servo_tc_get_servo_id(&msg)); + + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE || + !modules.get<Actuators>()->setServo(servoId, 0)) + { + return sendNack(msg); + } + + break; + } + case MAVLINK_MSG_ID_SET_REFERENCE_ALTITUDE_TC: + { + float altitude = + mavlink_msg_set_reference_altitude_tc_get_ref_altitude(&msg); + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE) + { + return sendNack(msg); + } + modules.get<NASController>()->setReferenceAltitude(altitude); + break; + } + case MAVLINK_MSG_ID_SET_REFERENCE_TEMPERATURE_TC: + { + float temperature = + mavlink_msg_set_reference_temperature_tc_get_ref_temp(&msg); + + temperature += 273.15; + + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE) + { + return sendNack(msg); + } + modules.get<NASController>()->setReferenceAltitude(temperature); + break; + } + case MAVLINK_MSG_ID_SET_DEPLOYMENT_ALTITUDE_TC: + { + float altitude = + mavlink_msg_set_deployment_altitude_tc_get_dpl_altitude(&msg); + + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE) + { + return sendNack(msg); + } + modules.get<AltitudeTrigger>()->setDeploymentAltitude(altitude); + break; + } + case MAVLINK_MSG_ID_SET_ORIENTATION_TC: + { + float yaw = mavlink_msg_set_orientation_tc_get_yaw(&msg); + float pitch = mavlink_msg_set_orientation_tc_get_pitch(&msg); + float roll = mavlink_msg_set_orientation_tc_get_roll(&msg); + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE) + { + return sendNack(msg); + } + modules.get<NASController>()->setOrientation(yaw, pitch, roll); + break; + } + case MAVLINK_MSG_ID_SET_COORDINATES_TC: + { + float latitude = mavlink_msg_set_coordinates_tc_get_latitude(&msg); + float longitude = + mavlink_msg_set_coordinates_tc_get_longitude(&msg); + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE) + { + return sendNack(msg); + } + modules.get<NASController>()->setCoordinates( + Eigen::Vector2f(latitude, longitude)); + break; + } + case MAVLINK_MSG_ID_SET_TARGET_COORDINATES_TC: + { + float latitude = mavlink_msg_set_coordinates_tc_get_latitude(&msg); + float longitude = + mavlink_msg_set_coordinates_tc_get_longitude(&msg); + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE) + { + return sendNack(msg); + } + modules.get<WingController>()->setTargetPosition( + Eigen::Vector2f(latitude, longitude)); + break; + } + case MAVLINK_MSG_ID_SET_ALGORITHM_TC: + { + u_int8_t algoID = + mavlink_msg_set_algorithm_tc_get_algorithm_number(&msg); + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE || + !modules.get<WingController>()->selectAlgorithm(algoID)) + { + return sendNack(msg); + } + + break; + } + case MAVLINK_MSG_ID_RAW_EVENT_TC: + { + uint8_t topicId = mavlink_msg_raw_event_tc_get_topic_id(&msg); + uint8_t eventId = mavlink_msg_raw_event_tc_get_event_id(&msg); + + // Send the event only if the flight mode manager is in test mode + if (modules.get<FlightModeManager>()->getStatus().state != + FlightModeManagerState::TEST_MODE) + { + return sendNack(msg); + } + + EventBroker::getInstance().post(topicId, eventId); + break; + } + } + + // At the end send the ack message + sendAck(msg); +} + +void Radio::handleCommand(const mavlink_message_t& msg) +{ + MavCommandList commandId = static_cast<MavCommandList>( + mavlink_msg_command_tc_get_command_id(&msg)); + + static const std::map<MavCommandList, Events> commandToEvent{ + {MAV_CMD_ARM, TMTC_ARM}, + {MAV_CMD_DISARM, TMTC_DISARM}, + {MAV_CMD_CALIBRATE, TMTC_CALIBRATE}, + {MAV_CMD_FORCE_INIT, TMTC_FORCE_INIT}, + {MAV_CMD_FORCE_LAUNCH, TMTC_FORCE_LAUNCH}, + {MAV_CMD_FORCE_LANDING, TMTC_FORCE_LANDING}, + {MAV_CMD_FORCE_APOGEE, TMTC_FORCE_APOGEE}, + {MAV_CMD_FORCE_EXPULSION, TMTC_FORCE_EXPULSION}, + {MAV_CMD_FORCE_DEPLOYMENT, TMTC_FORCE_DEPLOYMENT}, + {MAV_CMD_START_LOGGING, TMTC_START_LOGGING}, + {MAV_CMD_STOP_LOGGING, TMTC_STOP_LOGGING}, + {MAV_CMD_FORCE_REBOOT, TMTC_RESET_BOARD}, + {MAV_CMD_ENTER_TEST_MODE, TMTC_ENTER_TEST_MODE}, + {MAV_CMD_EXIT_TEST_MODE, TMTC_EXIT_TEST_MODE}, + {MAV_CMD_START_RECORDING, TMTC_START_RECORDING}, + {MAV_CMD_STOP_RECORDING, TMTC_STOP_RECORDING}, + }; + switch (commandId) + { + case MAV_CMD_SAVE_CALIBRATION: + { + // Save the sensor calibration and adopt it + ModuleManager::getInstance().get<Sensors>()->writeMagCalibration(); + break; + } + default: + { + // If the command is not a particular one, look for it inside the + // map + auto it = commandToEvent.find(commandId); + + if (it != commandToEvent.end()) + { + EventBroker::getInstance().post(it->second, TOPIC_TMTC); + } + else + { + return sendNack(msg); + } + } + } + // Acknowledge the message + sendAck(msg); +} + +void Radio::sendPeriodicMessage() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Send all the queue messages + { + Lock<FastMutex> lock(queueMutex); + + for (uint8_t i = 0; i < messageQueueIndex; i++) + { + mavDriver->enqueueMsg(messageQueue[i]); + } + + // Reset the index + messageQueueIndex = 0; + } + + mavDriver->enqueueMsg( + modules.get<TMRepository>()->packSystemTm(MAV_FLIGHT_ID, 0, 0)); +} + +void Radio::enqueueMsg(const mavlink_message_t& msg) +{ + { + Lock<FastMutex> lock(queueMutex); + + // Insert the message inside the queue only if there is enough space + if (messageQueueIndex < RadioConfig::MAVLINK_QUEUE_SIZE) + { + messageQueue[messageQueueIndex] = msg; + messageQueueIndex++; + } + } +} +} // namespace Payload diff --git a/src/boards/Payload/Radio/Radio.h b/src/boards/Payload/Radio/Radio.h new file mode 100644 index 000000000..4aa33b844 --- /dev/null +++ b/src/boards/Payload/Radio/Radio.h @@ -0,0 +1,102 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <Payload/Configs/RadioConfig.h> +#include <common/Mavlink.h> +#include <radio/MavlinkDriver/MavlinkDriver.h> +#include <radio/SX1278/SX1278Fsk.h> +#include <scheduler/TaskScheduler.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ +using MavDriver = Boardcore::MavlinkDriver<Boardcore::SX1278Fsk::MTU, + RadioConfig::RADIO_OUT_QUEUE_SIZE, + RadioConfig::RADIO_MAV_MSG_LENGTH>; + +class Radio : public Boardcore::Module +{ +public: + Radio(Boardcore::TaskScheduler* sched); + + /** + * @brief Starts the MavlinkDriver + */ + [[nodiscard]] bool start(); + + /** + * @brief Sends via radio an acknowledge message about the parameter passed + * message + */ + void sendAck(const mavlink_message_t& msg); + + /** + * @brief Sends via radio an non-acknowledge message about the parameter + * passed message + */ + void sendNack(const mavlink_message_t& msg); + + /** + * @brief Saves the MavlinkDriver and transceiver status + */ + void logStatus(); + + /** + * @brief Returns if the radio module is correctly started + */ + bool isStarted(); + + Boardcore::SX1278Fsk* transceiver = nullptr; + MavDriver* mavDriver = nullptr; + +private: + /** + * @brief Called by the MavlinkDriver when a message is received + */ + void handleMavlinkMessage(const mavlink_message_t& msg); + + /** + * @brief Called by the handleMavlinkMessage to handle a command message + */ + void handleCommand(const mavlink_message_t& msg); + + /** + * @brief Sends the periodic telemetry + */ + void sendPeriodicMessage(); + + /** + * @brief Inserts the mavlink message into the queue + */ + void enqueueMsg(const mavlink_message_t& msg); + + // Messages queue + mavlink_message_t messageQueue[RadioConfig::MAVLINK_QUEUE_SIZE]; + uint32_t messageQueueIndex = 0; + miosix::FastMutex queueMutex; + + Boardcore::PrintLogger logger = Boardcore::Logging::getLogger("Radio"); + Boardcore::TaskScheduler* scheduler = nullptr; +}; +} // namespace Payload \ No newline at end of file diff --git a/src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.cpp b/src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.cpp new file mode 100644 index 000000000..fb1b56949 --- /dev/null +++ b/src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.cpp @@ -0,0 +1,103 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/Sensors/RotatedIMU/RotatedIMU.h> + +using namespace Eigen; +using namespace Boardcore; + +namespace Payload +{ + +RotatedIMU::RotatedIMU(std::function<AccelerometerData()> accSampleFunction, + std::function<MagnetometerData()> magSampleFunction, + std::function<GyroscopeData()> gyroSampleFunction) + : accSample(accSampleFunction), magSample(magSampleFunction), + gyroSample(gyroSampleFunction), accT(Matrix3f::Identity()), + magT(Matrix3f::Identity()), gyroT(Matrix3f::Identity()) +{ +} + +void RotatedIMU::addAccTransformation(const Matrix3f& t) { accT = t * accT; } +void RotatedIMU::addMagTransformation(const Matrix3f& t) { magT = t * magT; } +void RotatedIMU::addGyroTransformation(const Matrix3f& t) { gyroT = t * gyroT; } + +void RotatedIMU::resetTransformations() +{ + accT = Matrix3f::Identity(); + magT = Matrix3f::Identity(); + gyroT = Matrix3f::Identity(); +} + +RotatedIMUData RotatedIMU::sampleImpl() +{ + Vector3f accResult = accT * static_cast<Vector3f>(accSample()); + Vector3f magResult = magT * static_cast<Vector3f>(magSample()); + Vector3f gyroResult = gyroT * static_cast<Vector3f>(gyroSample()); + + return {AccelerometerData{accResult}, GyroscopeData{gyroResult}, + MagnetometerData{magResult}}; +} + +// Static functions +Matrix3f RotatedIMU::rotateAroundX(float angle) +{ + Matrix3f rotation; + angle = angle * EIGEN_PI / 180.f; + + // clang-format off + rotation = Matrix3f{{1, 0, 0}, + {0, cosf(angle), -sinf(angle)}, + {0, sinf(angle), cosf(angle)}}; + // clang-format on + + return rotation; +} + +Matrix3f RotatedIMU::rotateAroundY(float angle) +{ + Matrix3f rotation; + angle = angle * EIGEN_PI / 180.f; + + // clang-format off + rotation = Matrix3f{{cosf(angle), 0, sinf(angle)}, + {0, 1, 0}, + {-sinf(angle), 0, cosf(angle)}}; + // clang-format on + + return rotation; +} + +Matrix3f RotatedIMU::rotateAroundZ(float angle) +{ + Matrix3f rotation; + angle = angle * EIGEN_PI / 180.f; + + // clang-format off + rotation = Matrix3f{{cosf(angle), -sinf(angle), 0}, + {sinf(angle), cosf(angle), 0}, + {0, 0, 1}}; + // clang-format on + + return rotation; +} +} // namespace Payload diff --git a/src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.h b/src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.h new file mode 100644 index 000000000..d939e8e54 --- /dev/null +++ b/src/boards/Payload/Sensors/RotatedIMU/RotatedIMU.h @@ -0,0 +1,120 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <Payload/Sensors/RotatedIMU/RotatedIMUData.h> +#include <sensors/Sensor.h> + +#include <Eigen/Eigen> +#include <functional> + +namespace Payload +{ +/** + * @brief Creates a "fake" sensor which allows the user + * to transform the values with transformation matrices. + * The default configuration (thus the reset one) + * comprehends identity matrices as transformation ones. + * + * @warning This is NOT a thread safe class + */ +class RotatedIMU : public Boardcore::Sensor<RotatedIMUData> +{ +public: + /** + * @brief Construct a new Rotated IMU object + * + * @param accSampleFunction Function to call to retrieve an accelerometer + * sample + * @param magSampleFunction Function to call to retrieve a magnetometer + * sample + * @param gyroSampleFunction Function to call to retrieve a gyroscope sample + */ + RotatedIMU( + std::function<Boardcore::AccelerometerData()> accSampleFunction = []() + { return Boardcore::AccelerometerData{}; }, + std::function<Boardcore::MagnetometerData()> magSampleFunction = []() + { return Boardcore::MagnetometerData{}; }, + std::function<Boardcore::GyroscopeData()> gyroSampleFunction = []() + { return Boardcore::GyroscopeData{}; }); + + /** + * @brief Multiplies the current accelerometer transformation + * @param transformation Transformation matrix to be multiplied to the + * current one + */ + void addAccTransformation(const Eigen::Matrix3f& t); + + /** + * @brief Multiplies the current magnetometer transformation + * @param transformation Transformation matrix to be multiplied to the + * current one + */ + void addMagTransformation(const Eigen::Matrix3f& t); + + /** + * @brief Multiplies the current gyroscope transformation + * @param transformation Transformation matrix to be multiplied to the + * current one + */ + void addGyroTransformation(const Eigen::Matrix3f& t); + + /** + * @brief Resets all the transformations to the original (Identity) ones + */ + void resetTransformations(); + + bool init() override { return true; } + bool selfTest() override { return true; } + + /** + * @brief Creates a rotation matrix around the X axis + * @param angle Angle in degrees + */ + static Eigen::Matrix3f rotateAroundX(float angle); + + /** + * @brief Creates a rotation matrix around the Y axis + * @param angle Angle in degrees + */ + static Eigen::Matrix3f rotateAroundY(float angle); + + /** + * @brief Creates a rotation matrix around the Z axis + * @param angle Angle in degrees + */ + static Eigen::Matrix3f rotateAroundZ(float angle); + +private: + RotatedIMUData sampleImpl() override; + + // Functions to sample the under neath sensors + std::function<Boardcore::AccelerometerData()> accSample; + std::function<Boardcore::MagnetometerData()> magSample; + std::function<Boardcore::GyroscopeData()> gyroSample; + + // Transformation matrices + Eigen::Matrix3f accT; + Eigen::Matrix3f magT; + Eigen::Matrix3f gyroT; +}; +} // namespace Payload diff --git a/src/boards/Payload/Sensors/RotatedIMU/RotatedIMUData.h b/src/boards/Payload/Sensors/RotatedIMU/RotatedIMUData.h new file mode 100644 index 000000000..455d1ae20 --- /dev/null +++ b/src/boards/Payload/Sensors/RotatedIMU/RotatedIMUData.h @@ -0,0 +1,60 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <sensors/SensorData.h> + +struct RotatedIMUData : public Boardcore::AccelerometerData, + public Boardcore::MagnetometerData, + public Boardcore::GyroscopeData +{ + RotatedIMUData() + : AccelerometerData{0, 0.0, 0.0, 0.0}, + MagnetometerData{0, 0.0, 0.0, 0.0}, GyroscopeData{0, 0.0, 0.0, 0.0} + + { + } + + RotatedIMUData(AccelerometerData acc, GyroscopeData gyr, + MagnetometerData mag) + : AccelerometerData(acc), MagnetometerData(mag), GyroscopeData(gyr) + { + } + + static std::string header() + { + return "accelerationTimestamp,accelerationX,accelerationY," + "accelerationZ,angularSpeedTimestamp,angularSpeedX," + "angularSpeedY,angularSpeedZ,magneticFieldTimestamp," + "magneticFieldX,magneticFieldY,magneticFieldZ\n"; + } + + void print(std::ostream& os) const + { + os << accelerationTimestamp << "," << accelerationX << "," + << accelerationY << "," << accelerationZ << "," + << angularSpeedTimestamp << "," << angularSpeedX << "," + << angularSpeedY << "," << angularSpeedZ << "," + << magneticFieldTimestamp << "," << magneticFieldX << "," + << magneticFieldY << "," << magneticFieldZ << "\n"; + } +}; diff --git a/src/boards/Payload/Sensors/SensorData.h b/src/boards/Payload/Sensors/SensorData.h new file mode 100644 index 000000000..7ea2399f7 --- /dev/null +++ b/src/boards/Payload/Sensors/SensorData.h @@ -0,0 +1,97 @@ + +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once +#include <sensors/LPS28DFW/LPS28DFWData.h> +namespace Payload +{ +struct LPS28DFW_1Data : Boardcore::LPS28DFWData +{ + explicit LPS28DFW_1Data(const Boardcore::LPS28DFWData& data) + : Boardcore::LPS28DFWData(data) + { + } + + LPS28DFW_1Data() {} + + static std::string header() + { + return "pressureTimestamp,pressure,temperatureTimestamp,temperature\n "; + } + + void print(std::ostream& os) const + { + os << pressureTimestamp << "," << pressure << "," + << temperatureTimestamp << "," << temperature << "\n"; + } +}; + +struct LPS28DFW_2Data : Boardcore::LPS28DFWData +{ + explicit LPS28DFW_2Data(const Boardcore::LPS28DFWData& data) + : Boardcore::LPS28DFWData(data) + { + } + + LPS28DFW_2Data() {} + + static std::string header() + { + return "pressureTimestamp,pressure,temperatureTimestamp,temperature\n "; + } + + void print(std::ostream& os) const + { + os << pressureTimestamp << "," << pressure << "," + << temperatureTimestamp << "," << temperature << "\n"; + } +}; + +struct SensorsCalibrationParameter +{ + uint64_t timestamp; + float referencePressure; + float offsetStatic; + float offsetDynamic; + + SensorsCalibrationParameter(uint64_t timestamp, float referencePressure, + float offsetStatic, float offsetDynamic) + : timestamp(timestamp), referencePressure(referencePressure), + offsetStatic(offsetStatic), offsetDynamic(offsetDynamic) + { + } + + SensorsCalibrationParameter() : SensorsCalibrationParameter(0, 0, 0, 0) {} + + static std::string header() + { + return "timestamp,referencePressure,offsetStatic,offsetDynamic"; + } + + void print(std::ostream& os) const + { + os << timestamp << "," << referencePressure << "," << offsetStatic + << "," << offsetDynamic << "\n"; + } +}; + +} // namespace Payload diff --git a/src/boards/Payload/Sensors/Sensors.cpp b/src/boards/Payload/Sensors/Sensors.cpp new file mode 100644 index 000000000..9adc0129e --- /dev/null +++ b/src/boards/Payload/Sensors/Sensors.cpp @@ -0,0 +1,687 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "Sensors.h" + +#include <Payload/Buses.h> +#include <Payload/Configs/SensorsConfig.h> +#include <common/ReferenceConfig.h> +#include <interfaces-impl/hwmapping.h> + +using namespace Boardcore; +using namespace std; +using namespace Payload::SensorsConfig; +namespace Payload +{ +LPS22DFData Sensors::getLPS22DFLastSample() +{ + miosix::PauseKernelLock lock; + return lps22df != nullptr ? lps22df->getLastSample() : LPS22DFData{}; +} +LPS28DFWData Sensors::getLPS28DFW_1LastSample() +{ + miosix::PauseKernelLock lock; + return lps28dfw_1 != nullptr ? lps28dfw_1->getLastSample() : LPS28DFWData{}; +} +LPS28DFWData Sensors::getLPS28DFW_2LastSample() +{ + miosix::PauseKernelLock lock; + return lps28dfw_2 != nullptr ? lps28dfw_2->getLastSample() : LPS28DFWData{}; +} +H3LIS331DLData Sensors::getH3LIS331DLLastSample() +{ + miosix::PauseKernelLock lock; + return h3lis331dl != nullptr ? h3lis331dl->getLastSample() + : H3LIS331DLData{}; +} +LIS2MDLData Sensors::getLIS2MDLLastSample() +{ + miosix::PauseKernelLock lock; + return lis2mdl != nullptr ? lis2mdl->getLastSample() : LIS2MDLData{}; +} +UBXGPSData Sensors::getGPSLastSample() +{ + miosix::PauseKernelLock lock; + return ubxgps != nullptr ? ubxgps->getLastSample() : UBXGPSData{}; +} +LSM6DSRXData Sensors::getLSM6DSRXLastSample() +{ + miosix::PauseKernelLock lock; + return lsm6dsrx != nullptr ? lsm6dsrx->getLastSample() : LSM6DSRXData{}; +} +ADS131M08Data Sensors::getADS131M08LastSample() +{ + miosix::PauseKernelLock lock; + return ads131m08 != nullptr ? ads131m08->getLastSample() : ADS131M08Data{}; +} + +HSCMRNN015PAData Sensors::getStaticPressureLastSample() +{ + miosix::PauseKernelLock lock; + return staticPressure != nullptr ? staticPressure->getLastSample() + : HSCMRNN015PAData{}; +} + +SSCMRNN030PAData Sensors::getDynamicPressureLastSample() +{ + miosix::PauseKernelLock lock; + return dynamicPressure != nullptr ? dynamicPressure->getLastSample() + : SSCMRNN030PAData{}; +} +PitotData Sensors::getPitotLastSample() +{ + miosix::PauseKernelLock lock; + return pitot != nullptr ? pitot->getLastSample() : PitotData{}; +} + +// Processed Getters +BatteryVoltageSensorData Sensors::getBatteryVoltageLastSample() +{ + // Do not need to pause the kernel, the last sample getter is already + // protected + ADS131M08Data sample = getADS131M08LastSample(); + BatteryVoltageSensorData data; + + // Populate the data + data.voltageTimestamp = sample.timestamp; + data.channelId = static_cast<uint8_t>(BATTERY_VOLTAGE_CHANNEL); + data.voltage = sample.getVoltage(BATTERY_VOLTAGE_CHANNEL).voltage; + data.batVoltage = sample.getVoltage(BATTERY_VOLTAGE_CHANNEL).voltage * + BATTERY_VOLTAGE_CONVERSION_FACTOR; + return data; +} + +BatteryVoltageSensorData Sensors::getCamBatteryVoltageLastSample() +{ + // Do not need to pause the kernel, the last sample getter is already + // protected + ADS131M08Data sample = getADS131M08LastSample(); + BatteryVoltageSensorData data; + + // Populate the data + data.voltageTimestamp = sample.timestamp; + data.channelId = static_cast<uint8_t>(CAM_BATTERY_VOLTAGE_CHANNEL); + data.voltage = sample.getVoltage(CAM_BATTERY_VOLTAGE_CHANNEL).voltage; + data.batVoltage = sample.getVoltage(CAM_BATTERY_VOLTAGE_CHANNEL).voltage * + BATTERY_VOLTAGE_CONVERSION_FACTOR; + return data; +} + +CurrentData Sensors::getCurrentLastSample() +{ + // Do not need to pause the kernel, the last sample getter is already + // protected + ADS131M08Data sample = getADS131M08LastSample(); + CurrentData data; + + // Populate the data + data.currentTimestamp = sample.timestamp; + data.current = + (sample.getVoltage(CURRENT_CHANNEL).voltage - CURRENT_OFFSET) * + CURRENT_CONVERSION_FACTOR; + return data; +} + +RotatedIMUData Sensors::getIMULastSample() +{ + miosix::PauseKernelLock lock; + return imu != nullptr ? imu->getLastSample() : RotatedIMUData{}; +} + +MagnetometerData Sensors::getCalibratedMagnetometerLastSample() +{ + // Do not need to pause the kernel, the last sample getter is already + // protected + MagnetometerData lastSample = getLIS2MDLLastSample(); + MagnetometerData result; + + // Correct the result and copy the timestamp + { + miosix::Lock<FastMutex> l(calibrationMutex); + result = + static_cast<MagnetometerData>(magCalibration.correct(lastSample)); + } + + result.magneticFieldTimestamp = lastSample.magneticFieldTimestamp; + return result; +} + +Sensors::Sensors(TaskScheduler* sched) : scheduler(sched), sensorsCounter(0) {} + +bool Sensors::start() +{ + // Read the magnetometer calibration from predefined file + magCalibration.fromFile("magCalibration.csv"); + // Init all the sensors + lps22dfInit(); + lps28dfw_1Init(); + lps28dfw_2Init(); + h3lis331dlInit(); + lis2mdlInit(); + ubxgpsInit(); + lsm6dsrxInit(); + ads131m08Init(); + staticPressureInit(); + dynamicPressureInit(); + pitotInit(); + imuInit(); + + // Add the magnetometer calibration to the scheduler + size_t result = scheduler->addTask( + [&]() + { + // Gather the last sample data + MagnetometerData lastSample = getLIS2MDLLastSample(); + + // Feed the data to the calibrator inside a protected area. + // Contention is not high and the use of a mutex is suitable to + // avoid pausing the kernel for this calibration operation + { + miosix::Lock<FastMutex> l(calibrationMutex); + magCalibrator.feed(lastSample); + } + }, + MAG_CALIBRATION_PERIOD); + + // Create sensor manager with populated map and configured scheduler + manager = new SensorManager(sensorMap, scheduler); + return manager->start() && result != 0; +} + +void Sensors::stop() { manager->stop(); } + +bool Sensors::isStarted() +{ + return manager->areAllSensorsInitialized() && scheduler->isRunning(); +} + +void Sensors::calibrate() +{ + // Create the stats to calibrate the barometers + Stats lps28dfw1Stats; + Stats lps28dfw2Stats; + Stats staticPressureStats; + Stats dynamicPressureStats; + + // Add N samples to the stats + for (unsigned int i = 0; i < SensorsConfig::CALIBRATION_SAMPLES; i++) + { + lps28dfw1Stats.add(getLPS28DFW_1LastSample().pressure); + lps28dfw2Stats.add(getLPS28DFW_2LastSample().pressure); + staticPressureStats.add(getStaticPressureLastSample().pressure); + dynamicPressureStats.add(getDynamicPressureLastSample().pressure); + + // Delay for the expected period + miosix::Thread::sleep(SensorsConfig::CALIBRATION_PERIOD); + } + + // Compute the difference between the mean value from LPS28DFW + float reference = + (lps28dfw1Stats.getStats().mean + lps28dfw2Stats.getStats().mean) / 2.f; + + staticPressure->updateOffset(staticPressureStats.getStats().mean - + reference); + dynamicPressure->updateOffset(dynamicPressureStats.getStats().mean - + reference); + + // Log the offsets + SensorsCalibrationParameter cal{}; + cal.timestamp = TimestampTimer::getTimestamp(); + cal.offsetStatic = staticPressureStats.getStats().mean - reference; + cal.offsetDynamic = dynamicPressureStats.getStats().mean - reference; + cal.referencePressure = reference; + + Logger::getInstance().log(cal); +} + +bool Sensors::writeMagCalibration() +{ + // Compute the calibration result in protected area + { + miosix::Lock<FastMutex> l(calibrationMutex); + SixParametersCorrector cal = magCalibrator.computeResult(); + + // Check result validity + if (!isnan(cal.getb()[0]) && !isnan(cal.getb()[1]) && + !isnan(cal.getb()[2]) && !isnan(cal.getA()[0]) && + !isnan(cal.getA()[1]) && !isnan(cal.getA()[2])) + { + magCalibration = cal; + + // Save the calibration to the calibration file + return magCalibration.toFile("magCalibration.csv"); + } + } + return false; +} + +void Sensors::lps22dfInit() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Get the correct SPI configuration + SPIBusConfig config = LPS22DF::getDefaultSPIConfig(); + config.clockDivider = SPI::ClockDivider::DIV_16; + + // Configure the device + LPS22DF::Config sensorConfig; + sensorConfig.avg = LPS22DF_AVG; + sensorConfig.odr = LPS22DF_ODR; + + // Create sensor instance with configured parameters + lps22df = new LPS22DF(modules.get<Buses>()->spi3, + miosix::sensors::LPS22DF::cs::getPin(), config, + sensorConfig); + + // Emplace the sensor inside the map + SensorInfo info("LPS22DF", LPS22DF_PERIOD, + bind(&Sensors::lps22dfCallback, this)); + sensorMap.emplace(make_pair(lps22df, info)); + + // used for the sensor state + auto lps22Status = + ([&]() -> SensorInfo { return manager->getSensorInfo(lps22df); }); + sensorsInit[sensorsCounter] = lps22Status; + sensorsCounter++; +} +void Sensors::lps28dfw_1Init() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Configure the sensor + LPS28DFW::SensorConfig config{false, LPS28DFW_FSR, LPS28DFW_AVG, + LPS28DFW_ODR, false}; + + // Create sensor instance with configured parameters + lps28dfw_1 = new LPS28DFW(modules.get<Buses>()->i2c1, config); + + // Emplace the sensor inside the map + SensorInfo info("LPS28DFW_1", LPS28DFW_PERIOD, + bind(&Sensors::lps28dfw_1Callback, this)); + sensorMap.emplace(make_pair(lps28dfw_1, info)); + + // used for the sensor state + auto lps28_1Status = + ([&]() -> SensorInfo { return manager->getSensorInfo(lps28dfw_1); }); + sensorsInit[sensorsCounter] = lps28_1Status; + sensorsCounter++; +} +void Sensors::lps28dfw_2Init() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Configure the sensor + LPS28DFW::SensorConfig config{true, LPS28DFW_FSR, LPS28DFW_AVG, + LPS28DFW_ODR, false}; + + // Create sensor instance with configured parameters + lps28dfw_2 = new LPS28DFW(modules.get<Buses>()->i2c1, config); + + // Emplace the sensor inside the map + SensorInfo info("LPS28DFW_2", LPS28DFW_PERIOD, + bind(&Sensors::lps28dfw_2Callback, this)); + sensorMap.emplace(make_pair(lps28dfw_2, info)); + + // used for the sensor state + auto lps28_2Status = + ([&]() -> SensorInfo { return manager->getSensorInfo(lps28dfw_2); }); + sensorsInit[sensorsCounter] = lps28_2Status; + sensorsCounter++; +} +void Sensors::h3lis331dlInit() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Get the correct SPI configuration + SPIBusConfig config = H3LIS331DL::getDefaultSPIConfig(); + config.clockDivider = SPI::ClockDivider::DIV_16; + + // Create sensor instance with configured parameters + h3lis331dl = new H3LIS331DL( + modules.get<Buses>()->spi3, miosix::sensors::H3LIS331DL::cs::getPin(), + config, H3LIS331DL_ODR, H3LIS331DL_BDU, H3LIS331DL_FSR); + + // Emplace the sensor inside the map + SensorInfo info("H3LIS331DL", H3LIS331DL_PERIOD, + bind(&Sensors::h3lis331dlCallback, this)); + sensorMap.emplace(make_pair(h3lis331dl, info)); + + // used for the sensor state + auto h3lis331Status = + ([&]() -> SensorInfo { return manager->getSensorInfo(h3lis331dl); }); + sensorsInit[sensorsCounter] = h3lis331Status; + sensorsCounter++; +} +void Sensors::lis2mdlInit() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Get the correct SPI configuration + SPIBusConfig config = LIS2MDL::getDefaultSPIConfig(); + config.clockDivider = SPI::ClockDivider::DIV_16; + + // Configure the sensor + LIS2MDL::Config sensorConfig; + sensorConfig.deviceMode = LIS2MDL_OPERATIVE_MODE; + sensorConfig.odr = LIS2MDL_ODR; + sensorConfig.temperatureDivider = LIS2MDL_TEMPERATURE_DIVIDER; + + // Create sensor instance with configured parameters + lis2mdl = new LIS2MDL(modules.get<Buses>()->spi3, + miosix::sensors::LIS2MDL::cs::getPin(), config, + sensorConfig); + + // Emplace the sensor inside the map + SensorInfo info("LIS2MDL", LIS2MDL_PERIOD, + bind(&Sensors::lis2mdlCallback, this)); + sensorMap.emplace(make_pair(lis2mdl, info)); + + // used for the sensor state + auto lis2mdlStatus = + ([&]() -> SensorInfo { return manager->getSensorInfo(lis2mdl); }); + sensorsInit[sensorsCounter] = lis2mdlStatus; + sensorsCounter++; +} + +void Sensors::ubxgpsInit() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Get the correct SPI configuration + SPIBusConfig config = UBXGPSSpi::getDefaultSPIConfig(); + config.clockDivider = SPI::ClockDivider::DIV_64; + + // Create sensor instance with configured parameters + ubxgps = new UBXGPSSpi(modules.get<Buses>()->spi4, + miosix::sensors::GPS::cs::getPin(), config, 5); + + // Emplace the sensor inside the map + SensorInfo info("UBXGPS", UBXGPS_PERIOD, + bind(&Sensors::ubxgpsCallback, this)); + sensorMap.emplace(make_pair(ubxgps, info)); + + // used for the sensor state + auto ubxStatus = + ([&]() -> SensorInfo { return manager->getSensorInfo(ubxgps); }); + sensorsInit[sensorsCounter] = ubxStatus; + sensorsCounter++; +} + +void Sensors::lsm6dsrxInit() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Configure the SPI + SPIBusConfig config; + config.clockDivider = SPI::ClockDivider::DIV_32; + config.mode = SPI::Mode::MODE_0; + + // Configure the sensor + LSM6DSRXConfig sensorConfig; + sensorConfig.bdu = LSM6DSRX_BDU; + + // Accelerometer + sensorConfig.fsAcc = LSM6DSRX_ACC_FS; + sensorConfig.odrAcc = LSM6DSRX_ACC_ODR; + sensorConfig.opModeAcc = LSM6DSRX_OPERATING_MODE; + + // Gyroscope + sensorConfig.fsGyr = LSM6DSRX_GYR_FS; + sensorConfig.odrGyr = LSM6DSRX_GYR_ODR; + sensorConfig.opModeGyr = LSM6DSRX_OPERATING_MODE; + + // Fifo + sensorConfig.fifoMode = LSM6DSRX_FIFO_MODE; + sensorConfig.fifoTimestampDecimation = LSM6DSRX_FIFO_TIMESTAMP_DECIMATION; + sensorConfig.fifoTemperatureBdr = LSM6DSRX_FIFO_TEMPERATURE_BDR; + + // Create sensor instance with configured parameters + lsm6dsrx = new LSM6DSRX(modules.get<Buses>()->spi1, + miosix::sensors::LSM6DSRX::cs::getPin(), config, + sensorConfig); + + // Emplace the sensor inside the map + SensorInfo info("LSM6DSRX", LSM6DSRX_PERIOD, + bind(&Sensors::lsm6dsrxCallback, this)); + sensorMap.emplace(make_pair(lsm6dsrx, info)); + + // used for the sensor state + auto lsm6dsrxStatus = + ([&]() -> SensorInfo { return manager->getSensorInfo(lsm6dsrx); }); + sensorsInit[sensorsCounter] = lsm6dsrxStatus; + sensorsCounter++; +} + +void Sensors::ads131m08Init() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Configure the SPI + SPIBusConfig config; + config.clockDivider = SPI::ClockDivider::DIV_32; + + // Configure the device + ADS131M08::Config sensorConfig; + sensorConfig.oversamplingRatio = ADS131M08_OVERSAMPLING_RATIO; + sensorConfig.globalChopModeEnabled = ADS131M08_GLOBAL_CHOP_MODE; + + // Create the sensor instance with configured parameters + ads131m08 = new ADS131M08(modules.get<Buses>()->spi4, + miosix::sensors::ADS131::cs::getPin(), config, + sensorConfig); + + // Emplace the sensor inside the map + SensorInfo info("ADS131M08", ADS131M08_PERIOD, + bind(&Sensors::ads131m08Callback, this)); + sensorMap.emplace(make_pair(ads131m08, info)); + + // used for the sensor state + auto ads131m08Status = + ([&]() -> SensorInfo { return manager->getSensorInfo(ads131m08); }); + sensorsInit[sensorsCounter] = ads131m08Status; + sensorsCounter++; +} + +void Sensors::staticPressureInit() +{ + // create lambda function to read the voltage + auto readVoltage = ( + [&]() -> ADCData + { + ADS131M08Data sample = ads131m08->getLastSample(); + return sample.getVoltage( + STATIC_PRESSURE_CHANNEL); + }); + + staticPressure = new HSCMRNN015PA(readVoltage, ADC_VOLTAGE_RANGE); + + // Emplace the sensor inside the map + SensorInfo info("StaticPressure", ADS131M08_PERIOD, + bind(&Sensors::staticPressureCallback, this)); + sensorMap.emplace(make_pair(staticPressure, info)); +} + +void Sensors::dynamicPressureInit() +{ + // create lambda function to read the voltage + auto readVoltage = ( + [&]() -> ADCData + { + auto sample = ads131m08->getLastSample(); + return sample.getVoltage( + DYNAMIC_PRESSURE_CHANNEL); + }); + + dynamicPressure = new SSCMRNN030PA(readVoltage, ADC_VOLTAGE_RANGE); + + // Emplace the sensor inside the map + SensorInfo info("TotalPressure", ADS131M08_PERIOD, + bind(&Sensors::dynamicPressureCallback, this)); + sensorMap.emplace(make_pair(dynamicPressure, info)); +} + +void Sensors::pitotInit() +{ + // create lambda function to read the pressure + function<float()> getDynamicPressure( + [&]() { return dynamicPressure->getLastSample().pressure; }); + function<float()> getStaticPressure( + [&]() { return staticPressure->getLastSample().pressure; }); + + pitot = new Pitot(getDynamicPressure, getStaticPressure); + pitot->setReferenceValues(Common::ReferenceConfig::defaultReferenceValues); + + // Emplace the sensor inside the map + SensorInfo info("Pitot", ADS131M08_PERIOD, + bind(&Sensors::pitotCallback, this)); + sensorMap.emplace(make_pair(pitot, info)); +} + +void Sensors::pitotSetReferenceAltitude(float altitude) +{ + // Need to pause the kernel because the only invocation comes from the radio + // which is a separate thread + miosix::PauseKernelLock l; + + ReferenceValues reference = pitot->getReferenceValues(); + reference.refAltitude = altitude; + pitot->setReferenceValues(reference); +} + +void Sensors::pitotSetReferenceTemperature(float temperature) +{ + // Need to pause the kernel because the only invocation comes from the radio + // which is a separate thread + miosix::PauseKernelLock l; + + ReferenceValues reference = pitot->getReferenceValues(); + reference.refTemperature = temperature + 273.15f; + pitot->setReferenceValues(reference); +} + +std::array<SensorInfo, 8> Sensors::getSensorInfo() +{ + std::array<SensorInfo, 8> sensorState; + for (size_t i = 0; i < sensorsInit.size(); i++) + { + sensorState[i] = sensorsInit[i](); + } + return sensorState; +} + +void Sensors::imuInit() +{ + // Register the IMU as the fake sensor, passing as parameters the + // methods to retrieve real data. The sensor is not synchronized, but + // the sampling thread is always the same. + imu = new RotatedIMU( + bind(&LSM6DSRX::getLastSample, lsm6dsrx), + bind(&Sensors::getCalibratedMagnetometerLastSample, this), + bind(&LSM6DSRX::getLastSample, lsm6dsrx)); + + // Invert the Y axis on the magnetometer + Eigen::Matrix3f m{{1, 0, 0}, {0, -1, 0}, {0, 0, 1}}; + imu->addMagTransformation(m); + + // Emplace the sensor inside the map (TODO CHANGE PERIOD INTO NON MAGIC) + SensorInfo info("RotatedIMU", IMU_PERIOD, + bind(&Sensors::imuCallback, this)); + sensorMap.emplace(make_pair(imu, info)); +} + +void Sensors::lps22dfCallback() +{ + LPS22DFData lastSample = lps22df->getLastSample(); + Logger::getInstance().log(lastSample); +} +void Sensors::lps28dfw_1Callback() +{ + LPS28DFW_1Data lastSample = + static_cast<LPS28DFW_1Data>(lps28dfw_1->getLastSample()); + + Logger::getInstance().log(lastSample); +} +void Sensors::lps28dfw_2Callback() +{ + LPS28DFW_2Data lastSample = + static_cast<LPS28DFW_2Data>(lps28dfw_2->getLastSample()); + Logger::getInstance().log(lastSample); +} +void Sensors::h3lis331dlCallback() +{ + H3LIS331DLData lastSample = h3lis331dl->getLastSample(); + Logger::getInstance().log(lastSample); +} +void Sensors::lis2mdlCallback() +{ + LIS2MDLData lastSample = lis2mdl->getLastSample(); + Logger::getInstance().log(lastSample); +} +void Sensors::ubxgpsCallback() +{ + UBXGPSData lastSample = ubxgps->getLastSample(); + Logger::getInstance().log(lastSample); +} +void Sensors::lsm6dsrxCallback() +{ + LSM6DSRXData lastSample = lsm6dsrx->getLastSample(); + + auto& fifo = lsm6dsrx->getLastFifo(); + uint16_t fifoSize = lsm6dsrx->getLastFifoSize(); + + // For every instance inside the fifo log the sample + for (uint16_t i = 0; i < fifoSize; i++) + { + Logger::getInstance().log(fifo.at(i)); + } + Logger::getInstance().log(lastSample); +} +void Sensors::ads131m08Callback() +{ + ADS131M08Data lastSample = ads131m08->getLastSample(); + Logger::getInstance().log(lastSample); +} + +void Sensors::staticPressureCallback() +{ + HSCMRNN015PAData lastSample = staticPressure->getLastSample(); + Logger::getInstance().log(lastSample); +} + +void Sensors::dynamicPressureCallback() +{ + SSCMRNN030PAData lastSample = dynamicPressure->getLastSample(); + Logger::getInstance().log(lastSample); +} + +void Sensors::pitotCallback() +{ + PitotData lastSample = pitot->getLastSample(); + Logger::getInstance().log(lastSample); +} +void Sensors::imuCallback() +{ + RotatedIMUData lastSample = imu->getLastSample(); + Logger::getInstance().log(lastSample); +} + +} // namespace Payload diff --git a/src/boards/Payload/Sensors/Sensors.h b/src/boards/Payload/Sensors/Sensors.h new file mode 100644 index 000000000..faeee0b84 --- /dev/null +++ b/src/boards/Payload/Sensors/Sensors.h @@ -0,0 +1,180 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <Payload/Configs/SensorsConfig.h> +#include <Payload/Sensors/RotatedIMU/RotatedIMU.h> +#include <sensors/ADS131M08/ADS131M08.h> +#include <sensors/H3LIS331DL/H3LIS331DL.h> +#include <sensors/LIS2MDL/LIS2MDL.h> +#include <sensors/LPS22DF/LPS22DF.h> +#include <sensors/LPS28DFW/LPS28DFW.h> +#include <sensors/LSM6DSRX/LSM6DSRX.h> +#include <sensors/SensorData.h> +#include <sensors/SensorManager.h> +#include <sensors/UBXGPS/UBXGPSSpi.h> +#include <sensors/analog/BatteryVoltageSensorData.h> +#include <sensors/analog/Pitot/Pitot.h> +#include <sensors/analog/Pitot/PitotData.h> +#include <sensors/analog/pressure/honeywell/HSCMRNN015PA.h> +#include <sensors/analog/pressure/honeywell/SSCMRNN030PA.h> +#include <sensors/calibration/SoftAndHardIronCalibration/SoftAndHardIronCalibration.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +#include "SensorData.h" + +namespace Payload +{ + +class Sensors : public Boardcore::Module +{ +public: + explicit Sensors(Boardcore::TaskScheduler* sched); + + [[nodiscard]] bool start(); + + /** + * @brief Stops the sensor manager + * @warning Stops the passed scheduler + */ + void stop(); + + /** + * @brief Returns if all the sensors are started successfully + */ + bool isStarted(); + + /** + * @brief Calibrates the sensors with an offset + */ + void calibrate(); + + /** + * @brief Takes the result of the live magnetometer calibration and applies + * it to the current calibration + writes it in the csv file + * + * @return true if the write was successful + */ + bool writeMagCalibration(); + + // Sensor getters + Boardcore::LPS22DFData getLPS22DFLastSample(); + Boardcore::LPS28DFWData getLPS28DFW_1LastSample(); + Boardcore::LPS28DFWData getLPS28DFW_2LastSample(); + Boardcore::H3LIS331DLData getH3LIS331DLLastSample(); + Boardcore::LIS2MDLData getLIS2MDLLastSample(); + Boardcore::UBXGPSData getGPSLastSample(); + Boardcore::LSM6DSRXData getLSM6DSRXLastSample(); + Boardcore::ADS131M08Data getADS131M08LastSample(); + + // Processed getters + Boardcore::BatteryVoltageSensorData getBatteryVoltageLastSample(); + Boardcore::BatteryVoltageSensorData getCamBatteryVoltageLastSample(); + Boardcore::CurrentData getCurrentLastSample(); + RotatedIMUData getIMULastSample(); + Boardcore::MagnetometerData getCalibratedMagnetometerLastSample(); + Boardcore::HSCMRNN015PAData getStaticPressureLastSample(); + Boardcore::SSCMRNN030PAData getDynamicPressureLastSample(); + Boardcore::PitotData getPitotLastSample(); + + void pitotSetReferenceAltitude(float altitude); + void pitotSetReferenceTemperature(float temperature); + + std::array<Boardcore::SensorInfo, 8> getSensorInfo(); + +private: + // Init and callbacks methods + void lps22dfInit(); + void lps22dfCallback(); + + void lps28dfw_1Init(); + void lps28dfw_1Callback(); + + void lps28dfw_2Init(); + void lps28dfw_2Callback(); + + void h3lis331dlInit(); + void h3lis331dlCallback(); + + void lis2mdlInit(); + void lis2mdlCallback(); + + void ubxgpsInit(); + void ubxgpsCallback(); + + void lsm6dsrxInit(); + void lsm6dsrxCallback(); + + void ads131m08Init(); + void ads131m08Callback(); + + void staticPressureInit(); + void staticPressureCallback(); + + void dynamicPressureInit(); + void dynamicPressureCallback(); + + void pitotInit(); + void pitotCallback(); + + void imuInit(); + void imuCallback(); + + // Sensors instances + Boardcore::LPS22DF* lps22df = nullptr; + Boardcore::LPS28DFW* lps28dfw_1 = nullptr; + Boardcore::LPS28DFW* lps28dfw_2 = nullptr; + Boardcore::H3LIS331DL* h3lis331dl = nullptr; + Boardcore::LIS2MDL* lis2mdl = nullptr; + Boardcore::UBXGPSSpi* ubxgps = nullptr; + Boardcore::LSM6DSRX* lsm6dsrx = nullptr; + Boardcore::ADS131M08* ads131m08 = nullptr; + + // Fake processed sensors + RotatedIMU* imu = nullptr; + Boardcore::HSCMRNN015PA* staticPressure = nullptr; + Boardcore::SSCMRNN030PA* dynamicPressure = nullptr; + Boardcore::Pitot* pitot = nullptr; + + // Magnetometer live calibration + Boardcore::SoftAndHardIronCalibration magCalibrator; + Boardcore::SixParametersCorrector magCalibration; + miosix::FastMutex calibrationMutex; + + // Sensor manager + Boardcore::SensorManager* manager = nullptr; + Boardcore::SensorManager::SensorMap_t sensorMap; + Boardcore::TaskScheduler* scheduler = nullptr; + + uint8_t sensorsCounter; + + // SD logger + Boardcore::Logger& SDlogger = Boardcore::Logger::getInstance(); + + Boardcore::PrintLogger logger = Boardcore::Logging::getLogger("Sensors"); + + std::array<std::function<Boardcore::SensorInfo()>, + SensorsConfig::NUMBER_OF_SENSORS> + sensorsInit; +}; +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.cpp b/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.cpp new file mode 100644 index 000000000..a5d45e037 --- /dev/null +++ b/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.cpp @@ -0,0 +1,668 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Authors: Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "FlightModeManager.h" + +#include <Payload/Actuators/Actuators.h> +#include <Payload/AltitudeTrigger/AltitudeTrigger.h> +#include <Payload/CanHandler/CanHandler.h> +#include <Payload/Configs/FlightModeManagerConfig.h> +#include <Payload/Sensors/Sensors.h> +#include <Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.h> +#include <common/Events.h> +#include <drivers/timer/TimestampTimer.h> +#include <events/EventBroker.h> + +using namespace miosix; +using namespace Boardcore; +using namespace Common; + +namespace Payload +{ +FlightModeManager::FlightModeManager() + : HSM(&FlightModeManager::state_on_ground) +{ + EventBroker::getInstance().subscribe(this, TOPIC_FLIGHT); + EventBroker::getInstance().subscribe(this, TOPIC_FMM); + EventBroker::getInstance().subscribe(this, TOPIC_TMTC); + EventBroker::getInstance().subscribe(this, TOPIC_CAN); + EventBroker::getInstance().subscribe(this, TOPIC_NAS); +} + +FlightModeManager::~FlightModeManager() +{ + EventBroker::getInstance().unsubscribe(this); +} + +FlightModeManagerStatus FlightModeManager::getStatus() +{ + PauseKernelLock lock; + return status; +} + +State FlightModeManager::state_on_ground(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_top); + } + case EV_INIT: + { + return transition(&FlightModeManager::state_init); + } + case TMTC_START_LOGGING: + { + Logger::getInstance().start(); + return HANDLED; + } + case TMTC_STOP_LOGGING: + { + Logger::getInstance().stop(); + return HANDLED; + } + case TMTC_RESET_BOARD: + { + reboot(); + return HANDLED; + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_init(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::INIT); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_on_ground); + } + case EV_INIT: + { + return HANDLED; + } + case FMM_INIT_OK: + { + return transition(&FlightModeManager::state_init_done); + } + case FMM_INIT_ERROR: + { + return transition(&FlightModeManager::state_init_error); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_init_error(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::INIT_ERROR); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_on_ground); + } + case EV_INIT: + { + return HANDLED; + } + case CAN_FORCE_INIT: + case TMTC_FORCE_INIT: + { + if (event != CAN_FORCE_INIT) + { + ModuleManager::getInstance().get<CanHandler>()->sendEvent( + CanConfig::EventId::FORCE_INIT); + } + return transition(&FlightModeManager::state_init_done); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_init_done(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + // We turn off the led if we are coming from init_error + logStatus(FlightModeManagerState::INIT_DONE); + EventBroker::getInstance().post(FMM_CALIBRATE, TOPIC_FMM); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_on_ground); + } + case EV_INIT: + { + return HANDLED; + } + case FMM_CALIBRATE: + { + return transition(&FlightModeManager::state_sensors_calibration); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_sensors_calibration(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::SENSORS_CALIBRATION); + ModuleManager::getInstance().get<Sensors>()->calibrate(); + EventBroker::getInstance().post(FMM_ALGOS_CALIBRATE, TOPIC_FMM); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_on_ground); + } + case EV_INIT: + { + return HANDLED; + } + case FMM_ALGOS_CALIBRATE: + { + return transition(&FlightModeManager::state_algos_calibration); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_algos_calibration(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::ALGOS_CALIBRATION); + // EventBroker::getInstance().post(FMM_ALGOS_CALIBRATE, TOPIC_FMM); + EventBroker::getInstance().post(NAS_CALIBRATE, TOPIC_NAS); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_on_ground); + } + case EV_INIT: + { + return HANDLED; + } + case NAS_READY: + { + EventBroker::getInstance().post(FMM_READY, TOPIC_FMM); + return transition(&FlightModeManager::state_disarmed); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_disarmed(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::DISARMED); + // Stop eventual logging + Logger::getInstance().stop(); + ModuleManager::getInstance().get<Actuators>()->buzzerOff(); + ModuleManager::getInstance().get<Actuators>()->camOff(); + EventBroker::getInstance().post(FLIGHT_DISARMED, TOPIC_FLIGHT); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_on_ground); + } + case EV_INIT: + { + return HANDLED; + } + case CAN_ARM: + case TMTC_ARM: + { + if (event != CAN_ARM) + { + ModuleManager::getInstance().get<CanHandler>()->sendEvent( + CanConfig::EventId::ARM); + } + return transition(&FlightModeManager::state_armed); + } + case CAN_ENTER_TEST_MODE: + case TMTC_ENTER_TEST_MODE: + { + if (event != CAN_ENTER_TEST_MODE) + { + ModuleManager::getInstance().get<CanHandler>()->sendEvent( + CanConfig::EventId::ENTER_TEST_MODE); + } + return transition(&FlightModeManager::state_test_mode); + } + case CAN_CALIBRATE: + case TMTC_CALIBRATE: + { + if (event != CAN_CALIBRATE) + { + ModuleManager::getInstance().get<CanHandler>()->sendEvent( + CanConfig::EventId::CALIBRATE); + } + return transition(&FlightModeManager::state_sensors_calibration); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_test_mode(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + Logger::getInstance().start(); + logStatus(FlightModeManagerState::TEST_MODE); + + return HANDLED; + } + case EV_EXIT: + { + ModuleManager::getInstance().get<Actuators>()->camOff(); + Logger::getInstance().stop(); + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_on_ground); + } + case EV_INIT: + { + return HANDLED; + } + case TMTC_START_RECORDING: + { + ModuleManager::getInstance().get<Actuators>()->camOn(); + return HANDLED; + } + case TMTC_STOP_RECORDING: + { + ModuleManager::getInstance().get<Actuators>()->camOff(); + return HANDLED; + } + case TMTC_RESET_BOARD: + { + Logger::getInstance().stop(); + reboot(); + return HANDLED; + } + case CAN_EXIT_TEST_MODE: + case TMTC_EXIT_TEST_MODE: + { + Logger::getInstance().stop(); + if (event != CAN_EXIT_TEST_MODE) + { + ModuleManager::getInstance().get<CanHandler>()->sendEvent( + CanConfig::EventId::EXIT_TEST_MODE); + } + return transition(&FlightModeManager::state_disarmed); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_armed(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::ARMED); + Logger::getInstance().start(); + + // Starts signaling devices and camera + ModuleManager::getInstance().get<Actuators>()->buzzerArmed(); + ModuleManager::getInstance().get<Actuators>()->camOn(); + // Post event + EventBroker::getInstance().post(FLIGHT_ARMED, TOPIC_FLIGHT); + return HANDLED; + } + case EV_EXIT: + { + Logger::getInstance().stop(); + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_top); + } + case EV_INIT: + { + return HANDLED; + } + case CAN_DISARM: + case TMTC_DISARM: + { + EventBroker::getInstance().post(NAS_FORCE_STOP, TOPIC_NAS); + if (event != CAN_DISARM) + { + ModuleManager::getInstance().get<CanHandler>()->sendEvent( + CanConfig::EventId::DISARM); + } + return transition(&FlightModeManager::state_disarmed); + } + case CAN_LIFTOFF: + case TMTC_FORCE_LAUNCH: + { + if (event != CAN_LIFTOFF) + { + ModuleManager::getInstance().get<CanHandler>()->sendEvent( + CanConfig::EventId::LIFTOFF); + } + return transition(&FlightModeManager::state_flying); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_flying(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + EventBroker::getInstance().postDelayed( + FLIGHT_MISSION_TIMEOUT, TOPIC_FLIGHT, MISSION_TIMEOUT); + EventBroker::getInstance().postDelayed( + FLIGHT_NC_DETACHED, TOPIC_FLIGHT, APOGEE_TIMEOUT); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_top); + } + case EV_INIT: + { + return transition(&FlightModeManager::state_ascending); + } + case TMTC_FORCE_LANDING: + case FLIGHT_MISSION_TIMEOUT: + { + return transition(&FlightModeManager::state_landed); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_ascending(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::ASCENDING); + EventBroker::getInstance().post(FLIGHT_LIFTOFF, TOPIC_FLIGHT); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_flying); + } + case EV_INIT: + { + return HANDLED; + } + case CAN_APOGEE_DETECTED: + case FLIGHT_NC_DETACHED: + case TMTC_FORCE_EXPULSION: + { + return transition(&FlightModeManager::state_drogue_descent); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_drogue_descent(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::DROGUE_DESCENT); + + ModuleManager::getInstance().get<AltitudeTrigger>()->enable(); + + // ModuleManager::getInstance() + // .get<VerticalVelocityTrigger>() + // ->enable(); + + EventBroker::getInstance().post(FLIGHT_DROGUE_DESCENT, + TOPIC_FLIGHT); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_flying); + } + case EV_INIT: + { + return HANDLED; + } + case ALTITUDE_TRIGGER_ALTITUDE_REACHED: + case TMTC_FORCE_DEPLOYMENT: + { + ModuleManager::getInstance().get<AltitudeTrigger>()->disable(); + ModuleManager::getInstance() + .get<VerticalVelocityTrigger>() + ->disable(); + return transition(&FlightModeManager::state_wing_descent); + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_wing_descent(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + EventBroker::getInstance().post(FLIGHT_WING_DESCENT, TOPIC_FLIGHT); + + logStatus(FlightModeManagerState::WING_DESCENT); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_flying); + } + case EV_INIT: + { + return HANDLED; + } + default: + { + return UNHANDLED; + } + } +} + +State FlightModeManager::state_landed(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(FlightModeManagerState::LANDED); + + // Turns off signaling devices + ModuleManager::getInstance().get<Actuators>()->buzzerLanded(); + ModuleManager::getInstance().get<Actuators>()->camOff(); + ModuleManager::getInstance().get<Actuators>()->disableServo( + PARAFOIL_LEFT_SERVO); + ModuleManager::getInstance().get<Actuators>()->disableServo( + PARAFOIL_RIGHT_SERVO); + // Sends events + EventBroker::getInstance().post(FLIGHT_LANDING_DETECTED, + TOPIC_FLIGHT); + EventBroker::getInstance().postDelayed(FMM_STOP_LOGGING, TOPIC_FMM, + LOGGING_DELAY); + + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&FlightModeManager::state_top); + } + case EV_INIT: + { + return HANDLED; + } + case FMM_STOP_LOGGING: + { + Logger::getInstance().stop(); + return HANDLED; + } + case TMTC_RESET_BOARD: + { + Logger::getInstance().stop(); + reboot(); + return HANDLED; + } + default: + { + return UNHANDLED; + } + } +} + +void FlightModeManager::logStatus(FlightModeManagerState state) +{ + status.timestamp = TimestampTimer::getTimestamp(); + status.state = state; + + Logger::getInstance().log(status); +} + +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.h b/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.h new file mode 100644 index 000000000..a801add57 --- /dev/null +++ b/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManager.h @@ -0,0 +1,126 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Authors: Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <diagnostic/PrintLogger.h> +#include <events/HSM.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +#include "FlightModeManagerData.h" + +namespace Payload +{ +class FlightModeManager : public Boardcore::HSM<FlightModeManager>, + public Boardcore::Module +{ +public: + FlightModeManager(); + ~FlightModeManager(); + + bool startModule() { return start(); } + FlightModeManagerStatus getStatus(); + + /** + * @brief Super state for when the payload is on ground. + */ + // Super state for when the payload is on ground. + Boardcore::State state_on_ground(const Boardcore::Event& event); + + /** + * @brief Super state for when the payload is on ground. + */ + Boardcore::State state_init(const Boardcore::Event& event); + + /** + * @brief State in which the init has failed + */ + Boardcore::State state_init_error(const Boardcore::Event& event); + + /** + * @brief State in which the init is done and a calibration event is + * thrown + */ + Boardcore::State state_init_done(const Boardcore::Event& event); + + /** + * @brief Calibration of all sensors. + */ + Boardcore::State state_sensors_calibration(const Boardcore::Event& event); + + /** + * @brief Calibration of all algorithms. + */ + Boardcore::State state_algos_calibration(const Boardcore::Event& event); + + /** + * @brief State in which the electronics is ready to be armed + */ + Boardcore::State state_disarmed(const Boardcore::Event& event); + + /** + * @brief The rocket will accept specific telecommands otherwise considered + * risky. + */ + Boardcore::State state_test_mode(const Boardcore::Event& event); + + /** + * @brief Super state in which the algorithms start to run (NAS) and the + * electronics is ready to fly + */ + Boardcore::State state_armed(const Boardcore::Event& event); + + /** + * @brief Super state for when the payload is in the air. + */ + Boardcore::State state_flying(const Boardcore::Event& event); + + /** + * @brief Ascending phase of the trajectory. + */ + Boardcore::State state_ascending(const Boardcore::Event& event); + + /** + * @brief State in which the apogee/expulsion has occurred + */ + Boardcore::State state_drogue_descent(const Boardcore::Event& event); + + /** + * @brief State in which the parafoil wing is opened and starts guiding + * itself + */ + Boardcore::State state_wing_descent(const Boardcore::Event& event); + + /** + * @brief The rocket ended the flight and closes the log. + */ + Boardcore::State state_landed(const Boardcore::Event& event); + +private: + void logStatus(FlightModeManagerState state); + + FlightModeManagerStatus status; + + Boardcore::PrintLogger logger = Boardcore::Logging::getLogger("fmm"); +}; +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManagerData.h b/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManagerData.h new file mode 100644 index 000000000..6c40d9540 --- /dev/null +++ b/src/boards/Payload/StateMachines/FlightModeManager/FlightModeManagerData.h @@ -0,0 +1,63 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <stdint.h> + +#include <iostream> +#include <string> + +namespace Payload +{ + +enum class FlightModeManagerState : uint8_t +{ + INVALID = 0, + INIT, + INIT_ERROR, + INIT_DONE, + SENSORS_CALIBRATION, + ALGOS_CALIBRATION, + DISARMED, + TEST_MODE, + ARMED, + ASCENDING, + DROGUE_DESCENT, + WING_DESCENT, + LANDED, +}; + +struct FlightModeManagerStatus +{ + uint64_t timestamp = 0; + FlightModeManagerState state = FlightModeManagerState::INVALID; + + static std::string header() { return "timestamp,state\n"; } + + void print(std::ostream& os) const + { + os << timestamp << "," << (int)state << "\n"; + } +}; + +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/NASController/NASController.cpp b/src/boards/Payload/StateMachines/NASController/NASController.cpp new file mode 100644 index 000000000..41503d305 --- /dev/null +++ b/src/boards/Payload/StateMachines/NASController/NASController.cpp @@ -0,0 +1,370 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/Configs/NASConfig.h> +#include <Payload/Sensors/Sensors.h> +#include <Payload/StateMachines/NASController/NASController.h> +#include <algorithms/NAS/StateInitializer.h> +#include <common/Events.h> +#include <common/ReferenceConfig.h> +#include <events/EventBroker.h> +#include <utils/SkyQuaternion/SkyQuaternion.h> + +using namespace Boardcore; +using namespace Eigen; +using namespace std; +using namespace Common; +namespace Payload +{ +NASController::NASController(TaskScheduler* sched) + : FSM(&NASController::state_idle), nas(NASConfig::config), scheduler(sched) +{ + // Subscribe the class to the topics + EventBroker::getInstance().subscribe(this, TOPIC_NAS); + EventBroker::getInstance().subscribe(this, TOPIC_FLIGHT); + + // Setup the NAS + Matrix<float, 13, 1> x = Matrix<float, 13, 1>::Zero(); + + // Create the initial quaternion + Vector4f q = SkyQuaternion::eul2quat({0, 0, 0}); + + // Set the initial quaternion inside the matrix + x(6) = q(0); + x(7) = q(1); + x(8) = q(2); + x(9) = q(3); + + // Set the NAS x matrix + nas.setX(x); + + // Set the referenced values for the correct place on earth + nas.setReferenceValues(ReferenceConfig::defaultReferenceValues); +} + +bool NASController::start() +{ + // Add the task to the scheduler + size_t result = scheduler->addTask(bind(&NASController::update, this), + NASConfig::UPDATE_PERIOD, + TaskScheduler::Policy::RECOVER); + + return ActiveObject::start() && result != 0; +} + +void NASController::update() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Update the NAS state only if the FSM is active + if (this->testState(&NASController::state_active)) + { + // Get the IMU data + RotatedIMUData imuData = modules.get<Sensors>()->getIMULastSample(); + UBXGPSData gpsData = modules.get<Sensors>()->getGPSLastSample(); + + HSCMRNN015PAData baroData = + modules.get<Sensors>()->getStaticPressureLastSample(); + + // NAS prediction + nas.predictGyro(imuData); + nas.predictAcc(imuData); + + // NAS correction + nas.correctMag(imuData); + nas.correctGPS(gpsData); + nas.correctBaro(baroData.pressure); + // Correct with accelerometer if the acceleration is in specs + Vector3f acceleration = static_cast<AccelerometerData>(imuData); + float accelerationNorm = acceleration.norm(); + if (accelerationValid) + { + nas.correctAcc(imuData); + } + if ((accelerationNorm < + (9.8 + (NASConfig::ACCELERATION_THRESHOLD) / 2) && + accelerationNorm > + (9.8 - (NASConfig::ACCELERATION_THRESHOLD) / 2))) + { + if (!accelerationValid) + { + accSampleAfterSpike++; + } + } + else + { + accelerationValid = false; + accSampleAfterSpike = 0; + } + if (accSampleAfterSpike > NASConfig::ACCELERATION_THRESHOLD_SAMPLE) + { + accSampleAfterSpike = 0; + accelerationValid = true; + } + + Logger::getInstance().log(nas.getState()); + } +} + +void NASController::calibrate() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + Vector3f acceleration = Vector3f::Zero(); + Vector3f magneticField = Vector3f::Zero(); + Stats pressure; + + for (int i = 0; i < NASConfig::CALIBRATION_SAMPLES_COUNT; i++) + { + // IMU + LSM6DSRXData imuData = modules.get<Sensors>()->getLSM6DSRXLastSample(); + acceleration += Vector3f(imuData.accelerationX, imuData.accelerationY, + imuData.accelerationZ); + + // Magnetometer + LIS2MDLData magData = modules.get<Sensors>()->getLIS2MDLLastSample(); + magneticField += + Vector3f(magData.magneticFieldX, magData.magneticFieldY, + magData.magneticFieldZ); + + // Static pressure barometer + HSCMRNN015PAData barometerData = + modules.get<Sensors>()->getStaticPressureLastSample(); + pressure.add(barometerData.pressure); + + miosix::Thread::sleep(NASConfig::CALIBRATION_SLEEP_TIME); + } + + // Normalize the data + acceleration /= NASConfig::CALIBRATION_SAMPLES_COUNT; + magneticField /= NASConfig::CALIBRATION_SAMPLES_COUNT; + acceleration.normalize(); + magneticField.normalize(); + + // Use the triad algorithm to estimate the initial orientation + StateInitializer state; + state.triad(acceleration, magneticField, ReferenceConfig::nedMag); + + // Set the pressure reference using an already existing reference values + ReferenceValues reference = nas.getReferenceValues(); + reference.refPressure = pressure.getStats().mean; + + // Set reference altitude using barometric measure + reference.refAltitude = Aeroutils::relAltitude(pressure.getStats().mean); + + // If in this moment the GPS has fix i use that position as starting + UBXGPSData gps = modules.get<Sensors>()->getGPSLastSample(); + if (gps.fix != 0) + { + // We don't set the altitude with the GPS because of not precise + // measurements + reference.refLatitude = gps.latitude; + reference.refLongitude = gps.longitude; + } + + // Update the algorithm reference values + { + miosix::PauseKernelLock lock; + nas.setX(state.getInitX()); + nas.setReferenceValues(reference); + } + + EventBroker::getInstance().post(NAS_READY, TOPIC_NAS); +} + +void NASController::setCoordinates(Vector2f position) +{ + // Need to pause the kernel because the only invocation comes from the radio + // which is a separate thread + miosix::PauseKernelLock l; + + ReferenceValues reference = nas.getReferenceValues(); + reference.refLatitude = position[0]; + reference.refLongitude = position[1]; + nas.setReferenceValues(reference); +} + +void NASController::setOrientation(float yaw, float pitch, float roll) +{ + // Need to pause the kernel because the only invocation comes from the radio + // which is a separate thread + miosix::PauseKernelLock l; + + Matrix<float, 13, 1> x = nas.getX(); + + // Set quaternions + Vector4f q = SkyQuaternion::eul2quat({yaw, pitch, roll}); + x(6) = q(0); + x(7) = q(1); + x(8) = q(2); + x(9) = q(3); + + nas.setX(x); +} + +void NASController::setReferenceAltitude(float altitude) +{ + // Need to pause the kernel because the only invocation comes from the radio + // which is a separate thread + miosix::PauseKernelLock l; + + ReferenceValues reference = nas.getReferenceValues(); + reference.refAltitude = altitude; + nas.setReferenceValues(reference); +} + +void NASController::setReferenceTemperature(float temperature) +{ + // Need to pause the kernel because the only invocation comes from the radio + // which is a separate thread + miosix::PauseKernelLock l; + + ReferenceValues reference = nas.getReferenceValues(); + + // The temperature is in degrees, converted in kelvin + reference.refTemperature = temperature + 273.15f; + nas.setReferenceValues(reference); +} + +void NASController::setReferenceValues(const ReferenceValues reference) +{ + // Need to pause the kernel + miosix::PauseKernelLock l; + nas.setReferenceValues(reference); +} + +NASControllerStatus NASController::getStatus() +{ + // Need to pause the kernel + miosix::PauseKernelLock l; + return status; +} + +NASState NASController::getNasState() +{ + // Need to pause the kernel + miosix::PauseKernelLock l; + return nas.getState(); +} + +ReferenceValues NASController::getReferenceValues() +{ + // Need to pause the kernel + miosix::PauseKernelLock l; + return nas.getReferenceValues(); +} + +void NASController::state_idle(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + return logStatus(NASControllerState::IDLE); + } + case NAS_CALIBRATE: + { + return transition(&NASController::state_calibrating); + } + } +} + +void NASController::state_calibrating(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + + // Calibrate the NAS + calibrate(); + return logStatus(NASControllerState::CALIBRATING); + } + case NAS_READY: + { + return transition(&NASController::state_ready); + } + } +} + +void NASController::state_ready(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + return logStatus(NASControllerState::READY); + } + case NAS_CALIBRATE: + { + return transition(&NASController::state_calibrating); + } + case NAS_FORCE_START: + case FLIGHT_ARMED: + { + return transition(&NASController::state_active); + } + } +} + +void NASController::state_active(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + return logStatus(NASControllerState::ACTIVE); + } + case FLIGHT_LANDING_DETECTED: + case FLIGHT_MISSION_TIMEOUT: + { + return transition(&NASController::state_end); + } + case NAS_FORCE_STOP: + case FLIGHT_DISARMED: + { + return transition(&NASController::state_ready); + } + } +} + +void NASController::state_end(const Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + return logStatus(NASControllerState::END); + } + } +} + +void NASController::logStatus(NASControllerState state) +{ + // Update the current FSM state + status.timestamp = TimestampTimer::getTimestamp(); + status.state = state; + + // Log the status + Logger::getInstance().log(status); +} +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/NASController/NASController.h b/src/boards/Payload/StateMachines/NASController/NASController.h new file mode 100644 index 000000000..73a256714 --- /dev/null +++ b/src/boards/Payload/StateMachines/NASController/NASController.h @@ -0,0 +1,99 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <algorithms/NAS/NAS.h> +#include <diagnostic/PrintLogger.h> +#include <events/FSM.h> +#include <scheduler/TaskScheduler.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +#include "NASControllerData.h" + +namespace Payload +{ +class NASController : public Boardcore::FSM<NASController>, + public Boardcore::Module +{ +public: + NASController(Boardcore::TaskScheduler* sched); + + /** + * @brief Starts the FSM thread and adds the update function into the + * scheduler + */ + bool start() override; + + // NAS FSM called methods + void calibrate(); + + // NAS setters + void setCoordinates(Eigen::Vector2f position); + void setOrientation(float yaw, float pitch, float roll); + void setReferenceAltitude(float altitude); + void setReferenceTemperature(float temperature); + void setReferenceValues(const Boardcore::ReferenceValues reference); + + // NAS Getters + NASControllerStatus getStatus(); + Boardcore::NASState getNasState(); + Boardcore::ReferenceValues getReferenceValues(); + + // FSM states + void state_idle(const Boardcore::Event& event); + void state_calibrating(const Boardcore::Event& event); + void state_ready(const Boardcore::Event& event); + void state_active(const Boardcore::Event& event); + void state_end(const Boardcore::Event& event); + +private: + /** + * @brief Update the NAS estimation + */ + void update(); + + /** + * @brief Logs the NAS status updating the FSM state + * @param state The current FSM state + */ + void logStatus(NASControllerState state); + + // Controller state machine status + NASControllerStatus status; + Boardcore::NAS nas; + + // Scheduler to be used for update function + Boardcore::TaskScheduler* scheduler; + + // User set (or triac set) initial orientation + Eigen::Vector3f initialOrientation; + + // Parameters used to decide wether to correct with accelerometer after a + // spike is detected + bool accelerationValid = true; + u_int8_t accSampleAfterSpike = 0; + + Boardcore::PrintLogger logger = Boardcore::Logging::getLogger("NAS"); +}; +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/NASController/NASControllerData.h b/src/boards/Payload/StateMachines/NASController/NASControllerData.h new file mode 100644 index 000000000..782c231b6 --- /dev/null +++ b/src/boards/Payload/StateMachines/NASController/NASControllerData.h @@ -0,0 +1,56 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <stdint.h> + +#include <iostream> +#include <string> + +namespace Payload +{ + +enum class NASControllerState : uint8_t +{ + UNINIT = 0, + IDLE, + CALIBRATING, + READY, + ACTIVE, + END +}; + +struct NASControllerStatus +{ + long long timestamp = 0; + NASControllerState state = NASControllerState::UNINIT; + + static std::string header() { return "timestamp,state\n"; } + + void print(std::ostream& os) const + { + os << timestamp << "," << (int)state << "\n"; + } +}; + +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/WingController/WingController.cpp b/src/boards/Payload/StateMachines/WingController/WingController.cpp new file mode 100644 index 000000000..33a64f24a --- /dev/null +++ b/src/boards/Payload/StateMachines/WingController/WingController.cpp @@ -0,0 +1,472 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Authors: Matteo Pignataro, Federico Mandelli, Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#include "WingController.h" + +#include <Payload/Actuators/Actuators.h> +#include <Payload/BoardScheduler.h> +#include <Payload/Configs/WESConfig.h> +#include <Payload/Configs/WingConfig.h> +#include <Payload/StateMachines/FlightModeManager/FlightModeManager.h> +#include <Payload/StateMachines/NASController/NASController.h> +#include <Payload/WindEstimationScheme/WindEstimation.h> +#include <Payload/Wing/AutomaticWingAlgorithm.h> +#include <Payload/Wing/FileWingAlgorithm.h> +#include <Payload/Wing/WingAlgorithm.h> +#include <Payload/Wing/WingAlgorithmData.h> +#include <Payload/Wing/WingTargetPositionData.h> +#include <common/Events.h> +#include <diagnostic/PrintLogger.h> +#include <drivers/timer/TimestampTimer.h> +#include <events/EventBroker.h> + +using namespace Boardcore; +using namespace Payload::WingConfig; +using namespace Payload::WESConfig; +using namespace Common; +using namespace miosix; + +namespace Payload +{ + +WingController::WingController(TaskScheduler* sched) + : HSM(&WingController::state_idle), running(false), selectedAlgorithm(0), + scheduler(sched) +{ + + EventBroker::getInstance().subscribe(this, TOPIC_FLIGHT); + EventBroker::getInstance().subscribe(this, TOPIC_DPL); + this->targetPositionGEO = {DEFAULT_TARGET_LAT, DEFAULT_TARGET_LON}; +} + +bool WingController::start() +{ + return scheduler->addTask(std::bind(&WingController::update, this), + WING_UPDATE_PERIOD) && + addAlgorithms() && HSM::start(); +} + +WingController::~WingController() +{ + EventBroker::getInstance().unsubscribe(this); +} + +WingControllerStatus WingController::getStatus() +{ + miosix::Lock<miosix::FastMutex> s(statusMutex); + return status; +} + +State WingController::state_idle(const Boardcore::Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(WingControllerState::IDLE); + return HANDLED; + } + case FLIGHT_WING_DESCENT: + { + ModuleManager::getInstance().get<Actuators>()->cuttersOn(); + return transition(&WingController::state_flying); + } + case EV_EMPTY: + { + return tranSuper(&WingController::state_top); + } + default: + { + return UNHANDLED; + } + } +} + +State WingController::state_flying(const Event& event) +{ + + switch (event) + { + case EV_ENTRY: + { + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&WingController::state_top); + } + case EV_INIT: + { + return transition(&WingController::state_calibration); + } + case FLIGHT_LANDING_DETECTED: + { + return transition(&WingController::state_on_ground); + } + default: + { + return UNHANDLED; + } + } +} + +State WingController::state_calibration(const Boardcore::Event& event) +{ + ModuleManager& modules = ModuleManager::getInstance(); + switch (event) + { + case EV_ENTRY: // starts twirling and calibration wes + { + logStatus(WingControllerState::CALIBRATION); + modules.get<Actuators>()->setServo(ServosList::PARAFOIL_LEFT_SERVO, + 1); + modules.get<Actuators>()->setServo(ServosList::PARAFOIL_RIGHT_SERVO, + 0); + EventBroker::getInstance().postDelayed(DPL_WES_CAL_DONE, TOPIC_DPL, + WES_CALIBRATION_TIMEOUT); + modules.get<WindEstimation>() + ->startWindEstimationSchemeCalibration(); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&WingController::state_flying); + } + case DPL_WES_CAL_DONE: + { + reset(); + // Turn off the cutters + ModuleManager::getInstance().get<Actuators>()->cuttersOff(); + return transition(&WingController::state_controlled_descent); + } + default: + { + return UNHANDLED; + } + } +} +State WingController::state_controlled_descent(const Boardcore::Event& event) +{ + switch (event) + { + case EV_ENTRY: // start automatic algorithm + { + logStatus(WingControllerState::ALGORITHM_CONTROLLED); + selectAlgorithm(0); + setEarlyManeuverPoints( + convertTargetPositionToNED(targetPositionGEO), + {ModuleManager::getInstance() + .get<NASController>() + ->getNasState() + .n, + ModuleManager::getInstance() + .get<NASController>() + ->getNasState() + .e}); + startAlgorithm(); + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&WingController::state_flying); + } + case EV_EXIT: + { + return HANDLED; + } + default: + { + return UNHANDLED; + } + } +} + +State WingController::state_on_ground(const Boardcore::Event& event) +{ + switch (event) + { + case EV_ENTRY: + { + logStatus(WingControllerState::ON_GROUND); + + ModuleManager::getInstance() + .get<WindEstimation>() + ->stopWindEstimationScheme(); + ModuleManager::getInstance() + .get<WindEstimation>() + ->stopWindEstimationSchemeCalibration(); + stopAlgorithm(); + return HANDLED; + } + case EV_EXIT: + { + return HANDLED; + } + case EV_EMPTY: + { + return tranSuper(&WingController::state_top); + } + default: + { + return UNHANDLED; + } + } +} + +bool WingController::addAlgorithms() +{ + WingAlgorithm* algorithm; + WingAlgorithmData step; + + bool result; + // We add an AutomaticWingAlgorithm and a FileWingAlgorithm + + algorithm = new AutomaticWingAlgorithm(KP, KI, PARAFOIL_LEFT_SERVO, + PARAFOIL_RIGHT_SERVO, emGuidance); + // Ensure that the servos are correct + algorithm->setServo(PARAFOIL_LEFT_SERVO, PARAFOIL_RIGHT_SERVO); + + // Init the algorithm + result = algorithm->init(); + + // Add the algorithm to the vector + algorithms.push_back(algorithm); + + algorithm = new WingAlgorithm(PARAFOIL_LEFT_SERVO, PARAFOIL_RIGHT_SERVO); + + for (int i = 0; i < 3; i++) + { + step.servo1Angle = 120; + step.servo2Angle = 0; + step.timestamp = 0 + i * 40000000; + algorithm->addStep(step); + step.servo1Angle = 0; + step.servo2Angle = 0; + step.timestamp += 10000000 + i * 40000000; + algorithm->addStep(step); + step.servo1Angle = 0; + step.servo2Angle = 120; + step.timestamp += 10000000 + i * 40000000; + algorithm->addStep(step); + step.servo1Angle = 0; + step.servo2Angle = 0; + step.timestamp += 10000000 + i * 40000000; + algorithm->addStep(step); + } + + // Ensure that the servos are correct + algorithm->setServo(PARAFOIL_LEFT_SERVO, PARAFOIL_RIGHT_SERVO); + + // Init the algorithm + result = result && algorithm->init(); + + // Add the algorithm to the vector + algorithms.push_back(algorithm); + + selectAlgorithm(0); + + return result; +} + +bool WingController::selectAlgorithm(unsigned int index) +{ + bool success = false; + // We change the selected algorithm only if we are in IDLE + if (getStatus().state == WingControllerState::IDLE) + { + stopAlgorithm(); + if (index < algorithms.size()) + { + LOG_INFO(logger, "Algorithm {:1} selected", index); + selectedAlgorithm = index; + success = true; + } + else + { + // Select the 0 algorithm + selectedAlgorithm = 0; + success = false; + } + } + return success; +} + +void WingController::startAlgorithm() +{ + // If the selected algorithm is valid --> also the + // algorithms array is not empty i start the whole thing + if (selectedAlgorithm < algorithms.size()) + { + running = true; + + // Begin the selected algorithm + algorithms[selectedAlgorithm]->begin(); + + LOG_INFO(logger, "Wing algorithm started"); + } +} + +void WingController::stopAlgorithm() +{ + if (running) + { + // Set running to false + running = false; + // Stop the algorithm if selected + if (selectedAlgorithm < algorithms.size()) + { + algorithms[selectedAlgorithm]->end(); + reset(); + } + } +} + +void WingController::update() +{ + if (running) + { + algorithms[selectedAlgorithm]->step(); + } +} + +void WingController::flare() +{ + // Set the servo position to flare (pull the two ropes as skydiving people + // do) + + ModuleManager::getInstance().get<Actuators>()->setServo(PARAFOIL_LEFT_SERVO, + 1); + ModuleManager::getInstance().get<Actuators>()->setServo( + PARAFOIL_RIGHT_SERVO, 1); +} + +void WingController::reset() +{ + // Set the servo position to reset + ModuleManager::getInstance().get<Actuators>()->setServo(PARAFOIL_LEFT_SERVO, + 0); + ModuleManager::getInstance().get<Actuators>()->setServo( + PARAFOIL_RIGHT_SERVO, 0); +} + +void WingController::setTargetPosition(Eigen::Vector2f targetGEO) +{ + if (ModuleManager::getInstance().get<NASController>()->getStatus().state != + NASControllerState::READY) + { + this->targetPositionGEO = targetGEO; + setEarlyManeuverPoints( + convertTargetPositionToNED(targetPositionGEO), + {ModuleManager::getInstance().get<NASController>()->getNasState().n, + ModuleManager::getInstance() + .get<NASController>() + ->getNasState() + .e}); + } +} + +void WingController::setEarlyManeuverPoints(Eigen::Vector2f targetNED, + Eigen::Vector2f currentPosNED) +{ + + Eigen::Vector2f targetOffsetNED = targetNED - currentPosNED; + + Eigen::Vector2f norm_point = targetOffsetNED / targetOffsetNED.norm(); + + float psi0 = atan2(norm_point[1], norm_point[0]); + + float distFromCenterline = 20; // the distance that the M1 and M2 points + // must have from the center line + + // Calculate the angle between the lines <NED Origin, target> and <NED + // Origin, M1> This angle is the same for M2 since is symmetric to M1 + // relatively to the center line + float psiMan = atan2(distFromCenterline, targetOffsetNED.norm()); + + float maneuverPointsMagnitude = distFromCenterline / sin(psiMan); + float m2Angle = psi0 + psiMan; + float m1Angle = psi0 - psiMan; + + Eigen::Vector2f emcPosition = + targetOffsetNED * 1.2 + + currentPosNED; // EMC is calculated as target * 1.2 + + Eigen::Vector2f m1Position = + Eigen::Vector2f(cos(m1Angle), sin(m1Angle)) * maneuverPointsMagnitude + + currentPosNED; + + Eigen::Vector2f m2Position = + Eigen::Vector2f(cos(m2Angle), sin(m2Angle)) * maneuverPointsMagnitude + + currentPosNED; + + emGuidance.setPoints(targetNED, emcPosition, m1Position, m2Position); + WingTargetPositionData data; + + data.receivedLat = targetPositionGEO[0]; + data.receivedLon = targetPositionGEO[1]; + + data.targetN = targetNED[0]; + data.targetE = targetNED[1]; + + data.emcN = emcPosition[0]; + data.emcE = emcPosition[1]; + + data.m1N = m1Position[0]; + data.m1E = m1Position[1]; + + data.m2N = m2Position[0]; + data.m2E = m2Position[1]; + + // Log the received position + Logger::getInstance().log(data); +} + +void WingController::logStatus(WingControllerState state) +{ + miosix::Lock<miosix::FastMutex> s(statusMutex); + status.timestamp = TimestampTimer::getTimestamp(); + status.state = state; + + Logger::getInstance().log(status); +} + +Eigen::Vector2f WingController::convertTargetPositionToNED( + Eigen::Vector2f targetGEO) +{ + return Aeroutils::geodetic2NED(targetGEO, {ModuleManager::getInstance() + .get<NASController>() + ->getReferenceValues() + .refLatitude, + ModuleManager::getInstance() + .get<NASController>() + ->getReferenceValues() + .refLongitude}); +} + +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/WingController/WingController.h b/src/boards/Payload/StateMachines/WingController/WingController.h new file mode 100644 index 000000000..1fb84ee66 --- /dev/null +++ b/src/boards/Payload/StateMachines/WingController/WingController.h @@ -0,0 +1,182 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Authors: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Payload/Wing/Guidance/EarlyManeuversGuidanceAlgorithm.h> +#include <Payload/Wing/WingAlgorithm.h> +#include <events/HSM.h> + +#include <Eigen/Core> +#include <atomic> +#include <utils/ModuleManager/ModuleManager.hpp> + +#include "WingControllerData.h" + +/** + * @brief This class allows the user to select the wing algorithm + * that has to be used during the tests. It also registers his + * dedicated function in the task scheduler in order to be + * executed every fixed period and to update the two servos position + * depending on the selected algorithm. + * + * Use case example: + * controller = new WingController(scheduler); + * + * controller.addAlgorithm("filename"); + * OR + * controller.addAlgorithm(algorithm); + * + * controller.selectAlgorithm(index); + * + * controller.start(); + * controller.stop(); //If you want to abort the execution + * controller.start(); //If you want to start again from the beginning + */ + +namespace Payload +{ +class WingController : public Boardcore::HSM<WingController>, + public Boardcore::Module + +{ + +public: + Boardcore::State state_idle(const Boardcore::Event& event); + Boardcore::State state_flying(const Boardcore::Event& event); + Boardcore::State state_calibration(const Boardcore::Event& event); + Boardcore::State state_controlled_descent(const Boardcore::Event& event); + Boardcore::State state_on_ground(const Boardcore::Event& event); + + /** + * @brief Destroy the Wing Controller object. + */ + ~WingController(); + + /** + * @brief Method to set the target position. + */ + void setTargetPosition(Eigen::Vector2f target); + + /** + * @brief Selects the algorithm if present. + * + * @param index The algorithms vector index + * + * @return true if the selection was successful + */ + bool selectAlgorithm(unsigned int index); + + WingControllerStatus getStatus(); + + /** + * @brief Construct a new Wing Controller object + */ + explicit WingController(Boardcore::TaskScheduler* sched); + + bool start() override; + +private: + /** + * @brief Method to add the algorithm in the list + * + * @param algorithm The algorithm with + * all already done (e.g. steps already registered) + */ + bool addAlgorithms(); + + /** + * @brief target position getter + */ + Eigen::Vector2f convertTargetPositionToNED(Eigen::Vector2f targetGEO); + + /** + * @brief set points needed by the Guidance + */ + void setEarlyManeuverPoints(Eigen::Vector2f targetNED, + Eigen::Vector2f currentPosNED); + + void logStatus(WingControllerState state); + + WingControllerStatus status; + + miosix::FastMutex statusMutex; + + /** + * @brief Target position + */ + Eigen::Vector2f targetPositionGEO; + + /** + * @brief List of loaded algorithms (from SD or not) + */ + std::vector<WingAlgorithm*> algorithms; + + /** + * @brief PrintLogger + */ + Boardcore::PrintLogger logger = + Boardcore::Logging::getLogger("PayloadTest"); + + /** + * @brief Internal running state + */ + std::atomic<bool> running; + /** + * @brief This attribute is modified by the mavlink radio section. + * The user using the Ground Station can select the pre-enumerated algorithm + * to execute + */ + std::atomic<size_t> selectedAlgorithm; + + /** + * @brief Instance of the Early Maneuver Guidance Algorithm used by + * AutomaticWingAlgorithm + */ + EarlyManeuversGuidanceAlgorithm emGuidance; + + /** + * @brief starts the selected algorithm + */ + void startAlgorithm(); + + /** + * @brief Sets the internal state to stop and + * stops the selected algorithm + */ + void stopAlgorithm(); + + /** + * @brief Stops any on going algorithm and flares the wing + */ + void flare(); + + /** + * @brief Resets the servos in their initial position + */ + void reset(); + + void update(); + + Boardcore::TaskScheduler* scheduler = nullptr; +}; +} // namespace Payload diff --git a/src/boards/Payload/StateMachines/WingController/WingControllerData.h b/src/boards/Payload/StateMachines/WingController/WingControllerData.h new file mode 100644 index 000000000..82e444561 --- /dev/null +++ b/src/boards/Payload/StateMachines/WingController/WingControllerData.h @@ -0,0 +1,56 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <stdint.h> + +#include <iostream> +#include <string> + +namespace Payload +{ + +enum class WingControllerState : uint8_t +{ + UNINIT = 0, + IDLE, + CALIBRATION, + ALGORITHM_CONTROLLED, + ON_GROUND, + END +}; + +struct WingControllerStatus +{ + long long timestamp = 0; + WingControllerState state = WingControllerState::UNINIT; + + static std::string header() { return "timestamp,state\n"; } + + void print(std::ostream& os) const + { + os << timestamp << "," << (int)state << "\n"; + } +}; + +} // namespace Payload diff --git a/src/boards/Payload/TMRepository/TMRepository.cpp b/src/boards/Payload/TMRepository/TMRepository.cpp new file mode 100644 index 000000000..62eec8f4f --- /dev/null +++ b/src/boards/Payload/TMRepository/TMRepository.cpp @@ -0,0 +1,616 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#include <Payload/Actuators/Actuators.h> +#include <Payload/BoardScheduler.h> +#include <Payload/Configs/RadioConfig.h> +#include <Payload/FlightStatsRecorder/FlightStatsRecorder.h> +#include <Payload/PinHandler/PinHandler.h> +#include <Payload/Radio/Radio.h> +#include <Payload/Sensors/Sensors.h> +#include <Payload/StateMachines/FlightModeManager/FlightModeManager.h> +#include <Payload/StateMachines/NASController/NASController.h> +#include <Payload/StateMachines/WingController/WingController.h> +#include <Payload/TMRepository/TMRepository.h> +#include <Payload/WindEstimationScheme/WindEstimation.h> +#include <diagnostic/CpuMeter/CpuMeter.h> +#include <drivers/timer/TimestampTimer.h> +#include <events/EventBroker.h> +#include <interfaces-impl/hwmapping.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +using namespace miosix; +using namespace Boardcore; + +namespace Payload +{ +mavlink_message_t TMRepository::packSystemTm(SystemTMList tmId, uint8_t msgId, + uint8_t seq) +{ + ModuleManager& modules = ModuleManager::getInstance(); + mavlink_message_t msg; + + switch (tmId) + { + case SystemTMList::MAV_SYS_ID: + { + mavlink_sys_tm_t tm; + + tm.timestamp = TimestampTimer::getTimestamp(); + tm.logger = Logger::getInstance().isStarted(); + tm.board_scheduler = modules.get<BoardScheduler>()->isStarted(); + tm.event_broker = EventBroker::getInstance().isRunning(); + tm.radio = modules.get<Radio>()->isStarted(); + tm.sensors = modules.get<Sensors>()->isStarted(); + tm.pin_observer = modules.get<PinHandler>()->isStarted(); + + mavlink_msg_sys_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + + break; + } + case SystemTMList::MAV_LOGGER_ID: + { + mavlink_logger_tm_t tm; + + // Get the logger stats + LoggerStats stats = Logger::getInstance().getStats(); + + tm.timestamp = stats.timestamp; + tm.average_write_time = stats.averageWriteTime; + tm.buffers_filled = stats.buffersFilled; + tm.buffers_written = stats.buffersWritten; + tm.dropped_samples = stats.droppedSamples; + tm.last_write_error = stats.lastWriteError; + tm.log_number = stats.logNumber; + tm.max_write_time = stats.maxWriteTime; + tm.queued_samples = stats.queuedSamples; + tm.too_large_samples = stats.tooLargeSamples; + tm.writes_failed = stats.writesFailed; + + mavlink_msg_logger_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + + break; + } + case SystemTMList::MAV_MAVLINK_STATS: + { + mavlink_mavlink_stats_tm_t tm; + + // Get the mavlink stats + MavlinkStatus stats = modules.get<Radio>()->mavDriver->getStatus(); + + tm.timestamp = stats.timestamp; + tm.n_send_queue = stats.nSendQueue; + tm.max_send_queue = stats.maxSendQueue; + tm.n_send_errors = stats.nSendErrors; + tm.msg_received = stats.mavStats.msg_received; + tm.buffer_overrun = stats.mavStats.buffer_overrun; + tm.parse_error = stats.mavStats.parse_error; + tm.parse_state = stats.mavStats.parse_state; + tm.packet_idx = stats.mavStats.packet_idx; + tm.current_rx_seq = stats.mavStats.current_rx_seq; + tm.current_tx_seq = stats.mavStats.current_tx_seq; + tm.packet_rx_success_count = stats.mavStats.packet_rx_success_count; + tm.packet_rx_drop_count = stats.mavStats.packet_rx_drop_count; + + mavlink_msg_mavlink_stats_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, + &tm); + break; + } + case SystemTMList::MAV_NAS_ID: + { + mavlink_nas_tm_t tm; + + // Get the current NAS state + NASState state = modules.get<NASController>()->getNasState(); + ReferenceValues ref = + modules.get<NASController>()->getReferenceValues(); + + tm.timestamp = state.timestamp; + tm.state = static_cast<uint8_t>( + modules.get<NASController>()->getStatus().state); + tm.nas_n = state.n; + tm.nas_e = state.e; + tm.nas_d = state.d; + tm.nas_vn = state.vn; + tm.nas_ve = state.ve; + tm.nas_vd = state.vd; + tm.nas_qx = state.qx; + tm.nas_qy = state.qy; + tm.nas_qz = state.qz; + tm.nas_qw = state.qw; + tm.nas_bias_x = state.bx; + tm.nas_bias_y = state.by; + tm.nas_bias_z = state.bz; + tm.ref_pressure = ref.refPressure; + tm.ref_temperature = ref.refTemperature; + tm.ref_latitude = ref.refLatitude; + tm.ref_longitude = ref.refLongitude; + + mavlink_msg_nas_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + + break; + } + case SystemTMList::MAV_FLIGHT_ID: + { + mavlink_payload_flight_tm_t tm; + + tm.timestamp = TimestampTimer::getTimestamp(); + + // Last samples + LPS28DFWData lps28dfw1 = + modules.get<Sensors>()->getLPS28DFW_1LastSample(); + RotatedIMUData imu = modules.get<Sensors>()->getIMULastSample(); + UBXGPSData gps = modules.get<Sensors>()->getGPSLastSample(); + Eigen::Vector2f wind = + modules.get<WindEstimation>()->getWindEstimationScheme(); + + // NAS state + NASState nasState = modules.get<NASController>()->getNasState(); + + tm.nas_state = static_cast<uint8_t>( + modules.get<NASController>()->getStatus().state); + tm.fmm_state = static_cast<uint8_t>( + modules.get<FlightModeManager>()->getStatus().state); + tm.wes_state = static_cast<uint8_t>( + modules.get<WingController>()->getStatus().state); + + tm.wes_n = wind[0]; + tm.wes_e = wind[1]; + + tm.pressure_digi = lps28dfw1.pressure; + tm.pressure_static = + modules.get<Sensors>()->getStaticPressureLastSample().pressure; + // Pitot + tm.airspeed_pitot = + modules.get<Sensors>()->getPitotLastSample().airspeed; + + // Altitude agl + tm.altitude_agl = -nasState.d; + + // IMU + tm.acc_x = imu.accelerationX; + tm.acc_y = imu.accelerationY; + tm.acc_z = imu.accelerationZ; + tm.gyro_x = imu.angularSpeedX; + tm.gyro_y = imu.angularSpeedY; + tm.gyro_z = imu.angularSpeedZ; + + // Magnetometer + tm.mag_x = imu.magneticFieldX; + tm.mag_y = imu.magneticFieldY; + tm.mag_z = imu.magneticFieldZ; + + // GPS + tm.gps_fix = gps.fix; + tm.gps_lat = gps.latitude; + tm.gps_lon = gps.longitude; + tm.gps_alt = gps.height; + + // NAS + tm.nas_n = nasState.n; + tm.nas_e = nasState.e; + tm.nas_d = nasState.d; + tm.nas_vn = nasState.vn; + tm.nas_ve = nasState.ve; + tm.nas_vd = nasState.vd; + tm.nas_qx = nasState.qx; + tm.nas_qy = nasState.qy; + tm.nas_qz = nasState.qz; + tm.nas_qw = nasState.qw; + tm.nas_bias_x = nasState.bx; + tm.nas_bias_y = nasState.by; + tm.nas_bias_z = nasState.bz; + // Servos + tm.left_servo_angle = modules.get<Actuators>()->getServoAngle( + ServosList::PARAFOIL_LEFT_SERVO); + tm.right_servo_angle = modules.get<Actuators>()->getServoAngle( + ServosList::PARAFOIL_RIGHT_SERVO); + + tm.pin_nosecone = modules.get<PinHandler>() + ->getPinsData()[PinsList::NOSECONE_PIN] + .lastState; + + tm.cutter_presence = + static_cast<uint8_t>(miosix::gpios::cut_sense::value()); + + tm.battery_voltage = modules.get<Sensors>() + ->getBatteryVoltageLastSample() + .batVoltage; + tm.current_consumption = + modules.get<Sensors>()->getCurrentLastSample().current; + tm.temperature = lps28dfw1.temperature; + tm.logger_error = Logger::getInstance().getStats().lastWriteError; + + tm.cam_battery_voltage = modules.get<Sensors>() + ->getCamBatteryVoltageLastSample() + .batVoltage; + + mavlink_msg_payload_flight_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, + &tm); + + break; + } + case SystemTMList::MAV_STATS_ID: + { + mavlink_payload_stats_tm_t tm = + modules.get<FlightStatsRecorder>()->getStats(); + tm.cpu_load = CpuMeter::getCpuStats().mean; + tm.free_heap = CpuMeter::getCpuStats().freeHeap; + + mavlink_msg_payload_stats_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, + &tm); + break; + } + case SystemTMList::MAV_FSM_ID: + { + mavlink_fsm_tm_t tm; + + tm.timestamp = TimestampTimer::getTimestamp(); + tm.abk_state = 0; + tm.ada_state = 0; + tm.dpl_state = static_cast<uint8_t>( + modules.get<WingController>()->getStatus().state); + tm.fmm_state = static_cast<uint8_t>( + modules.get<FlightModeManager>()->getStatus().state); + tm.nas_state = static_cast<uint8_t>( + modules.get<NASController>()->getStatus().state); + tm.wes_state = 0; + + mavlink_msg_fsm_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + + break; + } + case SystemTMList::MAV_PIN_OBS_ID: + { + mavlink_pin_tm_t tm; + + tm.timestamp = TimestampTimer::getTimestamp(); + tm.last_change_timestamp = + modules.get<PinHandler>() + ->getPinsData()[PinsList::NOSECONE_PIN] + .lastStateTimestamp; /*< Last change timestamp of pin*/ + tm.pin_id = + PinsList::NOSECONE_PIN; /*< A member of the PinsList enum*/ + tm.changes_counter = + modules.get<PinHandler>() + ->getPinsData()[PinsList::NOSECONE_PIN] + .changesCount; /*< Number of changes of pin*/ + tm.current_state = modules.get<PinHandler>() + ->getPinsData()[PinsList::NOSECONE_PIN] + .lastState; /*< Current state of pin*/ + + mavlink_msg_pin_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + + break; + } + default: + { + // Send by default the nack message + mavlink_nack_tm_t nack; + + nack.recv_msgid = msgId; + nack.seq_ack = seq; + + LOG_ERR(logger, "Unknown message id: {}", tmId); + mavlink_msg_nack_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &nack); + + break; + } + } + return msg; +} +mavlink_message_t TMRepository::packSensorsTm(SensorsTMList sensorId, + uint8_t msgId, uint8_t seq) +{ + mavlink_message_t msg; + ModuleManager& modules = ModuleManager::getInstance(); + + switch (sensorId) + { + case SensorsTMList::MAV_GPS_ID: + { + mavlink_gps_tm_t tm; + + UBXGPSData gpsData = modules.get<Sensors>()->getGPSLastSample(); + + tm.timestamp = gpsData.gpsTimestamp; + strcpy(tm.sensor_name, "UBXGPS"); + tm.fix = gpsData.fix; + tm.height = gpsData.height; + tm.latitude = gpsData.latitude; + tm.longitude = gpsData.longitude; + tm.n_satellites = gpsData.satellites; + tm.speed = gpsData.speed; + tm.track = gpsData.track; + tm.vel_down = gpsData.velocityDown; + tm.vel_east = gpsData.velocityEast; + tm.vel_north = gpsData.velocityNorth; + + mavlink_msg_gps_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + + break; + } + + case SensorsTMList::MAV_STATIC_PRESS_ID: + { + mavlink_pressure_tm_t tm; + + HSCMRNN015PAData pressureData = + modules.get<Sensors>()->getStaticPressureLastSample(); + + tm.timestamp = pressureData.pressureTimestamp; + strcpy(tm.sensor_name, "STATIC_PRESSURE"); + tm.pressure = pressureData.pressure; + + mavlink_msg_pressure_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + + break; + } + case SensorsTMList::MAV_DPL_PRESS_ID: + { + mavlink_pressure_tm_t tm; + + SSCMRNN030PAData pressureData = + modules.get<Sensors>()->getDynamicPressureLastSample(); + + tm.timestamp = pressureData.pressureTimestamp; + strcpy(tm.sensor_name, "DYNAMIC_PRESSURE"); + tm.pressure = pressureData.pressure; + + mavlink_msg_pressure_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + + break; + } + case SensorsTMList::MAV_PITOT_PRESS_ID: + { + mavlink_pressure_tm_t tm; + + SSCMRNN030PAData pitot = + modules.get<Sensors>()->getDynamicPressureLastSample(); + + tm.timestamp = pitot.pressureTimestamp; + tm.pressure = pitot.pressure; + strcpy(tm.sensor_name, "PITOT_PRESSURE"); + + mavlink_msg_pressure_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + case SensorsTMList::MAV_LIS2MDL_ID: + { + mavlink_imu_tm_t tm; + + LIS2MDLData mag = modules.get<Sensors>()->getLIS2MDLLastSample(); + + tm.acc_x = 0; + tm.acc_y = 0; + tm.acc_z = 0; + tm.gyro_x = 0; + tm.gyro_y = 0; + tm.gyro_z = 0; + tm.mag_x = mag.magneticFieldX; + tm.mag_y = mag.magneticFieldY; + tm.mag_z = mag.magneticFieldZ; + tm.timestamp = mag.magneticFieldTimestamp; + strcpy(tm.sensor_name, "LIS2MD"); + + mavlink_msg_imu_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + case SensorsTMList::MAV_LSM6DSRX_ID: + { + mavlink_imu_tm_t tm; + + LSM6DSRXData imu = modules.get<Sensors>()->getLSM6DSRXLastSample(); + + tm.acc_x = imu.accelerationX; + tm.acc_y = imu.accelerationY; + tm.acc_z = imu.accelerationZ; + tm.gyro_x = imu.angularSpeedX; + tm.gyro_y = imu.angularSpeedY; + tm.gyro_z = imu.angularSpeedZ; + tm.mag_x = 0; + tm.mag_y = 0; + tm.mag_z = 0; + + tm.timestamp = imu.accelerationTimestamp; + strcpy(tm.sensor_name, "LSM6DSRX"); + + mavlink_msg_imu_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + case SensorsTMList::MAV_H3LIS331DL_ID: + { + mavlink_imu_tm_t tm; + + H3LIS331DLData imu = + modules.get<Sensors>()->getH3LIS331DLLastSample(); + + tm.acc_x = imu.accelerationX; + tm.acc_y = imu.accelerationY; + tm.acc_z = imu.accelerationZ; + tm.gyro_x = 0; + tm.gyro_y = 0; + tm.gyro_z = 0; + tm.mag_x = 0; + tm.mag_y = 0; + tm.mag_z = 0; + + tm.timestamp = imu.accelerationTimestamp; + strcpy(tm.sensor_name, "H3LIS331DL"); + + mavlink_msg_imu_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + case SensorsTMList::MAV_LPS22DF_ID: + { + mavlink_pressure_tm_t tm; + + LPS22DFData pressure = + modules.get<Sensors>()->getLPS22DFLastSample(); + + tm.timestamp = pressure.pressureTimestamp; + tm.pressure = pressure.pressure; + strcpy(tm.sensor_name, "LPS22DF"); + + mavlink_msg_pressure_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + case SensorsTMList::MAV_LPS28DFW_ID: + { + mavlink_pressure_tm_t tm; + LPS28DFWData pressure1 = + modules.get<Sensors>()->getLPS28DFW_1LastSample(); + + tm.timestamp = pressure1.pressureTimestamp; + tm.pressure = pressure1.pressure; + strcpy(tm.sensor_name, "LPS28DFW"); + + mavlink_msg_pressure_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + case SensorsTMList::MAV_CURRENT_SENSE_ID: + { + mavlink_current_tm_t tm; + CurrentData current = + modules.get<Sensors>()->getCurrentLastSample(); + tm.current = current.current; + strcpy(tm.sensor_name, "CURRENT"); + tm.timestamp = current.currentTimestamp; + + mavlink_msg_current_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + case SensorsTMList::MAV_BATTERY_VOLTAGE_ID: + { + mavlink_voltage_tm_t tm; + BatteryVoltageSensorData voltage = + modules.get<Sensors>()->getBatteryVoltageLastSample(); + tm.voltage = voltage.batVoltage; + strcpy(tm.sensor_name, "BATTERY"); + tm.timestamp = voltage.voltageTimestamp; + mavlink_msg_voltage_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + case SensorsTMList::MAV_ADS_ID: + { + mavlink_adc_tm_t tm; + ADS131M08Data voltage = + modules.get<Sensors>()->getADS131M08LastSample(); + tm.channel_0 = + voltage.getVoltage(ADS131M08Defs::Channel::CHANNEL_0).voltage; + + tm.channel_1 = + voltage.getVoltage(ADS131M08Defs::Channel::CHANNEL_1).voltage; + + tm.channel_2 = + voltage.getVoltage(ADS131M08Defs::Channel::CHANNEL_2).voltage; + + tm.channel_3 = + voltage.getVoltage(ADS131M08Defs::Channel::CHANNEL_3).voltage; + + tm.channel_4 = + voltage.getVoltage(ADS131M08Defs::Channel::CHANNEL_4).voltage; + + tm.channel_5 = + voltage.getVoltage(ADS131M08Defs::Channel::CHANNEL_5).voltage; + + tm.channel_6 = + voltage.getVoltage(ADS131M08Defs::Channel::CHANNEL_6).voltage; + + tm.channel_7 = + voltage.getVoltage(ADS131M08Defs::Channel::CHANNEL_7).voltage; + + strcpy(tm.sensor_name, "ADS131M08"); + tm.timestamp = voltage.timestamp; + mavlink_msg_adc_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + break; + } + default: + { + mavlink_nack_tm_t nack; + + nack.recv_msgid = msgId; + nack.seq_ack = seq; + + LOG_DEBUG(logger, "Unknown telemetry id: {}", sensorId); + mavlink_msg_nack_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &nack); + break; + } + } + + return msg; +} + +mavlink_message_t TMRepository::packServoTm(ServosList servoId, uint8_t msgId, + uint8_t seq) +{ + mavlink_message_t msg; + + if (servoId == PARAFOIL_LEFT_SERVO || servoId == PARAFOIL_RIGHT_SERVO) + { + mavlink_servo_tm_t tm; + + tm.servo_id = servoId; + tm.servo_position = + ModuleManager::getInstance().get<Actuators>()->getServoAngle( + servoId); + + mavlink_msg_servo_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &tm); + } + else + { + mavlink_nack_tm_t nack; + + nack.recv_msgid = msgId; + nack.seq_ack = seq; + + mavlink_msg_nack_tm_encode(RadioConfig::MAV_SYSTEM_ID, + RadioConfig::MAV_COMP_ID, &msg, &nack); + } + + return msg; +} + +} // namespace Payload diff --git a/src/boards/Payload/TMRepository/TMRepository.h b/src/boards/Payload/TMRepository/TMRepository.h new file mode 100644 index 000000000..4d2285c9c --- /dev/null +++ b/src/boards/Payload/TMRepository/TMRepository.h @@ -0,0 +1,52 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <common/Mavlink.h> +#include <diagnostic/PrintLogger.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ +class TMRepository : public Boardcore::Module +{ +public: + inline TMRepository() {} + + // Packs the telemetry at system level (E.g. logger telemetry..) + mavlink_message_t packSystemTm(SystemTMList tmId, uint8_t msgId, + uint8_t seq); + + // Packs the telemetry at sensors level (E.g. pressure sensors..) + mavlink_message_t packSensorsTm(SensorsTMList sensorId, uint8_t msgId, + uint8_t seq); + + // Packs the telemetry about servo positions states + mavlink_message_t packServoTm(ServosList servoId, uint8_t msgId, + uint8_t seq); + +private: + Boardcore::PrintLogger logger = + Boardcore::Logging::getLogger("TMRepository"); +}; +} // namespace Payload \ No newline at end of file diff --git a/src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.cpp b/src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.cpp new file mode 100644 index 000000000..538d58a45 --- /dev/null +++ b/src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.cpp @@ -0,0 +1,87 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Authors: Raul Radu + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/BoardScheduler.h> +#include <Payload/Configs/VerticalVelocityConfig.h> +#include <Payload/StateMachines/NASController/NASController.h> +#include <Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.h> +#include <common/Events.h> +#include <events/EventBroker.h> + +#include <functional> + +using namespace std; +using namespace Boardcore; +using namespace Common; + +namespace Payload +{ + +VerticalVelocityTrigger::VerticalVelocityTrigger(TaskScheduler* sched) + : running(false), confidence(0), scheduler(sched) +{ +} + +bool VerticalVelocityTrigger::start() +{ + return scheduler->addTask( + bind(&VerticalVelocityTrigger::update, this), + FailSafe::FAILSAFE_VERTICAL_VELOCITY_TRIGGER_PERIOD); +} + +void VerticalVelocityTrigger::enable() +{ + confidence = 0; + running = true; +} + +void VerticalVelocityTrigger::disable() { running = false; } + +bool VerticalVelocityTrigger::isActive() { return running; } + +void VerticalVelocityTrigger::update() +{ + if (running) + { + float verticalVelocity = -ModuleManager::getInstance() + .get<NASController>() + ->getNasState() + .vd; + if (verticalVelocity < FailSafe::FAILSAFE_VERTICAL_VELOCITY_THRESHOLD) + { + confidence++; + } + else + { + confidence = 0; + } + if (confidence >= + FailSafe::FAILSAFE_VERTICAL_VELOCITY_TRIGGER_CONFIDENCE) + { + confidence = 0; + EventBroker::getInstance().post(ALTITUDE_TRIGGER_ALTITUDE_REACHED, + TOPIC_FLIGHT); + running = false; + } + } +} +} // namespace Payload diff --git a/src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.h b/src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.h new file mode 100644 index 000000000..84f721f35 --- /dev/null +++ b/src/boards/Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.h @@ -0,0 +1,90 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Raul Radu + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Payload/BoardScheduler.h> + +#include <atomic> +#include <utils/ModuleManager/ModuleManager.hpp> + +namespace Payload +{ + +/** + * This class is used by the FailSafe logic to react to + * the premature opening of the parafoil by the payload + * Required modules: + * - Payload::BoardScheduler + * - Payload::NASController + */ +class VerticalVelocityTrigger : public Boardcore::Module +{ +public: + /** + * Default constructor for VerticalVelocityTrigger + * Sets the trigger to disabled by default + */ + VerticalVelocityTrigger(Boardcore::TaskScheduler* sched); + + /** + * Starts the module by inserting it in the BoardScheduler + */ + bool start(); + + /** + * Enables the Vertical Velocity Trigger + */ + void enable(); + + /** + * Disables the Vertical Velocity Trigger + */ + void disable(); + + /** + * Checks if the trigger is enabled + * @return true if the trigger is enabled + * @return false if the trigger is not enabled + */ + bool isActive(); + +private: + /** + * This method is called every + * FailSafe::FAILSAFE_VERTICAL_VELOCITY_TRIGGER_PERIOD + * and reads the state from the NAS and when the velocity is below + * the threshold for some confidence level it posts the event + * FLIGHT_FAILSAFE_TRIGGERED in topic TOPIC_FLIGHT + */ + void update(); + + std::atomic<bool> running; + + // Number of times that the algorithm detects to be slower than the velocity + // threshold + std::atomic<int> confidence; + + Boardcore::TaskScheduler* scheduler; +}; + +} // namespace Payload diff --git a/src/boards/Payload/WindEstimationScheme/WindEstimation.cpp b/src/boards/Payload/WindEstimationScheme/WindEstimation.cpp new file mode 100644 index 000000000..e6cc50cc7 --- /dev/null +++ b/src/boards/Payload/WindEstimationScheme/WindEstimation.cpp @@ -0,0 +1,215 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "WindEstimation.h" + +#include <Payload/BoardScheduler.h> +#include <Payload/Configs/WESConfig.h> +#include <Payload/Sensors/Sensors.h> +#include <common/Events.h> +#include <events/EventBroker.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +using namespace Payload::WESConfig; +using namespace Boardcore; +using namespace Common; +using namespace miosix; + +namespace Payload +{ + +WindEstimation::WindEstimation(TaskScheduler* sched) + : running(false), calRunning(false), scheduler(sched) +{ + funv << 1.0f, 0.0f, 0.0f, 1.0f; // cppcheck-suppress constStatement +} + +bool WindEstimation::start() +{ + scheduler->addTask( + std::bind(&WindEstimation::windEstimationSchemeCalibration, this), + WES_CALIBRATION_UPDATE_PERIOD); + + // Register the WES task + scheduler->addTask(std::bind(&WindEstimation::windEstimationScheme, this), + WES_PREDICTION_UPDATE_PERIOD); + + return true; +} + +WindEstimation::~WindEstimation() +{ + stopWindEstimationSchemeCalibration(); + stopWindEstimationScheme(); +} + +bool WindEstimation::getStatus() { return running; } + +void WindEstimation::startWindEstimationSchemeCalibration() +{ + if (!calRunning && !running) + { + calRunning = true; + nSampleCal = 0; + vx = 0; + vy = 0; + v2 = 0; + LOG_INFO(logger, "WindEstimationCalibration started"); + } +} + +void WindEstimation::stopWindEstimationSchemeCalibration() +{ + calRunning = false; + LOG_INFO(logger, "WindEstimationSchemeCalibration stopped"); + // assign value to the array only if running != false; + if (!running) + { + miosix::Lock<FastMutex> l(mutex); + wind = windCalibration; + } + windLogger.vn = windCalibration[0]; + windLogger.ve = windCalibration[1]; + startWindEstimationScheme(); + logStatus(); +} + +void WindEstimation::windEstimationSchemeCalibration() +{ + + if (calRunning) + { + auto gpsData = + ModuleManager::getInstance().get<Sensors>()->getGPSLastSample(); + if (gpsData.fix != 0) + { + if (nSampleCal < WES_CALIBRATION_SAMPLE_NUMBER) + { + float gpsN = 0, gpsE = 0; + + gpsN = gpsData.velocityNorth; + gpsE = gpsData.velocityEast; + calibrationMatrix(nSampleCal, 0) = gpsN; + calibrationMatrix(nSampleCal, 1) = gpsE; + calibrationV2(nSampleCal) = gpsN * gpsN + gpsE * gpsE; + + vx += gpsN; + vy += gpsE; + v2 += gpsN * gpsN + gpsE * gpsE; + nSampleCal++; + } + else + { + vx = vx / nSampleCal; + vy = vy / nSampleCal; + v2 = v2 / nSampleCal; + for (int i = 0; i < nSampleCal; i++) + { + calibrationMatrix(i, 0) = calibrationMatrix(i, 0) - vx; + calibrationMatrix(i, 1) = calibrationMatrix(i, 1) - vy; + calibrationV2(i) = 0.5f * (calibrationV2(i) - v2); + } + Eigen::MatrixXf calibrationMatrixT = + calibrationMatrix.transpose(); + windCalibration = + (calibrationMatrixT * calibrationMatrix) + .ldlt() + .solve(calibrationMatrixT * calibrationV2); + stopWindEstimationSchemeCalibration(); + } + } + } +} + +void WindEstimation::startWindEstimationScheme() +{ + if (!running) + { + running = true; + // nSample has to be reset after the calibration + nSample = nSampleCal; + LOG_INFO(logger, "WindEstimationScheme started"); + } +} + +void WindEstimation::stopWindEstimationScheme() +{ + if (running) + { + running = false; + LOG_INFO(logger, "WindEstimationScheme ended"); + } +} + +void WindEstimation::windEstimationScheme() +{ + if (running) + { + auto gpsData = + ModuleManager::getInstance().get<Sensors>()->getGPSLastSample(); + if (gpsData.fix != 0) + { + Eigen::Vector2f phi; + Eigen::Matrix<float, 1, 2> phiT; + Eigen::Vector2f temp; + float y, gpsN = 0, gpsE = 0; + gpsN = gpsData.velocityNorth; + gpsE = gpsData.velocityEast; + // update avg + nSample++; + vx = (vx * nSample + gpsN) / (nSample + 1); + vy = (vy * nSample + gpsE) / (nSample + 1); + v2 = (v2 * nSample + (gpsN * gpsN + gpsE * gpsE)) / (nSample + 1); + phi(0) = gpsN - vx; + phi(1) = gpsE - vy; + y = 0.5f * ((gpsN * gpsN + gpsE * gpsE) - v2); + + phiT = phi.transpose(); + funv = + (funv - (funv * phi * phiT * funv) / (1 + (phiT * funv * phi))); + temp = (0.5 * (funv + funv.transpose()) * phi) * + (y - phiT * getWindEstimationScheme()); + { + miosix::Lock<FastMutex> l(mutex); + wind = wind + temp; + windLogger.vn = wind[0]; + windLogger.ve = wind[1]; + } + logStatus(); + } + } +} + +Eigen::Vector2f WindEstimation::getWindEstimationScheme() +{ + miosix::Lock<FastMutex> l(mutex); + return wind; +} + +void WindEstimation::logStatus() +{ + windLogger.timestamp = TimestampTimer::getTimestamp(); + Logger::getInstance().log(windLogger); +} + +} // namespace Payload diff --git a/src/boards/Payload/WindEstimationScheme/WindEstimation.h b/src/boards/Payload/WindEstimationScheme/WindEstimation.h new file mode 100644 index 000000000..e3c5e0148 --- /dev/null +++ b/src/boards/Payload/WindEstimationScheme/WindEstimation.h @@ -0,0 +1,130 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Payload/BoardScheduler.h> +#include <Payload/Configs/WESConfig.h> +#include <diagnostic/PrintLogger.h> +#include <logger/Logger.h> + +#include <Eigen/Core> +#include <atomic> +#include <utils/ModuleManager/ModuleManager.hpp> + +#include "WindEstimationData.h" +namespace Payload +{ + +/** + * @brief This class implements the wind prediction algorithm, the first part is + * the initial setup, and then the continuos algoritms runs; + */ +class WindEstimation : public Boardcore::Module +{ +public: + /** + * @brief Construct a new Wing Controller object + */ + explicit WindEstimation(Boardcore::TaskScheduler* sched); + + /** + * @brief Destroy the Wing Controller object. + */ + ~WindEstimation(); + + bool start(); + + void startWindEstimationSchemeCalibration(); + + void stopWindEstimationSchemeCalibration(); + + void startWindEstimationScheme(); + + void stopWindEstimationScheme(); + + bool getStatus(); + + Eigen::Vector2f getWindEstimationScheme(); + +private: + /** + * @brief Creates the windCalibration matrix with the starting prediction + * value + */ + void windEstimationSchemeCalibration(); + + /** + * @brief Updates the wind matrix with the updated wind prediction values + */ + void windEstimationScheme(); + + /** + * @brief Logs the prediction + */ + void logStatus(); + + /** + * @brief Parameters needed for calibration + */ + Eigen::Vector2f windCalibration{0.0f, 0.0f}; + uint8_t nSampleCal = 0; + Eigen::Matrix<float, WESConfig::WES_CALIBRATION_SAMPLE_NUMBER, 2> + calibrationMatrix; + Eigen::Vector<float, WESConfig::WES_CALIBRATION_SAMPLE_NUMBER> + calibrationV2; + float vx = 0; + float vy = 0; + float v2 = 0; + + /** + * @brief Parameters needed for recursive + */ + Eigen::Vector2f wind{0.0f, 0.0f}; + uint8_t nSample = 0; + Eigen::Matrix2f funv; + + /** + * @brief Mutex + */ + miosix::FastMutex mutex; + + /** + * @brief PrintLogger + */ + Boardcore::PrintLogger logger = + Boardcore::Logging::getLogger("PayloadTest"); + + /** + * @brief Logging struct + */ + WindLogging windLogger{0, 0, 0}; + + /** + * @brief Internal running state + */ + std::atomic<bool> running; + std::atomic<bool> calRunning; + + Boardcore::TaskScheduler* scheduler = nullptr; +}; +} // namespace Payload diff --git a/src/boards/Payload/WindEstimationScheme/WindEstimationData.h b/src/boards/Payload/WindEstimationScheme/WindEstimationData.h new file mode 100644 index 000000000..49d674fc9 --- /dev/null +++ b/src/boards/Payload/WindEstimationScheme/WindEstimationData.h @@ -0,0 +1,46 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Alberto Nidasio + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <stdint.h> + +#include <iostream> +#include <string> + +namespace Payload +{ + +struct WindLogging +{ + long long timestamp = 0; + float vn = 0, ve = 0; + + static std::string header() { return "timestamp,vn,ve\n"; } + + void print(std::ostream& os) const + { + os << timestamp << "," << vn << "," << ve << "\n "; + } +}; + +} // namespace Payload diff --git a/src/boards/Payload/Wing/AutomaticWingAlgorithm.cpp b/src/boards/Payload/Wing/AutomaticWingAlgorithm.cpp new file mode 100644 index 000000000..eab89c3e4 --- /dev/null +++ b/src/boards/Payload/Wing/AutomaticWingAlgorithm.cpp @@ -0,0 +1,181 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro, Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include "AutomaticWingAlgorithm.h" + +#include <Payload/Configs/WingConfig.h> +#include <Payload/Sensors/Sensors.h> +#include <Payload/StateMachines/NASController/NASController.h> +#include <Payload/StateMachines/WingController/WingController.h> +#include <Payload/WindEstimationScheme/WindEstimation.h> +#include <drivers/timer/TimestampTimer.h> +#include <math.h> +#include <utils/AeroUtils/AeroUtils.h> +#include <utils/Constants.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +using namespace Boardcore; +using namespace Eigen; +using namespace Payload::WingConfig; + +namespace Payload +{ +AutomaticWingAlgorithm::AutomaticWingAlgorithm(float Kp, float Ki, + ServosList servo1, + ServosList servo2, + GuidanceAlgorithm& guidance) + : WingAlgorithm(servo1, servo2), guidance(guidance) +{ + controller = new PIController(Kp, Ki, WING_UPDATE_PERIOD / 1000.0f, + PI_CONTROLLER_SATURATION_MIN_LIMIT, + PI_CONTROLLER_SATURATION_MAX_LIMIT); +} + +AutomaticWingAlgorithm::~AutomaticWingAlgorithm() { delete (controller); } + +void AutomaticWingAlgorithm::step() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + if (modules.get<Sensors>()->getGPSLastSample().fix != 0) + { + // The PI calculated result + float result = algorithmStep( + modules.get<NASController>()->getNasState(), + modules.get<WindEstimation>()->getWindEstimationScheme()); + + // Actuate the result + if (result > 0) + { + // Activate the servo1 and reset servo2 + modules.get<Actuators>()->setServoAngle(servo1, result); + modules.get<Actuators>()->setServoAngle(servo2, 0); + } + else + { + // Activate the servo2 and reset servo1 + modules.get<Actuators>()->setServoAngle(servo1, 0); + modules.get<Actuators>()->setServoAngle(servo2, result * -1); + } + + // Log the servo positions + { + miosix::Lock<FastMutex> l(mutex); + + data.timestamp = TimestampTimer::getTimestamp(); + data.servo1Angle = + modules.get<Actuators>()->getServoPosition(servo1); + data.servo2Angle = + modules.get<Actuators>()->getServoPosition(servo2); + SDlogger->log(data); + } + } + else + { + // If we loose fix we set both servo at 0 + modules.get<Actuators>()->setServoAngle(servo1, 0); + modules.get<Actuators>()->setServoAngle(servo2, 0); + } +} + +float AutomaticWingAlgorithm::algorithmStep(NASState state, Vector2f windNED) +{ + float result; + // For some algorithms the third component is needed! + Vector3f currentPosition(state.n, state.e, state.d); + + Vector2f heading; // used for logging purposes + + float targetAngle = guidance.calculateTargetAngle(currentPosition, heading); + + Vector2f relativeVelocity(state.vn - windNED[0], state.ve - windNED[1]); + + // Compute the angle of the current velocity + float velocityAngle; + + // In case of a 0 north velocity i force the angle to 90 + if (relativeVelocity[0] == 0 && relativeVelocity[1] == 0) + { + velocityAngle = 0; + } + else if (relativeVelocity[1] == 0) + { + velocityAngle = (relativeVelocity[0] > 0 ? 1 : -1) * Constants::PI / 2; + } + else + { + velocityAngle = atan2(relativeVelocity[1], relativeVelocity[0]); + } + + // Compute the angle difference + float error = angleDiff(targetAngle, velocityAngle); + + // Call the PI with the just calculated error. The result is in RADIANS, + // if positive we activate one servo, if negative the other + result = controller->update(error); + + // Convert the result from radians back to degrees + result = result * (180.f / Constants::PI); + + // Flip the servo orientation + result *= -1; + + // Logs the outputs + { + miosix::Lock<FastMutex> l(mutex); + data.targetX = heading[0]; + data.targetY = heading[1]; + data.targetAngle = targetAngle; + data.velocityAngle = velocityAngle; + data.error = error; + data.pidOutput = result; + } + + return result; +} + +float AutomaticWingAlgorithm::angleDiff(float a, float b) +{ + float diff = a - b; + + // Angle difference + if (diff < -Constants::PI || Constants::PI < diff) + { + diff += Constants::PI; + bool positiveInput = diff > 0; + + diff = diff - floor(diff / (2 * Constants::PI)) * (2 * Constants::PI); + + // diff = fmod(diff, 2 * Constants::PI); + if (diff == 0 && positiveInput) + { + diff = 2 * Constants::PI; + } + + diff -= Constants::PI; + } + + return diff; +} + +} // namespace Payload diff --git a/src/boards/Payload/Wing/AutomaticWingAlgorithm.h b/src/boards/Payload/Wing/AutomaticWingAlgorithm.h new file mode 100644 index 000000000..ffc00ec59 --- /dev/null +++ b/src/boards/Payload/Wing/AutomaticWingAlgorithm.h @@ -0,0 +1,97 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <Payload/Wing/Guidance/GuidanceAlgorithm.h> +#include <Payload/Wing/WingAlgorithm.h> +#include <algorithms/NAS/NASState.h> +#include <algorithms/PIController.h> +#include <algorithms/ReferenceValues.h> + +#include <Eigen/Core> + +namespace Payload +{ +class AutomaticWingAlgorithm : public WingAlgorithm +{ + +public: + /** + * @brief Construct a new Automatic Wing Algorithm object + * + * @param Kp Proportional value for PI controller + * @param Ki Integral value for PI controller + * @param servo1 The first servo + * @param servo2 The second servo + * @param guidance The algorithm used to compute the target yaw and the + * heading + */ + AutomaticWingAlgorithm(float Kp, float Ki, ServosList servo1, + ServosList servo2, GuidanceAlgorithm& guidance); + + /** + * @brief Destroy the Automatic Wing Algorithm object and the PI + */ + ~AutomaticWingAlgorithm(); + +protected: + // Guidance algorithm that sets the yaw. + GuidanceAlgorithm& guidance; + + // PI controller tuned on the Kp and Ki passed through constructor + Boardcore::PIController* controller; + + /** + * @brief Actual algorithm implementation, all parameters should be in NED + * + * @param state NAS current state + * @param targetNED Target North & East + * @param windNED Wind velocity North & East + */ + float algorithmStep(Boardcore::NASState state, Eigen::Vector2f windNED); + + /** + * @brief This method implements the automatic algorithm that will steer the + * parafoil according to its position and velocity. IN THIS METHOD THE + * GUIDANCE IS TRANSLATED + */ + void step() override; + + /** + * @brief Computes the difference between two angles + * + * @param a The first angle + * @param b The second angle + * + * @returns angle(a) - angle(b) + */ + float angleDiff(float a, float b); + + // Logging structure + WingAlgorithmData data; + + /** + * @brief Mutex + */ + miosix::FastMutex mutex; +}; +} // namespace Payload diff --git a/src/boards/Payload/Wing/FileWingAlgorithm.cpp b/src/boards/Payload/Wing/FileWingAlgorithm.cpp new file mode 100644 index 000000000..7d4f8e7a1 --- /dev/null +++ b/src/boards/Payload/Wing/FileWingAlgorithm.cpp @@ -0,0 +1,68 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/Wing/FileWingAlgorithm.h> +#include <drivers/timer/TimestampTimer.h> + +using namespace Boardcore; + +namespace Payload +{ +std::istream& operator>>(std::istream& input, WingAlgorithmData& data) +{ + input >> data.timestamp; + input.ignore(1, ','); + input >> data.servo1Angle; + input.ignore(1, ','); + input >> data.servo2Angle; + return input; +} + +FileWingAlgorithm::FileWingAlgorithm(ServosList servo1, ServosList servo2, + const char* filename) + : WingAlgorithm(servo1, servo2), parser(filename) +{ + setServo(servo1, servo2); +} + +bool FileWingAlgorithm::init() +{ + // Returns a std::vector which contains + // all the csv parsed with the data structure in mind + steps = parser.collect(); + + // Return if the size collected is greater than 0 + fileValid = steps.size() > 0; + + // Communicate it via serial + if (fileValid) + { + LOG_INFO(logger, "File valid"); + } + + // Close the file + parser.close(); + + return fileValid; +} + +} // namespace Payload diff --git a/src/boards/Payload/Wing/FileWingAlgorithm.h b/src/boards/Payload/Wing/FileWingAlgorithm.h new file mode 100644 index 000000000..50884d5d1 --- /dev/null +++ b/src/boards/Payload/Wing/FileWingAlgorithm.h @@ -0,0 +1,91 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once +#include <Payload/Wing/WingAlgorithm.h> +#include <utils/CSVReader/CSVReader.h> + +/** + * @brief This class abstracts the concept of wing timestamp based + * algorithm. These algorithms are stored in files (formatted in csv). + * We use a CSV parser to properly parse the procedure and every step + * we check if it is time to advance and in case actuate the step with + * the two servos. + * + * Brief use case: + * + * Actuators::getInstance().enableServo(PARAFOIL_LEFT_SERVO); + * Actuators::getInstance().enableServo(PARAFOIL_RIGHT_SERVO); + * + * WingAlgorithm algorithm(PARAFOIL_LEFT_SERVO, PARAFOIL_RIGHT_SERVO, "Optional + * File") algorithm.init(); + * + * //In case of a non valid file/empty string you can add the steps + * algorithm.addStep(WingAlgorithmData{timestamp, angle1, angle2}); + * + * algorithm.begin(); + * + * algorithm.update()... + * + * //End of algorithm + * + * algorithm.begin(); + * + * algorithm.update()... + */ + +namespace Payload +{ + +class FileWingAlgorithm : public WingAlgorithm +{ +public: + /** + * @brief Construct a new Wing Algorithm object + * + * @param servo1 The first servo + * @param servo2 The second servo + * @param filename The csv file where all the operations are stored + */ + FileWingAlgorithm(ServosList servo1, ServosList servo2, + const char* filename); + + /** + * @brief This method parses the file and stores it into a std::vector + * + * @return true If the initialization finished correctly + * @return false If something went wrong + */ + bool init() override; + +protected: + /** + * @brief CSV format file parser + */ + Boardcore::CSVParser<WingAlgorithmData> parser; + + /** + * @brief Indicates whether the current file of the algorithm is readable + */ + bool fileValid = false; +}; +} // namespace Payload diff --git a/src/boards/Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.cpp b/src/boards/Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.cpp new file mode 100644 index 000000000..48b42619c --- /dev/null +++ b/src/boards/Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.cpp @@ -0,0 +1,42 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.h> +#include <math.h> + +namespace Payload +{ + +float ClosedLoopGuidanceAlgorithm::calculateTargetAngle( + const Eigen::Vector3f& currentPositionNED, Eigen::Vector2f& heading) +{ + heading[0] = targetNED[0] - currentPositionNED[0]; + heading[1] = targetNED[1] - currentPositionNED[1]; + return atan2(heading[1], heading[0]); +} + +void ClosedLoopGuidanceAlgorithm::setPoints(Eigen::Vector2f targetNED) +{ + this->targetNED = targetNED; +} + +} // namespace Payload diff --git a/src/boards/Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.h b/src/boards/Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.h new file mode 100644 index 000000000..5bc739693 --- /dev/null +++ b/src/boards/Payload/Wing/Guidance/ClosedLoopGuidanceAlgorithm.h @@ -0,0 +1,57 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Payload/Wing/Guidance/GuidanceAlgorithm.h> + +#include <Eigen/Core> + +namespace Payload +{ + +/** + * This class is the implementation of the Simple Closed Loop guidance. + * It calculates the yaw between the current position and the target position by + * calculating the difference between the two vectors and the angle formed by + * the diff vector + */ +class ClosedLoopGuidanceAlgorithm : public GuidanceAlgorithm +{ + /** + * @brief This method calculates the yaw angle of the parafoil knowing + * the current position and the target position. + * + * @param[in] position the current NED position of the parafoil in [m] + * @param[in] target NED position of the target in [m] + * @param[out] heading Saves the heading vector for logging purposes + * + * @returns the yaw angle of the parafoil in [rad] + */ + float calculateTargetAngle(const Eigen::Vector3f& currentPositionNED, + Eigen::Vector2f& heading) override; + +public: + void setPoints(Eigen::Vector2f targetNED); +}; + +} // namespace Payload diff --git a/src/boards/Payload/Wing/Guidance/EarlyManeuverGuidanceAlgorithm.cpp b/src/boards/Payload/Wing/Guidance/EarlyManeuverGuidanceAlgorithm.cpp new file mode 100644 index 000000000..66ee2bcce --- /dev/null +++ b/src/boards/Payload/Wing/Guidance/EarlyManeuverGuidanceAlgorithm.cpp @@ -0,0 +1,150 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/Configs/WingConfig.h> +#include <Payload/Wing/Guidance/EarlyManeuversGuidanceAlgorithm.h> + +#include <Eigen/Core> +#include <utils/ModuleManager/ModuleManager.hpp> + +using namespace Payload::WingConfig; + +namespace Payload +{ + +EarlyManeuversGuidanceAlgorithm::EarlyManeuversGuidanceAlgorithm() + : activeTarget(Target::EMC), targetAltitudeConfidence(0), + m2AltitudeConfidence(0), m1AltitudeConfidence(0), + emcAltitudeConfidence(0){}; + +EarlyManeuversGuidanceAlgorithm::~EarlyManeuversGuidanceAlgorithm(){}; + +float EarlyManeuversGuidanceAlgorithm::calculateTargetAngle( + const Eigen::Vector3f& currentPositionNED, Eigen::Vector2f& heading) +{ + using namespace Boardcore; + + float altitude = abs(currentPositionNED[2]); + + computeActiveTarget(altitude); + + switch (activeTarget) + { + case Target::EMC: + heading[0] = EMC[0] - currentPositionNED[0]; + heading[1] = EMC[1] - currentPositionNED[1]; + break; + case Target::M1: + heading[0] = M1[0] - currentPositionNED[0]; + heading[1] = M1[1] - currentPositionNED[1]; + break; + case Target::M2: + heading[0] = M2[0] - currentPositionNED[0]; + heading[1] = M2[1] - currentPositionNED[1]; + break; + case Target::FINAL: + heading[0] = targetNED[0] - currentPositionNED[0]; + heading[1] = targetNED[1] - currentPositionNED[1]; + break; + } + + return atan2(heading[1], heading[0]); +} + +void EarlyManeuversGuidanceAlgorithm::computeActiveTarget(float altitude) +{ + if (altitude <= + GUIDANCE_TARGET_ALTITUDE_THRESHOLD) // Altitude is low, head directly + // to target + { + targetAltitudeConfidence++; + } + else if (altitude <= GUIDANCE_M2_ALTITUDE_THRESHOLD) // Altitude is almost + // okay, go to M2 + { + m2AltitudeConfidence++; + } + else if (altitude <= + GUIDANCE_M1_ALTITUDE_THRESHOLD) // Altitude is high, go to M1 + { + m1AltitudeConfidence++; + } + else + { + emcAltitudeConfidence++; // Altitude is too high, head to the emc + } + + switch (activeTarget) + { + case Target::EMC: + if (targetAltitudeConfidence >= GUIDANCE_CONFIDENCE) + { + activeTarget = Target::FINAL; + emcAltitudeConfidence = 0; + } + else if (m2AltitudeConfidence >= GUIDANCE_CONFIDENCE) + { + activeTarget = Target::M2; + emcAltitudeConfidence = 0; + } + else if (m1AltitudeConfidence >= GUIDANCE_CONFIDENCE) + { + activeTarget = Target::M1; + emcAltitudeConfidence = 0; + } + break; + case Target::M1: + if (targetAltitudeConfidence >= GUIDANCE_CONFIDENCE) + { + activeTarget = Target::FINAL; + m1AltitudeConfidence = 0; + } + else if (m2AltitudeConfidence >= GUIDANCE_CONFIDENCE) + { + activeTarget = Target::M2; + m1AltitudeConfidence = 0; + } + break; + case Target::M2: + if (targetAltitudeConfidence >= GUIDANCE_CONFIDENCE) + { + activeTarget = Target::FINAL; + m2AltitudeConfidence = 0; + } + break; + case Target::FINAL: + break; + } +} + +void EarlyManeuversGuidanceAlgorithm::setPoints(Eigen::Vector2f targetNED, + Eigen::Vector2f EMC, + Eigen::Vector2f M1, + Eigen::Vector2f M2) +{ + this->targetNED = targetNED; + this->EMC = EMC; + this->M1 = M1; + this->M2 = M2; +} + +} // namespace Payload diff --git a/src/boards/Payload/Wing/Guidance/EarlyManeuversGuidanceAlgorithm.h b/src/boards/Payload/Wing/Guidance/EarlyManeuversGuidanceAlgorithm.h new file mode 100644 index 000000000..30a432504 --- /dev/null +++ b/src/boards/Payload/Wing/Guidance/EarlyManeuversGuidanceAlgorithm.h @@ -0,0 +1,112 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Payload/Wing/Guidance/GuidanceAlgorithm.h> + +#include <Eigen/Core> + +namespace Payload +{ + +/** + * This class is the implementation of the Simple Closed Loop guidance. + * It calculates the yaw between the current position and the target position by + * calculating the difference between the two vectors and the angle formed by + * the diff vector + * + * requires: WingControllers + */ +class EarlyManeuversGuidanceAlgorithm : public GuidanceAlgorithm +{ + +public: + /** + * @brief Constructor for the EM Algorithm + * + */ + EarlyManeuversGuidanceAlgorithm(); + + virtual ~EarlyManeuversGuidanceAlgorithm(); + + /** + * @brief This method calculates the yaw angle of the parafoil knowing + * the current position and the target position. + * + * @param[in] currentPositionNED the current NED position of the parafoil in + * m + * @param[in] targetPositionNED NED position of the target in m + * @param[out] heading Saves the heading vector for logging purposes + * + * @returns the yaw angle of the parafoil in rad + * + */ + float calculateTargetAngle(const Eigen::Vector3f& currentPositionNED, + Eigen::Vector2f& heading) override; + + /** + * @brief Set Early Maneuvers points + * + * @param[in] EMC NED + * @param[in] M1 NED + * @param[in] M2 NED + * + */ + void setPoints(Eigen::Vector2f targetNED, Eigen::Vector2f EMC, + Eigen::Vector2f M1, Eigen::Vector2f M2); + +private: + /** @brief Updates the class target + * + */ + void computeActiveTarget(float altitude); + + /** + * @brief Enumerates all the possible targets of the EM algorithm + */ + enum class Target + { + EMC = 0, + M1, + M2, + FINAL + }; + + // Point we are currently poinying to + Target activeTarget; + + // Eigen::Vector2f targetNED; // NED + + Eigen::Vector2f EMC; // NED + + Eigen::Vector2f M1; // NED + + Eigen::Vector2f M2; // NED + + unsigned int targetAltitudeConfidence; + unsigned int m2AltitudeConfidence; + unsigned int m1AltitudeConfidence; + unsigned int emcAltitudeConfidence; +}; + +} // namespace Payload diff --git a/src/boards/Payload/Wing/Guidance/GuidanceAlgorithm.h b/src/boards/Payload/Wing/Guidance/GuidanceAlgorithm.h new file mode 100644 index 000000000..4086116c3 --- /dev/null +++ b/src/boards/Payload/Wing/Guidance/GuidanceAlgorithm.h @@ -0,0 +1,61 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <Eigen/Core> + +namespace Payload +{ + +/** + * This class acts as an interface for a generic guidance algorithm that is used + * by the Automatic Wing Algorithm. + */ +class GuidanceAlgorithm +{ +public: + /** + * @brief This method must calculate the yaw angle of the parafoil knowing + * the current position and the target position without changing the vectors + * passed as arguments. + * + * @note the args are const references to reduce access time by avoiding + * copying objects that will be read-only. + * + * @param[in] position the current NED position of the parafoil in [m] + * @param[in] target NED position of the target in [m] + * @param[out] heading The current heading, it is used for logging purposes + * + * @returns the yaw angle of the parafoil in [rad] + */ + virtual float calculateTargetAngle( + const Eigen::Vector3f& currentPositionNED, + Eigen::Vector2f& heading) = 0; + + Eigen::Vector2f getTargetNED() { return targetNED; } + +protected: + Eigen::Vector2f targetNED{0, 0}; // NED +}; + +} // namespace Payload diff --git a/src/boards/Payload/Wing/WingAlgorithm.cpp b/src/boards/Payload/Wing/WingAlgorithm.cpp new file mode 100644 index 000000000..9bb304991 --- /dev/null +++ b/src/boards/Payload/Wing/WingAlgorithm.cpp @@ -0,0 +1,122 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Authors: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/Configs/WingConfig.h> +#include <Payload/Wing/WingAlgorithm.h> +#include <common/Events.h> +#include <drivers/timer/TimestampTimer.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +using namespace Boardcore; +using namespace Payload::WingConfig; +using namespace Common; +namespace Payload +{ +WingAlgorithm::WingAlgorithm(ServosList servo1, ServosList servo2) +{ + this->servo1 = servo1; + this->servo2 = servo2; + stepIndex = 0; + // Create the vector for algorithm data + steps = std::vector<WingAlgorithmData>(); +} + +bool WingAlgorithm::init() +{ + return true; // In this case the init is always true +} + +void WingAlgorithm::setServo(ServosList servo1, ServosList servo2) +{ + this->servo1 = servo1; + this->servo2 = servo2; +} + +void WingAlgorithm::addStep(WingAlgorithmData step) { steps.push_back(step); } + +void WingAlgorithm::begin() +{ + running = true; + shouldReset = true; + + // Set the reference timestamp + timeStart = TimestampTimer::getTimestamp(); +} + +void WingAlgorithm::end() +{ + running = false; + + // Set the reference timestamp to 0 + timeStart = 0; +} + +void WingAlgorithm::step() +{ + ModuleManager& modules = ModuleManager::getInstance(); + uint64_t currentTimestamp = TimestampTimer::getTimestamp(); + + if (shouldReset) + { + // If the algorithm has been stopped + // i want to start from the beginning + stepIndex = 0; + shouldReset = false; + } + + if (stepIndex >= steps.size()) + { + LOG_INFO(logger, "Algorithm end {:d} >= {:d}", stepIndex, steps.size()); + // End the procedure so it won't be executed + // Set the index to 0 in case of another future execution + stepIndex = 0; + // Terminate here + // EventBroker::getInstance().post(ALGORITHM_ENDED, TOPIC_ALGOS); + return; + } + + if (currentTimestamp - timeStart >= steps[stepIndex].timestamp) + { + // I need to execute the current step + modules.get<Actuators>()->setServoAngle(servo1, + steps[stepIndex].servo1Angle); + modules.get<Actuators>()->setServoAngle(servo2, + steps[stepIndex].servo2Angle); + + // Log the data setting the timestamp to the absolute one + WingAlgorithmData data; + data.timestamp = TimestampTimer::getTimestamp(); + data.servo1Angle = steps[stepIndex].servo1Angle; + data.servo2Angle = steps[stepIndex].servo2Angle; + + // After copy i can log the actual step + SDlogger->log(data); + + // finally increment the stepIndex + stepIndex++; + + LOG_INFO(logger, "Step"); + } +} + +} // namespace Payload diff --git a/src/boards/Payload/Wing/WingAlgorithm.h b/src/boards/Payload/Wing/WingAlgorithm.h new file mode 100644 index 000000000..4334300d8 --- /dev/null +++ b/src/boards/Payload/Wing/WingAlgorithm.h @@ -0,0 +1,107 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Authors: Matteo Pignataro, Federico Mandelli + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once + +#include <Payload/Actuators/Actuators.h> +#include <Payload/Wing/WingAlgorithmData.h> +#include <algorithms/Algorithm.h> +#include <diagnostic/PrintLogger.h> +#include <logger/Logger.h> +#include <miosix.h> +namespace Payload +{ +class WingAlgorithm : public Boardcore::Algorithm +{ +public: + /** + * @brief Construct a new Wing Algorithm object + * + * @param servo1 The first servo + * @param servo2 The second servo + */ + WingAlgorithm(ServosList servo1, ServosList servo2); + + /** + * @brief Method to initialize the algorithm + * + * @return true If the init process goes well + * @return false If the init process doesn't go well + */ + bool init() override; + + /** + * @brief Set the Servos object + * + * @param servo1 The first algorithm servo + * @param servo2 The second algorithm servo + */ + void setServo(ServosList servo1, ServosList servo2); + + /** + * @brief Add a step to the algorithm sequence + * + * @param step The step to add + */ + void addStep(WingAlgorithmData step); + + /** + * @brief This sets the reference timestamp for the algorithm + */ + void begin(); + + /** + * @brief This method disables the algorithm + */ + void end(); + /** + * @brief This method implements the algorithm step based on the current + * timestamp + */ + void step() override; + +protected: + // The actuators + ServosList servo1, servo2; + + // Reference timestamp for relative algorithm timestamps + uint64_t timeStart; + + // Procedure array to memorize all the steps needed to perform the algorithm + std::vector<WingAlgorithmData> steps; + + // PrintLogger + Boardcore::PrintLogger logger = + Boardcore::Logging::getLogger("WingAlgorithm"); + + // SD logger + Boardcore::Logger* SDlogger = &Boardcore::Logger::getInstance(); + + // This boolean is used to understand when to reset + // the index where the algorithm has stopped. + // In case of end call, we want to be able to perform + // another time this algorithm starting from 0 + std::atomic<bool> shouldReset; + + // Variable to remember what step that has to be done + unsigned int stepIndex; +}; +} // namespace Payload diff --git a/src/boards/Payload/Wing/WingAlgorithmData.h b/src/boards/Payload/Wing/WingAlgorithmData.h new file mode 100644 index 000000000..38e20628c --- /dev/null +++ b/src/boards/Payload/Wing/WingAlgorithmData.h @@ -0,0 +1,57 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ +#pragma once +#include <sensors/SensorData.h> + +namespace Payload +{ +/** + * This class represents the algorithm data structure that needs to be logged + * into the onboard SD card. It has the timestamp(absolute) and the servo + * position set by the selected algorithm + */ +struct WingAlgorithmData +{ + uint64_t timestamp; // First timestamp is 0 (in microseconds) + float servo1Angle; // degrees + float servo2Angle; // degrees + float targetAngle; // radians (automatic only) + float velocityAngle; // radians + float targetX; // NED (only automatic algorithm) + float targetY; // NED (only automatic algorithm) + float error; + float pidOutput; + + static std::string header() + { + return "WingAlgorithmTimestamp,servo1Angle,servo2Angle,targetAngle," + "velocityAngle,targetX,targetY,error,pidOutput\n"; + } + + void print(std::ostream& os) const + { + os << timestamp << "," << servo1Angle << "," << servo2Angle << "," + << targetAngle << "," << velocityAngle << "," << targetX << "," + << targetY << "," << error << "," << pidOutput << "\n"; + } +}; +} // namespace Payload diff --git a/src/boards/Payload/Wing/WingTargetPositionData.h b/src/boards/Payload/Wing/WingTargetPositionData.h new file mode 100644 index 000000000..a1cab4dbf --- /dev/null +++ b/src/boards/Payload/Wing/WingTargetPositionData.h @@ -0,0 +1,58 @@ +/* Copyright (c) 2022 Skyward Experimental Rocketry + * Author: Alberto Nidasio, Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#pragma once + +#include <ostream> +#include <string> + +namespace Payload +{ + +struct WingTargetPositionData +{ + float receivedLat; + float receivedLon; + float targetN; + float targetE; + float emcN; + float emcE; + float m1N; + float m1E; + float m2N; + float m2E; + + static std::string header() + { + return "receivedLat, receivedLon, " + "targetN,targetE,EMCN,EMCE,M1N,M1E,M2N,M2E\n"; + } + + void print(std::ostream& os) const + { + os << receivedLat << "," << receivedLon << "," << targetN << "," + << targetE << "," << emcN << "," << emcE << "," << m1N << "," << m1E + << "," << m2N << "," << m2E << "\n"; + } +}; + +} // namespace Payload diff --git a/src/entrypoints/Payload/payload-entry.cpp b/src/entrypoints/Payload/payload-entry.cpp new file mode 100644 index 000000000..b174e140b --- /dev/null +++ b/src/entrypoints/Payload/payload-entry.cpp @@ -0,0 +1,318 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Matteo Pignataro + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// #define DEFAULT_STDOUT_LOG_LEVEL LOGL_WARNING +#include <Payload/Actuators/Actuators.h> +#include <Payload/AltitudeTrigger/AltitudeTrigger.h> +#include <Payload/BoardScheduler.h> +#include <Payload/Buses.h> +#include <Payload/CanHandler/CanHandler.h> +#include <Payload/FlightStatsRecorder/FlightStatsRecorder.h> +#include <Payload/PinHandler/PinHandler.h> +#include <Payload/Radio/Radio.h> +#include <Payload/Sensors/Sensors.h> +#include <Payload/StateMachines/FlightModeManager/FlightModeManager.h> +#include <Payload/StateMachines/NASController/NASController.h> +#include <Payload/StateMachines/WingController/WingController.h> +#include <Payload/TMRepository/TMRepository.h> +#include <Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.h> +#include <Payload/WindEstimationScheme/WindEstimation.h> +#include <common/Events.h> +#include <common/Topics.h> +#include <diagnostic/CpuMeter/CpuMeter.h> +#include <diagnostic/PrintLogger.h> +#include <diagnostic/StackLogger.h> +#include <drivers/timer/TimestampTimer.h> +#include <events/EventBroker.h> +#include <events/EventData.h> +#include <events/utils/EventSniffer.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +using namespace Boardcore; +using namespace Payload; +using namespace Common; + +int main() +{ + ModuleManager& modules = ModuleManager::getInstance(); + + // Overall status, if at some point it becomes false, there is a problem + // somewhere + bool initResult = true; + PrintLogger logger = Logging::getLogger("Payload"); + + // Scheduler + BoardScheduler* scheduler = new BoardScheduler(); + + // Nas priority (Max priority) + NASController* nas = + new NASController(scheduler->getScheduler(miosix::PRIORITY_MAX)); + + // Sensors priority (MAX - 1) + Sensors* sensors = + new Sensors(scheduler->getScheduler(miosix::PRIORITY_MAX - 1)); + + // Other critical components (Max - 2) + Radio* radio = new Radio(scheduler->getScheduler(miosix::PRIORITY_MAX - 2)); + AltitudeTrigger* altTrigger = + new AltitudeTrigger(scheduler->getScheduler(miosix::PRIORITY_MAX - 2)); + WingController* wingController = + new WingController(scheduler->getScheduler(miosix::PRIORITY_MAX - 2)); + VerticalVelocityTrigger* verticalVelocityTrigger = + new VerticalVelocityTrigger( + scheduler->getScheduler(miosix::PRIORITY_MAX - 2)); + WindEstimation* windEstimation = + new WindEstimation(scheduler->getScheduler(miosix::PRIORITY_MAX - 2)); + CanHandler* canHandler = + new CanHandler(scheduler->getScheduler(miosix::PRIORITY_MAX - 2)); + + // Non critical components (Max - 3) + // Actuators is considered non-critical since the scheduler is only used for + // the led and buzzer tasks + Actuators* actuators = + new Actuators(scheduler->getScheduler(miosix::PRIORITY_MAX - 3)); + FlightStatsRecorder* statesRecorder = new FlightStatsRecorder( + scheduler->getScheduler(miosix::PRIORITY_MAX - 3)); + + // Components without a scheduler + TMRepository* tmRepo = new TMRepository(); + FlightModeManager* fmm = new FlightModeManager(); + Buses* buses = new Buses(); + PinHandler* pinHandler = new PinHandler(); + + // Insert modules + if (!modules.insert<BoardScheduler>(scheduler)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the Board Scheduler module"); + } + + if (!modules.insert<Buses>(buses)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the Buses module"); + } + + if (!modules.insert<Sensors>(sensors)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the Sensor module"); + } + + if (!modules.insert<NASController>(nas)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the NAS module"); + } + + if (!modules.insert<FlightModeManager>(fmm)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the FMM module"); + } + if (!modules.insert<Radio>(radio)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the Radio module"); + } + + if (!modules.insert<TMRepository>(tmRepo)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the TMRepository module"); + } + + if (!modules.insert<Actuators>(actuators)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the Actuators module"); + } + + if (!modules.insert<AltitudeTrigger>(altTrigger)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the Altitude Trigger module"); + } + + if (!modules.insert<WingController>(wingController)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the WingController module"); + } + + if (!modules.insert<WindEstimation>(windEstimation)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the WindEstimation module"); + } + + if (!modules.insert<PinHandler>(pinHandler)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the PinHandler module"); + } + + if (!modules.insert<VerticalVelocityTrigger>(verticalVelocityTrigger)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the VerticalVelocityTrigger module"); + } + + if (!modules.insert<CanHandler>(canHandler)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the CanHandler module"); + } + + if (!modules.insert<FlightStatsRecorder>(statesRecorder)) + { + initResult = false; + LOG_ERR(logger, "Error inserting the FlightStatsRecorder module"); + } + + // Start modules + if (!Logger::getInstance().testSDCard()) + { + initResult = false; + LOG_ERR(logger, "Error testing the Logger module"); + } + + if (!EventBroker::getInstance().start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the EventBroker module"); + } + + if (!modules.get<Sensors>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the Sensors module"); + } + + if (!modules.get<NASController>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the NAS module"); + } + + if (!modules.get<FlightModeManager>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the FMM module"); + } + + if (!modules.get<Radio>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the Radio module"); + } + + if (!modules.get<Actuators>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the Actuators module"); + } + + if (!modules.get<AltitudeTrigger>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the AltitudeTrigger module"); + } + + if (!modules.get<WingController>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the WingController module"); + } + + if (!modules.get<WindEstimation>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the WindEstimation module"); + } + + if (!modules.get<PinHandler>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the PinHandler module"); + } + + if (!modules.get<VerticalVelocityTrigger>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the VerticalVelocityTrigger module"); + } + + if (!modules.get<CanHandler>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the CanHandler module"); + } + + if (!modules.get<FlightStatsRecorder>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the FlightStatsRecorder module"); + } + + if (!modules.get<BoardScheduler>()->start()) + { + initResult = false; + LOG_ERR(logger, "Error starting the Board Scheduler module"); + } + + // Log all the events + EventSniffer sniffer( + EventBroker::getInstance(), TOPICS_LIST, + [](uint8_t event, uint8_t topic) + { + EventData ev{TimestampTimer::getTimestamp(), event, topic}; + Logger::getInstance().log(ev); + }); + + // Check the init result and launch an event + if (initResult) + { + // Post OK + EventBroker::getInstance().post(FMM_INIT_OK, TOPIC_FMM); + + // Set the LED status + miosix::led1On(); + } + else + { + EventBroker::getInstance().post(FMM_INIT_ERROR, TOPIC_FMM); + LOG_ERR(logger, "Failed to initialize"); + } + + // Periodic statistics + while (true) + { + Thread::sleep(1000); + Logger::getInstance().log(CpuMeter::getCpuStats()); + CpuMeter::resetCpuStats(); + StackLogger::getInstance().log(); + } + + return 0; +} diff --git a/src/tests/Payload/payload-test-VerticalVelocityTrigger.cpp b/src/tests/Payload/payload-test-VerticalVelocityTrigger.cpp new file mode 100644 index 000000000..3dc7ac5df --- /dev/null +++ b/src/tests/Payload/payload-test-VerticalVelocityTrigger.cpp @@ -0,0 +1,166 @@ +/* Copyright (c) 2023 Skyward Experimental Rocketry + * Author: Radu Raul + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#include <Payload/BoardScheduler.h> +#include <Payload/Configs/FailSafeConfig.h> +#include <Payload/NASControllerMock/NASControllerMock.h> +#include <Payload/VerticalVelocityTrigger/VerticalVelocityTrigger.h> +#include <events/EventBroker.h> +#include <miosix.h> + +#include <utils/ModuleManager/ModuleManager.hpp> + +using namespace Boardcore; +using namespace Payload; + +// Initial velocity for the Vertical Velocity Trigger +constexpr float MOCK_INITIAL_VERTICAL_VELOCITY = -30; +constexpr float MOCK_VELOCITY_DECELERATION = 0.5; // m/s^2 + +/** + * This class mocks the NASController class since for this test we cannot start + * the NASController as it needs the sensor reading and we cannot test the + * velocity trigger unless we launch the rocket + */ +class NASMock : public NASController +{ +public: + /** + * Default constructor for NASMock + * It initializes the mockedVerticalSpeed + */ + NASMock() : mockedVerticalSpeed(MOCK_INITIAL_VERTICAL_VELOCITY) {} + + /** + * Default destructor for NASMock + */ + ~NASMock() {} + + /** + * This method mocks the NASController::getNasState() and returns a + * NASState with a personalized vertical velocity that starts at + * NASMock::MOCK_INITIAL_VERTICAL_VELOCITY and decreases by 0.5 m/s^2 + * + * @return NASState object that contains the vertical vector in NED + * orientation + */ + NASState getNasState() override + { + mockedVerticalSpeed += + MOCK_VELOCITY_DECELERATION * + ((float)FailSafe::FAILSAFE_VERTICAL_VELOCITY_TRIGGER_PERIOD / + 1000.f); + NASState n = NASState(); + n.vd = mockedVerticalSpeed; + return n; + } + +private: + // Keeps trace of the vertical velocity in NED orientation + float mockedVerticalSpeed; +}; + +/** + * This function halts the board + */ +void halt() +{ + while (1) + { + } +} + +/** + * This function calculates the maximum wait time needed by the Vertical + * Velocity Trigger to trigger + */ +float calculateMaxWaitTime() +{ + float confidenceTime = + ((float)FailSafe::FAILSAFE_VERTICAL_VELOCITY_TRIGGER_CONFIDENCE * + (float)FailSafe::FAILSAFE_VERTICAL_VELOCITY_TRIGGER_PERIOD) / + 1000.f; + float targetReachTime = (-MOCK_INITIAL_VERTICAL_VELOCITY - + FailSafe::FAILSAFE_VERTICAL_VELOCITY_THRESHOLD) / + MOCK_VELOCITY_DECELERATION; + TRACE("Target reach time: %f [s]\n", targetReachTime); + TRACE("Confidence time: %f [s]\n", confidenceTime); + + return confidenceTime + targetReachTime + 1; +} + +int main() +{ + + // Insert the modules + ModuleManager::getInstance().insert<BoardScheduler>(new BoardScheduler()); + ModuleManager::getInstance().insert<NASController>(new NASMock()); + ModuleManager::getInstance().insert<VerticalVelocityTrigger>( + new VerticalVelocityTrigger()); + + // start the scheduler + TRACE("Starting the board scheduler\n"); + if (!ModuleManager::getInstance().get<BoardScheduler>()->start()) + { + TRACE("Error starting the General Purpose Scheduler\n"); + halt(); + } + + // start the modules + if (!ModuleManager::getInstance().get<NASController>()->start()) + { + TRACE("Error starting the NAS Controller\n"); + halt(); + } + if (!ModuleManager::getInstance() + .get<VerticalVelocityTrigger>() + ->startModule()) + { + TRACE("Error starting the Vertical Velocity Trigger\n"); + halt(); + } + + ModuleManager::getInstance().get<VerticalVelocityTrigger>()->enable(); + + TRACE("Starting... \n"); + // wait for the trigger + int count = 0; + int maxWaitTime = calculateMaxWaitTime() * 100; + while ( + ModuleManager::getInstance().get<VerticalVelocityTrigger>()->isActive()) + { + Thread::sleep(100); + count++; + + if (count > maxWaitTime) + { + TRACE("Vertical Velocity Trigger not working properly\n"); + break; + } + } + if (count < maxWaitTime) + { + TRACE("Vertical Velocity Triggered \n"); + } + + halt(); +} -- GitLab